|
16.6.2004 |
EN |
Official Journal of the European Union |
L 216/3 |
Corrigendum to Commission Directive 2004/73/EC of 29 April 2004 adapting to technical progress for the 29th time Council Directive 67/548/EEC on the approximation of the laws, regulations and administrative provisions relating to the classification, packaging and labelling of dangerous substances
(‘Official Journal of the European Union’ L 152 of 30 April 2004)
Directive 2004/73/EC should read as follows:
‘
COMMISSION DIRECTIVE 2004/73/EC
of 29 April 2004
adapting to technical progress for the 29th time Council Directive 67/548/EEC on the approximation of the laws, regulations and administrative provisions relating to the classification, packaging and labelling of dangerous substances
(Text with EEA relevance)
THE COMMISSION OF THE EUROPEAN COMMUNITIES,
Having regard to the Treaty establishing the European Community,
Having regard to Council Directive 67/548/EEC of 27 June 1967 on the approximation of the laws, regulations and administrative provisions relating to the classification, packaging and labelling of dangerous substances (1), and in particular Article 28 thereof,
Whereas:
|
(1) |
Annex I to Directive 67/548/EEC contains a list of dangerous substances, together with particulars of the classification and labelling of each substance. That list needs to be updated to include further notified new substances and further existing substances as well adapting the existing entries to technical progress such as setting environmental concentration limits for certain substances. Accordingly it is also necessary to delete entries for certain substances and to split some entries because the classification no longer applies to all the substances under those entries. The labelling of substances containing 1,3-butadiene should be changed in order to reflect that that substance will be classified as a mutagen by the present Directive. |
|
(2) |
Annex V to Directive 67/548/EEC lays down the methods for the determination of the physicochemical properties, toxicity and ecotoxicity of substances and preparations. It is appropriate to amend that Annex in order to obtain a reduction to a minimum of the number of animals used for experimental purposes, in accordance with Council Directive 86/609/EEC of 24 November 1986 on the approximation of laws, regulations and administrative provisions of the Member States regarding the protection of animals used for experimental and other scientific purposes (2). The methods for subchronic oral toxicity in Chapters B.1, B.4, B.5, B.31 and B.35 should be revised accordingly. Furthermore, Chapter B.42 should be added to Annex V in order to make available a refined method on subchronic oral toxicity. Finally, Chapter A.21 on physico-chemical properties, Chapter B.43 on subchronic oral toxicity and Chapters C.21 to C.24 on environmental toxicity should be added in order to allow for the determination of properties which are not yet sufficiently covered by the methods in Annex V. |
|
(3) |
The measures provided for in this Directive are in accordance with the opinion of the Committee on the Adaptation to Technical Progress of the Directives for the Elimination of Technical Barriers to Trade with Dangerous Substances and Preparations, |
HAS ADOPTED THIS DIRECTIVE:
Article 1
Directive 67/548/EEC is amended as follows:
|
1. |
Annex I is amended as follows:
|
|
2. |
Annex V is amended as follows:
|
Article 2
1. Member States shall bring into force the laws, regulations and administrative provisions necessary to comply with this Directive by 31 October 2005 at the latest. They shall forthwith communicate to the Commission the text of those provisions and a correlation table between those provisions and this Directive. When Member States adopt those provisions, they shall contain a reference to this Directive or be accompanied by such a reference on the occasion of their official publication. Member States shall determine how such reference is to be made.
2. Member States shall communicate to the Commission the main provisions of national law which they adopt in the field covered by this Directive.
Article 3
This Directive shall enter into force on the twentieth day following its publication in the Official Journal of the European Union.
Article 4
This Directive is addressed to the Member States.
Done at Brussels, 29 April 2004.
For the Commission
Margot WALLSTRÖM
Member of the Commission
ANNEX 1A
‘Note K:
The classification as a carcinogen or mutagen need not apply if it can be shown that the substance contains less than 0.1 % w/w 1,3-butadiene (Einecs No 203-450-8). If the substance is not classified as a carcinogen or mutagen, at least the S-phrases (2-)9-16 should apply. This note applies to certain complex oil-derived substances in Annex I.’
ANNEX 1B
|
Index No |
chemical name |
Notes related to substances |
EC No |
CAS No |
Classification |
Labelling |
Concentration Limits |
Notes related to preparations |
|
‘006-005-00-4 |
thiram tetramethylthiuram disulphide |
|
205-286-2 |
137-26-8 |
Xn; R20/22-48/22 Xi; R36/38 R43 N; R50-53 |
Xn; N R: 20/22-36/38-43-48/22-50/53 S: (2-)26-36/37-60-61 |
C ≥ 25 %: Xn, N; R20/22-36/38-43-48/22-50/53 20 % ≤ C < 25 %: Xn, N; R36/38-43-48/22-50/53 10 % ≤ C < 20 %: Xn, N; R43-48/22-50/53 2,5 % ≤ C < 10 %: Xi, N; R43-50/53 1 % ≤ C < 2,5 %: Xi, N; R43-51/53 0,25 % ≤ C < 1 %: N; R51/53 0,025 % ≤ C < 0,25 %: R52/53 |
|
|
006-006-01-7 |
hydrogen cyanide …% hydrocyanic acid …% |
B |
200-821-6 |
74-90-8 |
T+; R26/27/28 N; R50-53 |
T+; N R: 26/27/28-50/53 S: (1/2-)7/9-16-36/37-38-45-60-61 |
C ≥ 25 %: T+, N; R26/27/28-50-53 7 % ≤ C < 25 %: T+, N; R26/27/28-51-53 2,5 % ≤ C < 7 %: T, N; R23/24/25-51-53 1 % ≤ C < 2,5 %: T, N; R23/24/25-52-53 0,25 % ≤ C < 1 %: Xn; R20/21/22-52-53 0,1 % ≤ C < 0,25 %: Xn; R20/21/22 |
|
|
006-012-00-2 |
ziram (ISO) zinc bis dimethyldithiocarbamate |
|
205-288-3 |
137-30-4 |
T+; R26 Xn; R22-48/22 Xi; R37-41 R43 N; R50-53 |
T+; N R: 22-26-37-41-43-48/22-50/53 S: (1/2-)22-26-28-36/37/39-45-60-61 |
C ≥ 25 %: T+, N; R22-26-37-41-43-48/22-50-53 20 % ≤ C < 25 %: T+, N; R26-37-41-43-48/22-50-53 10 % ≤ C < 20 %: T+, N; R26-41-43-48/22-50-53 7 % ≤ C < 10 %: T+, N; R26-36-43-50-53 5 % ≤ C < 7 %: T, N; R23-36-43-50-53 1 % ≤ C < 5 %: T, N; R23-43-50-53 0,25 % ≤ C < 1 %: Xn, N; R20-50-53 0,1 % ≤ C < 0,25 %: Xn, N; R20-51-53 0,025 % ≤ C < 0,1 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
006-021-00-1 |
linuron (ISO) 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
E |
206-356-5 |
330-55-2 |
Repr. Cat. 2; R61 Repr. Cat. 3; R62 Carc. Cat. 3; R40 Xn; R22-48/22 N; R50-53 |
T; N R: 61-22-40-48/22-62-50/53 S: 53-45-60-61 |
|
|
|
006-044-00-7 |
isoproturon 3-(4-isopropylphenyl)-1,1-dimethylurea |
|
251-835-4 |
34123-59-6 |
Carc. Cat. 3; R40 N; R50-53 |
Xn; N R: 40-50/53 S: (2-)36/37-60-61 |
C ≥ 2,5 %: Xn, N; R40-50-53 1 % ≤ C < 2,5 %: Xn, N; R40-51-53 0,25 % ≤ C < 1 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
006-072-00-X |
S-benzyl N,N-dipropylthiocarbamate prosulfocarb |
|
401-730-6 |
52888-80-9 |
Xn; R22 R43 N; R51-53 |
Xn; N R: 22-43-51/53 S: (2-)24-37-61 |
|
|
|
006-089-00-2 |
chlorine dioxide |
|
233-162-8 |
10049-04-4 |
O; R8 R6 T+; R26 C; R34 N; R50 |
O; T+; N R: 6-8-26-34-50 S: (1/2-)23-26-28-36/37/39-38-45-61 |
C ≥ 5 %: T+; N; R26-34-50 1 % ≤ C < 5 %: T+; N; R26-36/37/38-50 0,5 % ≤ C < 1 %: T; N; R23-36/37/38-50 0,2 % ≤ C < 0,5 %: T; N; R23-50 0,02 % ≤ C < 0,2 %: Xn; N; R20-50 |
|
|
006-089-01-X |
chlorine dioxide … % |
B |
233-162-8 |
10049-04-4 |
T; R25 C; R34 N; R50 |
T; N R: 25-34-50 S: (1/2-)23-26-28-36/37/39-45-61 |
C ≥ 25 %: T; N; R25-34-50 10 % ≤ C < 25 %: C, N; R22-34-50 3 % ≤ C < 10 %: Xn; N; R22-36/37/38-50 0,3 % ≤ C < 3 %: Xi; R36 |
|
|
007-001-00-5 |
ammonia, anhydrous |
|
231-635-3 |
7664-41-7 |
R10 T; R23 C; R34 N; R50 |
T; N R: 10-23-34-50 S: (1/2-)9-16-26-36/37/39-45-61 |
C ≥ 25 %: T, N; R23-34-50 5 % ≤ C < 25 %: T; R23-34 0,5 % ≤ C < 5 %: Xn; R20-36/37/38 |
|
|
007-008-00-3 |
hydrazine |
E |
206-114-9 |
302-01-2 |
R10 Carc. Cat. 2; R45 T; R23/24/25 C; R34 R43 N; R50-53 |
T; N R: 45-10-23/24/25-34-43-50/53 S: 53-45-60-61 |
C ≥ 25 %: T, N; R45-23/24/25-34-43-50/53 10 % ≤ C < 25 %: T, N; R45-20/21/22-34-43-51/53 3 % ≤ C < 10 %: T, N; R45-20/21/22-36/38-43-51/53 2,5 % ≤ C < 3 %: T, N; R45-43-51/53 1 % ≤ C < 2,5 %: T; R45-43-52/53 0,25 % ≤ C < 1 %: T; R45-52/53 0,1 % ≤ C < 0,25 %: T; R45 |
|
|
007-010-00-4 |
sodium nitrite |
|
231-555-9 |
7632-00-0 |
O; R8 T; R25 N; R50 |
O; T; N R: 8-25-50 S: (1/2-)45-61 |
C ≥ 25 %: T, N; R25-50 5 % ≤ C < 25 %: T; R25 1 % ≤ C < 5 %: Xn; R22 |
|
|
007-011-00-X |
potassium nitrite |
|
231-832-4 |
7758-09-0 |
O; R8 T; R25 N; R50 |
O; T; N R: 8-25-50 S: (1/2-)45-61 |
C ≥ 25 %: T, N; R25-50 5 % ≤ C < 25 %: T; R25 1 % ≤ C < 5 %: Xn; R22 |
|
|
007-013-00-0 |
1,2-dimethylhydrazine |
E |
— |
540-73-8 |
Carc. Cat. 2; R45 T; R23/24/25 N; R51-53 |
T; N R: 45-23/24/25-51/53 S: 53-45-61 |
C ≥ 25 %: T, N; R45-23/24/25-51/53 3 % ≤ C < 25 %: T; R45-20/21/22-52/53 2,5 % ≤ C < 3 %: T; R45-52/53 0,01 % ≤ C < 2,5 %: T; R45 |
|
|
007-017-00-2 |
isobutyl nitrite |
E |
208-819-7 |
542-56-3 |
F; R11 Xn; R20/22 Carc. Cat. 2; R45 Muta. Cat. 3; R68 |
F; T R: 11-20/22-45-68 S: 53-45 |
|
|
|
007-027-00-7 |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane |
|
420-190-2 |
— |
Xn; R21/22-48/21 C; R34 R43 N; R50-53 |
C; N R: 21/22-34-43-48/21-50/53 S: (1/2-)7-26-36/37/39-45-60-61 |
|
|
|
008-003-00-9 |
hydrogen peroxide solution … % |
B |
231-765-0 |
7722-84-1 |
R5 O; R8 C; R35 Xn; R20/22 |
O; C R: 5-8-20/22-35 S: (1/2-)17-26-28-36/37/39-45 |
C ≥ 70 %: C; R20/22-35 50 % ≤ C < 70 %: C; R20/22-34 35 % ≤ C < 50 %: Xn; R22-37/38-41 8 % ≤ C < 35 %: Xn; R22-41 5 % ≤ C < 8 %: Xi; R36 Footnote: C ≥ 70 %: R5, O;R8 50 % ≤ C < 70 %: O; R8 |
|
|
009-015-00-7 |
sulphuryl difluoride |
|
220-281-5 |
2699-79-8 |
T; R23 Xn; R48/20 N; R50 |
T; N R: 23-48/20-50 S: (1/2-)45-63-60-61 |
|
|
|
015-002-00-7 |
red phosphorus |
|
231-768-7 |
7723-14-0 |
F; R11 R16 R52-53 |
F R: 11-16-52/53 S: (2-)7-43-61 |
|
|
|
015-014-00-2 |
tributyl phosphate |
|
204-800-2 |
126-73-8 |
Carc.Cat.3; R40 Xn; R22 Xi; R38 |
Xn R: 22-38-40 S: (2-)36/37-46 |
|
|
|
015-015-00-8 |
tricresyl phosphate tritolyl phosphate o-o-o, o-o-m, o-o-p, o-m-m, o-m-p, o-p-p |
C |
201-103-5 |
78-30-8 |
T; R39/23/24/25 N; R51-53 |
T; N R: 39/23/24/25-51/53 S: (1/2-)20/21-28-45-61 |
C ≥ 25 %: T, N; R39/23/24/25-51/53 2,5 % ≤ C < 25 %: T; R39/23/24/25-52/53 1 % ≤ C < 2,5 %: T; R39/23/24/25 0,2 % ≤ C < 1 %: Xn; R68/20/21/22 |
|
|
015-016-00-3 |
tricresyl phosphate tritolyl phosphate m-m-m, m-m-p, m-p-p, p-p-p |
C |
201-105-6 |
78-32-0 |
Xn; R21/22 N; R51-53 |
Xn; N R: 21/22-51/53 S: (2-)28-61 |
C ≥ 25 %: Xn, N; R21/22-51/53 5 % ≤ C < 25 %: Xn; R21/22-52/53 2,5 % ≤ C < 5 %: R52/53 |
|
|
015-020-00-5 |
mevinphos (ISO) 2-methoxycarbonyl-1-methylvinyl dimethyl phosphate |
|
232-095-1 |
7786-34-7 |
T+; R27/28 N; R50-53 |
T+; N R: 27/28-50/53 S: (1/2-)23-28-36/37-45-60-61 |
C ≥ 7 %: T+, N; R27/28-50-53 1 % ≤ C < 7 %: T, N; R24/25-50-53 0,1 % ≤ C < 1 %: Xn, N; R21/22-50-53 0,0025 % ≤ C < 0,1 %: N; R50-53 0,00025 % ≤ C < 0,0025 %: N; R51-53 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
015-021-00-0 |
trichlorfon (ISO) dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate |
|
200-149-3 |
52-68-6 |
Xn; R22 R43 N; R50-53 |
Xn; N R: 22-43-50/53 S: (2-)24-37-60-61 |
C ≥ 25 %: Xn, N; R22-43-50-53 1 % ≤ C < 25 %: Xi, N; R43-50-53 0,025 % ≤ C < 1 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-027-00-3 |
sulfotep (ISO) O,O,O,O-tetraethyl dithiopyrophosphate |
|
222-995-2 |
3689-24-5 |
T+; R27/28 N; R50-53 |
T+; N R: 27/28-50/53 S: (1/2-)23-28-36/37-45-60-61 |
C ≥ 7 %: T+, N; R27/28-50-53 1 % ≤ C < 7 %: T, N; R24/25-50-53 0,1 % ≤ C < 1 %: Xn, N; R21/22-50-53 0,025 % ≤ C < 0,1 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-032-00-0 |
prothoate (ISO) O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate |
|
218-893-2 |
2275-18-5 |
T+; R27/28 R52-53 |
T+ R: 27/28-52/53 S: (1/2-)28-36/37-45-61 |
|
|
|
015-033-00-6 |
phorate (ISO) O,O-diethyl ethylthiomethyl phosphorodithioate |
|
206-052-2 |
298-02-2 |
T+; R27/28 N; R50-53 |
T+; N R: 27/28-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 7 %: T+, N; R27/28-50-53 1 % ≤ C < 7 %: T, N; R24/25-50-53 0,1 % ≤ C < 1 %: Xn, N; R21/22-50-53 0,025 % ≤ C < 0,1 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-034-00-1 |
parathion (ISO) O,O-diethyl O-4-nitrophenyl phosphorothioate |
|
200-271-7 |
56-38-2 |
T+; R26/28 T; 24-48/25 N; R50-53 |
T+; N R: 24-26/28-48/25-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 25 %: T+, N; R24-26/28-48/25-50-53 10 % ≤ C < 25 %: T+, N; R21-26/28-48/25-50-53 7 % ≤ C < 10 %: T+, N; R21-26/28-48/22-50-53 3 % ≤ C < 7 %: T, N; R21-23/25-48/22-50-53 1 % ≤ C < 3 %: T, N; R23/25-48/22-50-53 0,25 % ≤ C < 1 %: Xn, N; R20/22-50-53 0,1 % ≤ C < 0,25 %: Xn, N; R20/22-51-53 0,025 % ≤ C < 0,1 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-035-00-7 |
parathion - methyl (ISO) O,O-dimethyl O-4-nitrophenyl phosphorothioate |
|
206-050-1 |
298-00-0 |
R5 R10 T+; R26/28 T; R24 Xn; R48/22 N; R50-53 |
T+; N R: 5-10-24-26/28-48/22-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 25 %: T+, N; R24-26/28-48/22-50-53 10 % ≤ C < 25 %: T+, N; R21-26/28-48/22-50-53 7 % ≤ C < 10 %: T+, N; R21-26/28-50-53 3 % ≤ C < 7 %: T, N; R21-23/25-50-53 1 % ≤ C < 3 %: T, N; R23/25-50-53 0,25 % ≤ C < 1 %: Xn, N; R20/22-50-53 0,1 % ≤ C < 0,25 %: Xn, N; R20/22-51-53 0,025 % ≤ C < 0,1 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-041-00-X |
malathion (ISO) 1,2-bis (ethoxycarbonyl) ethyl O,O-dimethyl phosphorodithioate |
|
204-497-7 |
121-75-5 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)24-60-61 |
C ≥ 25 %: Xn, N; R22-50-53 0,25 % ≤ C < 25 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-042-00-5 |
chlorthion (common name not adopted by ISO) O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
|
207-902-5 |
500-28-7 |
Xn; R20/21/22 N; R50-53 |
Xn; N R: 20/21/22-50/53 S: (2-)13-60-61 |
C ≥ 25 %: Xn, N; R20/21/22-50-53 0,25 % ≤ C < 25 %: N; R50-53 0,025 % ≤ C < 0,25: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-047-00-2 |
ethion (ISO) O,O,O′,O′-tetraethyl S,S′-methylenedi (phosphorodithioate) diethion |
|
209-242-3 |
563-12-2 |
T; R25 Xn; R21 N; R50-53 |
T; N R: 21-25-50/53 S: (1/2-)25-36/37-45-60-61 |
C ≥ 25 %: T, N; R21-25-50-53 3 % ≤ C < 25 %: Xn, N; R22-50-53 0,0025 % ≤ C < 3 %: N; R50-53 0,00025 % ≤ C < 0,0025 %: N; R51-53 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
015-052-00-X |
fenchlorphos (ISO) O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate |
|
206-082-6 |
299-84-3 |
Xn; R21/22 N; R50-53 |
Xn; N R: 21/22-50/53 S: (2-)25-36/37-60-61 |
|
|
|
015-055-00-6 |
naled (ISO) 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
|
206-098-3 |
300-76-5 |
Xn; R21/22 Xi; R36/38 N; R50 |
Xn; N R: 21/22-36/38-50 S: (2-)36/37-61 |
C ≥ 25 %: Xn, N; R21/22-36/38-50 20 % ≤ C < 25 %: Xi, N; R36/38-50 0,025 % ≤ C < 20 %: N; R50 |
|
|
015-063-00-X |
dioxathion (ISO) 1,4-dioxan-2,3-diyl-O,O,O′,O′-tetraethyl di(phosphorodithioate) |
|
201-107-7 |
78-34-2 |
T+; R26/28 T; R24 N; R50-53 |
T+; N R: 24-26/28-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 25 %: T+, N; R24-26/28-50-53 7 % ≤ C < 25 %: T+, N; R21-26/28-50-53 3 % ≤ C < 7 %: T, N; R21-23/25-50-53 1 % ≤ C < 3 %: T, N; R23/25-50-53 0,1 % ≤ C < 1 %: Xn, N; R20/22-50-53 0,025 % ≤ C < 0,1 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-065-00-0 |
S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate |
|
— |
2703-37-9 |
T+; R26/27/28 N; R51-53 |
T+; N R: 26/27/28-51/53 S: (1/2-)13-28-45-61 |
|
|
|
015-076-00-0 |
potasan O,O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate |
|
— |
299-45-6 |
T+; R26/27/28 N; R50-53 |
T+; N R: 26/27/28-50/53 S: (1/2-)13-28-45-60-61 |
C ≥ 7 %: T+, N; R26/27/28-50-53 1 % ≤ C < 7 %: T, N; R23/24/25-50-53 0,1 % ≤ C < 1 %: Xn, N; R20/21/22-50-53 0,025 % ≤ C < 0,1 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-078-00-1 |
demeton-S-methylsulphon S-2-ethylsulphonylethyl dimethyl phosphorothioate |
|
241-109-5 |
17040-19-6 |
T; R25 Xn; R21 N; R51-53 |
T; N R: 21-25-51/53 S: (1/2-)22-28-36/37-45-61 |
|
|
|
015-083-00-9 |
bensulide (ISO) O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate |
|
212-010-4 |
741-58-2 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)24-36-60-61 |
|
|
|
015-084-00-4 |
chlorpyrifos (ISO) O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
|
220-864-4 |
2921-88-2 |
T; R25 N; R50-53 |
T; N R: 25-50/53 S: (1/2-)45-60-61 |
C ≥ 25 %: T, N; R25-50-53 3 % ≤ C < 25 %: Xn, N; R22-50-53 0,0025 % ≤ C < 3 %: N; R50-53 0,00025 % ≤ C < 0,0025 %: N; R51-53 0,000025 % ≤ C < 0,00025 %: R52-53 |
|
|
015-095-00-4 |
methamidophos (ISO) O,S-dimethyl phosphoramidothioate |
|
233-606-0 |
10265-92-6 |
T+; R26/28 T; R24 N; R50 |
T+; N R: 24-26/28-50 S: (1/2-)28-36/37-45-61 |
|
|
|
015-096-00-X |
oxydisulfoton; O,O-diethyl S-[2-(ethylsulphinyl)ethyl] phosphorodithioate |
|
219-679-1 |
2497-07-6 |
T+; R28 T; R24 N; R50-53 |
T+; N R: 24-28-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 25 %: T+, N; R24-28-50-53 7 % ≤ C < 25 %: T+, N; R21-28-50-53 3 % ≤ C < 7 %: T, N; R21-25-50-53 1 % ≤ C < 3 %: T, N; R25-50-53 0,25 % ≤ C < 1 %: Xn, N; R22-50-53 0,1 % ≤ C < 0,25 %: Xn, N; R22-51-53 0,025 % ≤ C < 0,1 %: R52-53 |
|
|
015-097-00-5 |
phenthoate (ISO) ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate |
|
219-997-0 |
2597-03-7 |
Xn; R21/22 N; R50-53 |
Xn; N R: 21/22-50/53 S: (2-)22-36/37-60-61 |
C ≥ 25 %: Xn, N; R21/22-50-53 0,25 % ≤ C < 25 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-100-00-X |
phoxim (ISO) α-(diethoxyphosphinothioylimino) phenylacetonitrile |
|
238-887-3 |
14816-18-3 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)36-60-61 |
C ≥ 25 %: Xn, N; R22-50-53 0,025 % ≤ C < 25 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-101-00-5 |
phosmet (ISO) O,O-dimethyl phthalimidomethyl S-phosphorodithioate |
|
211-987-4 |
732-11-6 |
Xn; R21/22 N; R50-53 |
Xn; N R: 21/22-50/53 S: (2-)22-36/37-60-61 |
C ≥ 25 %: Xn, N; R21/22-50-53 0,25 % ≤ C < 25 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-105-00-7 |
triphenyl phosphite |
|
202-908-4 |
101-02-0 |
Xi; R36/38 N; R50-53 |
Xi; N R: 36/38-50/53 S: (2-)28-60-61 |
C ≥ 25 %: Xi, N; R36/38-50/53 5 % ≤ C < 25 %: Xi, N; R36/38-51/53 2,5 % ≤ C < 5 %: N; R51/53 0,25 % ≤ C < 2,5 %: R52/53 |
|
|
015-107-00-8 |
ethoprophos (ISO) ethyl-S,S-dipropyl phosphorodithioate |
|
236-152-1 |
13194-48-4 |
T+; R26/27 T; R25 R43 N; R50-53 |
T+; N R: 25-26/27-43-50/53 S: (1/2-)27/28-36/37/39-45-60-61 |
|
|
|
015-108-00-3 |
bromophos (ISO) O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
|
218-277-3 |
2104-96-3 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)36-60-61 |
C ≥ 25 %: Xn, N; R22-50-53 0,25 % ≤ C < 25 %: N; R50-53 0,025 % ≤ C < 0,25: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-109-00-9 |
crotoxyphos (ISO) 1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate |
|
231-720-5 |
7700-17-6 |
T; R24/25 N; R50-53 |
T; N R: 24/25-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 25 %: T, N; R24/25-50-53 3 % ≤ C < 25 %: Xn, N; R21/22-50-53 2,5 % ≤ C < 3 %: N; R50-53 0,25 % ≤ C < 2,5 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-110-00-4 |
cyanofenphos (ISO) O-4-cyanophenyl O-ethyl phenylphosphonothioate |
|
— |
13067-93-1 |
T; R25-39/25 Xn; R21 Xi; R36 N; R51-53 |
T; N R: 21-25-36-39/25-51/53 S: (1/2-)36/37-45-61 |
|
|
|
015-114-00-6 |
chlormephos (ISO) S-chloromethyl O,O-diethyl phosphorodithioate |
|
246-538-1 |
24934-91-6 |
T+; R27/28 N; R50-53 |
T+; N R: 27/28-50/53 S: (1/2-)28-36/37-45-60-61 |
|
|
|
015-115-00-1 |
chlorthiophos (ISO) |
|
244-663-6 |
21923-23-9 |
T+; R28 T; R24 N; R50-53 |
T+; N R: 24-28-50/53 S: (1/2-)28-36/37-45-60-61 |
|
|
|
015-122-00-X |
O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethylphosphorothioate etrimfos |
|
253-855-9 |
38260-54-7 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)60-61 |
C ≥ 25 %: Xn, N; R22-50-53 2,5 % ≤ C < 25 %: N; R50-53 0,25 % ≤ C < 2,5 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-123-00-5 |
fenamiphos (ISO) ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate |
|
244-848-1 |
22224-92-6 |
T+; R28 T; R24 N; R50-53 |
T+; N R: 24-28-50/53 S: (1/2-)23-28-36/37-45-60-61 |
C ≥ 25 %: T+, N; R24-28-50-53 7 % ≤ C < 25 %: T+, N; R21-28-50-53 3 % ≤ C < 7 %: T, N; R21-25-50-53 1 % ≤ C < 3 %: T, N; R25-50-53 0,25 % ≤ C < 1 %: Xn, N; R22-50-53 0,1 % ≤ C < 0,25 %: Xn, N; R22-51-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-126-00-1 |
heptenophos (ISO) 7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate |
|
245-737-0 |
23560-59-0 |
T; R25 N; R50-53 |
T; N R: 25-50/53 S: (1/2-)23-28-37-45-60-61 |
C ≥ 25 %: T, N; R25-50-53 3 % ≤ C < 25 %: Xn, N; R22-50-53 0,25 % ≤ C < 3 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-127-00-7 |
iprobenfos S-benzyl diisopropyl phosphorothioate |
|
247-449-0 |
26087-47-8 |
Xn; R22 N; R51-53 |
Xn; N R: 22-51/53 S: (2-)61 |
|
|
|
015-128-00-2 |
IPSP S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate |
|
— |
5827-05-4 |
T+; R27 T; R25 N; R50-53 |
T+; N R: 25-27-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 25 %: T+, N; R25-27-50-53 7 % ≤ C < 25 %: T+, N; R22-27-50-53 3 % ≤ C < 7 %: T, N; R22-24-50-53 1 % ≤ C < 3 %: T, N; R24-50-53 0,25 % ≤ C < 1 %: Xn, N; R21-50-53 0,1 % ≤ C < 0,25 %: Xn, N; R21-51-53 0,025 % ≤ C < 0,1 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-129-00-8 |
isofenphos (ISO) O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate |
|
246-814-1 |
25311-71-1 |
T; R24/25 N; R50-53 |
T; N R: 24/25-50/53 S: (1/2-)36/37-45-60-61 |
C ≥ 25 %: T, N; R24/25-50-53 3 % ≤ C < 25 %: Xn, N; R21/22-50-53 0,25 % ≤ C < 3 %: N; R50-53 0,025 % ≤ C < 0,25: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-131-00-9 |
isoxathion (ISO) O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate |
|
242-624-8 |
18854-01-8 |
T; R24/25 N; R50-53 |
T; N R: 24/25-50/53 S: (1/2-)28-36/37-45-60-61 |
|
|
|
015-132-00-4 |
S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate methylcarbophenothione |
|
— |
953-17-3 |
T; R24/25 N; R50-53 |
T; N R: 24/25-50/53 S: (1/2-)28-36/37-45-60-61 |
C ≥ 25 %: T, N; R24/25-50-53 3 % ≤ C < 25 %: Xn, N; R21/22-50-53 0,025 % ≤ C < 3 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-133-00-X |
piperophos (ISO) S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate |
|
— |
24151-93-7 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)60-61 |
C ≥ 25 %: Xn, N; R22-50-53 2,5 % ≤ C < 25 %: N; R50-53 0,25 % ≤ C < 2,5 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
015-134-00-5 |
pirimiphos-methyl (ISO) O-(2-diethylamino-6-methylpyrimidin-4-yl) O,O-dimethyl phosphorothioate |
|
249-528-5 |
29232-93-7 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)60-61 |
|
|
|
015-135-00-0 |
O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate profenofos (ISO) |
|
255-255-2 |
41198-08-7 |
Xn; R20/21/22 N; R50-53 |
Xn; N R: 20/21/22-50/53 S: (2-)36/37-60-61 |
C ≥ 25 %: Xn, N; R20/21/22-50-53 0,025 % ≤ C < 25 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-136-00-6 |
trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate propetamphos (ISO) |
|
250-517-2 |
31218-83-4 |
T; R25 N; R50-53 |
T; N R: 25-50/53 S: (1/2-)37-45-60-61 |
C ≥ 25 %: T, N; R25-50-53 3 % ≤ C < 25 %: Xn, N; R22-50-53 0,25 % ≤ C < 3 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
015-138-00-7 |
quinalphos (ISO) O,O-diethyl-O-quinoxalin-2-yl phosphorothioate |
|
237-031-6 |
13593-03-8 |
T; R25 Xn; R21 N; R50-53 |
T; N R: 21-25-50/53 S: (1/2-)22-36/37-45-60-61 |
C ≥ 25 %: T, N; R21-25-50-53 3 % ≤ C < 25 %: Xn, N; R22-50-53 0,025 % ≤ C < 3 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-139-00-2 |
S-tert-butylthiomethyl O,O-diethylphosphorodithioate terbufos (ISO) |
|
235-963-8 |
13071-79-9 |
T+; R27/28 N; R50-53 |
T+; N R: 27/28-50/53 S: (1/2-)36/37-45-60-61 |
C ≥ 7 %: T+, N; R27/28-50-53 1 % ≤ C < 7 %: T, N; R24/25-50-53 0,1 % ≤ C < 1 %: Xn, N; R21/22-50-53 0,025 % ≤ C < 0,1 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
015-154-00-4 |
2-chloroethylphosphonic acid ethephon |
|
240-718-3 |
16672-87-0 |
Xn; R20/21 C; R34 R52-53 |
C R: 20/21-34-52/53 S: (1/2-)26-28-36/37/39-45-61 |
C ≥ 25 %: C; R20/21-34-52/53 10 % ≤ C < 25 %: C; R34 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
015-179-00-0 |
UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C 16-18 tallow alkylamine |
|
422-720-8 |
166242-53-1 |
Carc. Cat. 3; R40 Xn; R22-48/22 C; R34 R43 N; R50-53 |
C; N R: 22-34-40-43-48/22-50/53 S: (1/2-)26-36/37/39-45-60-61 |
|
|
|
016-001-00-4 |
hydrogen sulphide |
|
231-977-3 |
7783-06-4 |
F+; R12 T+; R26 N; R50 |
F+; T+; N R: 12-26-50 S: (1/2-)9-16-36-38-45-61 |
|
|
|
016-008-00-2 |
ammonium polysulphides |
|
232-989-1 |
9080-17-5 |
R31 C; R34 N; R50 |
C; N R: 31-34-50 S: (1/2-)26-45-61 |
C ≥ 25 %: C, N ; R31-34-50 5 % ≤ C < 25 %: C; R31-34 1 % ≤ C < 5 %: Xi; R31-36/38 |
|
|
016-012-00-4 |
disulphur dichloride sulfur monochloride |
|
233-036-2 |
10025-67-9 |
R14 T; R25 Xn; R20 R29 C; R35 N; R50 |
T; C; N R: 14-20-25-29-35-50 S: (1/2-)26-36/37/39-45-61 |
C ≥ 25 %: T, C, N; R20-25-35-50 10 % ≤ C < 25 %: C; R22-35 5 % ≤ C < 10 %: C; R22-34 3 % ≤ C < 5 %: Xn; R22-36/37/38 1 % ≤ C < 3 %: Xi; R36/37/38 |
|
|
016-013-00-X |
sulphur dichloride |
|
234-129-0 |
10545-99-0 |
R14 C; R34 Xi; R37 N; R50 |
C; N R: 14-34-37-50 S: (1/2-)26-45-61 |
C ≥ 25 %: C, N ; R34-50 10 % ≤ C < 25 %: C; R34 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
016-014-00-5 |
sulphur tetrachloride |
|
— |
13451-08-6 |
R14 C; R34 N; R50 |
C; N R: 14-34-50 S: (1/2-)26-45-61 |
C ≥ 25 %: C, N; R34-50 10 ≤ C < 25 %: C; R34 5 ≤ C < 10 %: Xi; R36/37/38 |
|
|
016-021-00-3 |
methanethiol methyl mercaptan |
|
200-822-1 |
74-93-1 |
F+; R12 T; R23 N; R50-53 |
F+; T; N R: 12-23-50/53 S: (2-)16-25-60-61 |
|
|
|
016-023-00-4 |
dimethyl sulphate |
E |
201-058-1 |
77-78-1 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 T+; R26 T; R25 C; R34 R43 |
T+ R: 45-25-26-34-43-68 S: 53-45 |
C ≥ 25 %: T+; R45-R25-R26-R34-R43-R68 10 % ≤ C < 25 %: T+; R45-R22-R26-R34-R43-R68 7 % ≤ C < 10 %: T+; R45-R22-R26-R36/37/38-R43-R68 5 % ≤ C < 7 %: T; R45-R22-R23-R36/37/38-R43-R68 3 % ≤ C < 5 %: T; R45-R22-R23-R43-R68 1 % ≤ C < 3 %: T; R45-R23-R43-R68 0,1 % ≤ C < 1 %: T; R45-R20-R68 0,01 % ≤ C < 0,1 %: T; R45-R68 |
|
|
016-059-00-0 |
N,N,N′,N′-tetramethyldithiobis(ethylene)diamine dihydrochloride |
|
405-300-9 |
17339-60-5 |
Xn; R22 Xi; R36 R43 N; R50-53 |
Xn; N R: 22-36-43-50/53 S: (2-)26-36/37-60-61 |
|
|
|
017-003-00-8 |
barium chlorate |
|
236-760-7 |
13477-00-4 |
O; R9 Xn; R20/22 N; R51-53 |
O; Xn; N R: 9-20/22-51/53 S: (2-)13-27-61 |
|
|
|
017-004-00-3 |
potassium chlorate |
|
223-289-7 |
3811-04-9 |
O; R9 Xn; R20/22 N; R51-53 |
O; Xn; N R: 9-20/22-51/53 S: (2-)13-16-27-61 |
|
|
|
017-005-00-9 |
sodium chlorate |
|
231-887-4 |
7775-09-9 |
O; R9 Xn; R22 N; R51-53 |
O; Xn; N R: 9-22-51/53 S: (2-)13-17-46-61 |
|
|
|
017-011-00-1 |
sodium hypochlorite, solution … % Cl active |
B |
231-668-3 |
7681-52-9 |
C; R34 R31 N; R50 |
C; N R: 31-34-50 S: (1/2-)28-45-50-61 |
C ≥ 25 %: C, N; R31-34-50 10 % ≤ C < 25 %: C; R31-34 5 % ≤ C < 10 %: Xi; R31-36/38 |
|
|
017-012-00-7 |
calcium hypochlorite |
|
231-908-7 |
7778-54-3 |
O; R8 Xn; R22 R31 C; R34 N; R50 |
O; C; N R: 8-22-31-34-50 S: (1/2-)26-36/37/39-45-61 |
C ≥ 25 %: C, N; R22-34-50 10 % ≤ C < 25 %: C; R34 3 % ≤ C < 10 %: Xi; R37/38-41 0,5 % ≤ C < 3 %: Xi; R36 |
|
|
024-001-00-0 |
chromium (VI) trioxide |
E |
215-607-8 |
1333-82-0 |
O; R9 Carc. Cat. 1; R45 Muta. Cat. 2; R46 Repr. Cat. 3; R62 T+; R26 T; R24/25-48/23 C; R35 R42/43 N; R50-53 |
O; T+; N R: 45-46-9-24/25-26-35-42/43-48/23-62-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R24/25-26-35-42/43-45-46-48/23-50/53-62 10 % ≤ C < 25 %: T+, N; R21/22-26-35-42/43-45-46-48/23-51/53-62 7 % ≤ C < 10 %: T+, N; R21/22-26-34-42/43-45-46-48/20-51/53-62 5 % ≤ C < 7 %: T, N; R21/22-23-34-42/43-45-46-48/20-51/53-62 3 % ≤ C < 5 %: T, N; R21/22-23-36/37/38-42/43-45-46-48/20-51/53 2,5 % ≤ C < 3 %: T, N; R23-36/37/38-42/43-45-46-48/20-51/53 1 % ≤ C < 2,5 %: T; R23-36/37/38-42/43-45-46-48/20-52/53 0,25 % ≤ C < 1 %: T; R20-45-46-52/53 0,1 % ≤ C < 0,25 %: T; R20-45-46 |
|
|
024-002-00-6 |
potassium dichromate |
E |
231-906-6 |
7778-50-9 |
O; R8 Carc. Cat. 2: R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 T+; R26 T; R25-48/23 Xn; R21 C; R34 R42/43 N; 50-53 |
T+; N; O R: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/53 5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/53 3 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/53 2,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/53 1 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/53 0,2 % ≤ C < 0,25 %: T; R45-46-20-42/43 0,1 % ≤ C < 0,2 %: T; R45-46-20 |
3 |
|
024-003-00-1 |
ammonium dichromate |
E |
232-143-1 |
7789-09-5 |
E; R2 O; R8 Carc. Cat. 2; R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 T+; R26 T; R25-48/23 Xn; R21 C; R34 R42/43 N; R50-53 |
E; T+; N R: 45-46-60-61-2-8-21-25-26-34-42/43-48/23-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-50/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-50/53 5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/53 3 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/53 2,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/53 1 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/53 0,2 % ≤ C < 0,25 %: T; R45-46-20-42/43 0,1 % ≤ C < 0,2 %: T; R45-46-20 |
3 |
|
024-004-00-7 |
sodium dichromate anhydrate |
E |
234-190-3 |
10588-01-9 |
O; R8 Carc. Cat. 2; R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 T+; R26 T; R25-48/23 Xn; R21 C; R34 R42/43 N; 50-53 |
T+; N; O R: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/53 5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/53 3 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/53 2,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/53 1 % ≤ C < 2,5 %: T ; R45-46-60-61-23-42/43-48/20-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/53 0,2 % ≤ C < 0,25 %: T; R45-46-20-42/43 0,1 % ≤ C < 0,2 %: T; R45-46-20 |
3 |
|
024-004-01-4 |
sodium dichromate, dihydrate |
E |
234-190-3 |
7789-12-0 |
O; R8 Carc. Cat.2; R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 T+; R26 T; R25-48/23 Xn; R21 C; R34 R42/43 N; R50-53 |
T+; N; O R: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/53 5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/53 3 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/53 2,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/53 1 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/53 0,2 % ≤ C < 0,25 %: T; R45-46-20-42/43 0,1 % ≤ C < 0,2 %: T; R45-46-20 |
3 |
|
024-011-00-5 |
ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) |
|
400-110-2 |
— |
F; R11 N; R50-53 |
F; N R: 11-50/53 S: (2-)33-60-61 |
|
|
|
024-018-00-3 |
sodium chromate |
E |
231-889-5 |
7775-11-3 |
Carc. Cat. 2; R45 Muta. Cat. 2; R46 Repr. Cat.2; R60-61 T+; R26 T; R25-48/23 Xn; R21 C; R34 R42/43 N; R50-53 |
T+; N R: 45-46-60-61-21-25-26-34-42/43-48/23-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/53 5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/53 3 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/53 2,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/53 1 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/53 0,2 % ≤ C < 0,25 %: T; R45-46-20-42/43 0,1 % ≤ C < 0,2 %: T; R45-46-20 |
3 |
|
027-004-00-5 |
cobalt dichloride |
E |
231-589-4 |
7646-79-9 |
Carc. Cat. 2; R49 Xn; R22 R42/43 N; R50-53 |
T; N R: 49-22-42/43-50/53 S: (2-)22-53-45-60-61 |
C ≥ 25 %: T, N; R49-22-42/43-50/53 2,5 % ≤ C < 25 %: T, N; R49-22-42/43-51/53 1 % ≤ C < 2,5 %: T; R49-42/43-52/53 0,25 % ≤ C < 1 %: T; R49-52/53 0,01 % ≤ C < 0,25 %: T; R49 |
1 |
|
027-005-00-0 |
cobalt sulphate |
E |
233-334-2 |
10124-43-3 |
Carc. Cat. 2; R49 Xn; R22 R42/43 N; R50-53 |
T; N R: 49-22-42/43-50/53 S: (2-)22-53-45-60-61 |
C ≥ 25 %: T, N; R49-22-42/43-50/53 2,5 % ≤ C < 25 %: T, N; R49-42/43-51/53 1 % ≤ C < 2,5 %: T; R49-42/43-52/53 0,25 % ≤ C < 1 %: T; R49-52/53 0,01 % ≤ C < 0,25 %: T; R49 |
1 |
|
029-002-00-X |
dicopper oxide copper (I) oxide |
|
215-270-7 |
1317-39-1 |
Xn; R22 N; 50-53 |
Xn; N R: 22-50/53 S: (2-)22-60-61 |
|
|
|
030-001-00-1 |
zinc powder - zinc dust (pyrophoric) |
|
231-175-3 |
7440-66-6 |
F; R15-17 N; R50-53 |
F; N R: 15-17-50/53 S: (2-)43-46-60-61 |
|
|
|
030-002-00-7 |
zinc powder - zinc dust (stabilized) |
|
231-175-3 |
7440-66-6 |
N; R50-53 |
N R: 50/53 S: 60-61 |
|
|
|
030-003-00-2 |
zinc chloride |
|
231-592-0 |
7646-85-7 |
Xn; R22 C; R34 N; R50-53 |
C; N R: 22-34-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R22-34-50/53 10 % ≤ C < 25 %: C, N; R34-51/53 5 % ≤ C < 10 %: Xn, N; R36/37/38-51/53 2.5 % ≤ C < 5 %: N; R51/53 0.25 % ≤ C < 2.5 %: R52/53 |
|
|
030-006-00-9 |
zinc sulphate (hydrous) (mono-, hexa- and hepta hydrate) [1] zinc sulphate (anhydrous) [2] |
|
231-793-3 [1] 231-793-3 [2] |
7446-19-7 [1] 7733-02-0 [2] |
Xn; R22 R41 N; R50-53 |
Xn; N R: 22-41-50/53 S: (2-)22-26-39-46-60-61 |
|
|
|
033-001-00-X |
arsenic |
|
231-148-6 |
7440-38-2 |
T; R23/25 N; R50-53 |
T; N R: 23/25-50/53 S: (1/2-)20/21-28-45-60-61 |
|
|
|
033-002-00-5 |
arsenic compounds, with the exception of those specified elsewhere in this Annex |
A |
— |
— |
T; R23/25 N; R50-53 |
T; N R: 23/25-50/53 S: (1/2-)20/21-28-45-60-61 |
C ≥ 25 %: T, N; R23/25-50/53 2,5 % ≤ C < 25 %: T, N; R23/25-51/53 0,25 % ≤ C < 2,5 %: T; R23/25-52/53 0,2 % ≤ C < 0,25 %: T; R23/25 0,1 % ≤ C < 0,2 %: Xn; R20/22 |
1 |
|
042-002-00-4 |
tetrakis(dimethylditetradecylammonium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdate(4-) |
|
404-760-8 |
117342-25-3 |
T; R23 Xi; R41 R53 |
T R: 23-41-53 S: (1/2-)26-37/39-45-61 |
|
|
|
048-001-00-5 |
cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe), mixture of cadmium sulphide with zinc sulphide (xCdS.yZnS), mixture of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex |
A |
— |
— |
Xn; R20/21/22 N; R50-53 |
Xn; N R: 20/21/22-50/53 S: (2-)60-61 |
C ≥ 25 %: Xn, N; R20/21/22-50/53 2,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/53 0,25 % ≤ C < 2,5 %: Xn; R20/21/22-52/53 0,1 % ≤ C < 0,25 %: Xn; R20/21/22 |
1 |
|
048-003-00-6 |
cadmium diformate cadmiumformate |
|
224-729-0 |
4464-23-7 |
T; R23/25 R33 Xn; R68 N; R50-53 |
T; N R: 23/25-33-68-50/53 S: (1/2-)22-45-60-61 |
C ≥ 25 %: T, N; R23/25-33-50/53-68 10 % ≤ C < 25 %: T, N; R23/25-33-51/53-68 2,5 % ≤ C < 10 %: Xn, N; R20/22-33-51/53-68 1 % ≤ C < 2,5 %: Xn; R20/22-33-52/53-68 0,1 % ≤ C < 1 %: Xn; R20/22-33-52/53 0,25 % ≤ C < 0,1 %: Xn; R20/22-33-52/53 |
|
|
048-004-00-1 |
cadmium cyanide |
|
208-829-1 |
542-83-6 |
T+; R26/27/28 R32 R33 Xn; R68 N; R50-53 |
T+; N R: 26/27/28-32-33-68-50/53 S: (1/2-)7-28-29-45-60-61 |
C ≥ 25 %: T+, N; R26/27/28-32-33-50/53-68 7 % ≤ C < 25 %: T+, N; R26/27/28-32-33-51/53-68 2,5 % ≤ C < 7 %: T, N; R23/24/25-32-33-51/53-68 1 % ≤ C < 2,5 %: T; R23/24/25-32-33-52/53-68 0,25 % ≤ C < 1 %: Xn; R20/21/22-33-52/53 0,1 % ≤ C < 0,25 %: Xn; R20/21/22-33 |
|
|
048-005-00-7 |
cadmiumhexafluorosilicate(2-) cadmium fluorosilica |
|
241-084-0 |
17010-21-8 |
T; R23/25 R33 Xn; R68 N; R50-53 |
T; N R: 23/25-33-68-50/53 S: (1/2-)22-45-60-61 |
C ≥ 25 %: T, N; R23/25-33-50/53-68 10 % ≤ C < 25 %: T, N; R23/25-33-51/53-68 2,5 % ≤ C < 10 %: Xn, N; R20/22-33-51/53-68 1 % ≤ C < 2,5 %: Xn; R20/22-33-52/53-68 0,25 % ≤ C < 1 %: Xn; R20/22-33-52/53 0,1 % ≤ C < 0,25 %: Xn; R20/22-33 |
|
|
048-006-00-2 |
cadmium fluoride |
E |
232-222-0 |
7790-79-6 |
Carc. Cat. 2; R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 T+; R26 T; R25-48/23/25 N; R50-53 |
T+; N R: 45-46-60-61-25-26-48/23/25-50/53 S: 53-45-60-61 |
C ≥ 25 %:: T+, N; R45-46-60-61-25-26-48/23/25-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-25-26-48/23/25-51/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-48/23/25-51/53 2,5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-48/20/22-51/53 1 % ≤ C < 2,5 %: T; R45-46-60-61-22-23-48/20/22-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20/22-48/20/22-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20/22-48/20/22-52/53 0,1 % ≤ C < 0,25 %: T; R45-46-20/22-48/20/22 0,01 % ≤ C < 0,1 %: T; R45 |
|
|
048-007-00-8 |
cadmium iodide |
|
232-223-6 |
7790-80-9 |
T; R23/25 R33 Xn; R68 N; R50-53 |
T; N R: 23/25-33-68-50/53 S: (1/2-)22-45-60-61 |
C ≥ 25 %: T, N; R23/25-33-50/53-68 10 % ≤ C < 25 %: T, N; R23/25-33-51/53-68 2,5 % ≤ C < 10 %: Xn, N; R20/22-33-51/53-68 1 % ≤ C < 2,5 %: Xn; R20/22-33-52/53-68 0,25 % ≤ C < 1 %: Xn; R20/22-33-52/53 0,1 % ≤ C < 0,25 %: Xn; R20/22-33 |
|
|
048-008-00-3 |
cadmium chloride |
E |
233-296-7 |
10108-64-2 |
Carc. Cat. 2; R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 T+; R26 T; R25-48/23/25 N; R50-53 |
T+; N R: 45-46-60-61-25-26-48/23/25-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-46-60-61-25-26-48/23/25-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-25-26-48/23/25-51/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-48/23/25-51/53 2,5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-48/20/22-51/53 1 % ≤ C < 2,5 %: T; R45-46-60-61-22-23-48/20/22-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20/22-48/20/22-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20/22-48/20/22-52/53 0,1 % ≤ C < 0,25 %: T; R45-46-20/22-48/20/22 0,01 % ≤ C < 0,1 %: T; R45 |
|
|
048-009-00-9 |
cadmium sulphate |
E |
233-331-6 |
10124-36-4 |
Carc. Cat. 2; R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 T; R48/23/25 T+; R26 T; R25 N; R50-53 |
T+; N R: 45-46-60-61-25-26-48/23/25-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-46-60-61-25-26-48/23/25-50/53 10 % ≤ C < 25 %: T+, N; R45-46-60-61-25-26-48/23/25-51/53 7 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-48/23/25-51/53 2,5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-48/20/22-51/53 1 % ≤ C < 2,5 %: T; R45-46-60-61-22-23-48/20/22-52/53 0,5 % ≤ C < 1 %: T; R45-46-60-61-20/22-48/20/22-52/53 0,25 % ≤ C < 0,5 %: T; R45-46-20/22-48/20/22-52/53 0,1 % ≤ C < 0,25 %: T; R45-46-20/22-48/20/22 0,01 % ≤ C < 0,1 %: T; R45 |
|
|
048-010-00-4 |
cadmium sulphide |
E |
215-147-8 |
1306-23-6 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 3; R62-63 T; R48/23/25 Xn; R22 R53 |
T; N R: 45-22-48/23/25-62-63-68-53 S: 53-45-61 |
C ≥ 25 %: T; R45-22-48/23/25-62-63-68-53 10 % ≤ C < 25 %: T; R45-22-48/23/25-62-63-68 5 % ≤ C < 10 %: T; R45-48/20/22-62-63-68 1 % ≤ C < 5 %: T; R45-48/20/22-68 0,1 % ≤ C < 1 %: T; R45-48/20/22 |
1 |
|
050-001-00-5 |
tin tetrachloride stannic chloride |
|
231-588-9 |
7646-78-8 |
C; R34 R52-53 |
C R: 34-52/53 S: (1/2-)7/8-26-45-61 |
C ≥ 25 %: C; R34-52/53 10 % ≤ C < 25 %: C; R34 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
050-005-00-7 |
trimethyltin compounds, with the exception of those specified elsewhere in this Annex |
A |
— |
— |
T+; R26/27/28 N; R50-53 |
T+; N R: 26/27/28-50/53 S: (1/2-)26-27-28-45-60-61 |
C ≥ 25 %: T+, N; R26/27/28-50/53 2,5 % ≤ C < 25 %: T+, N; R26/27/28-51/53 0,5 % ≤ C < 2,5 %: T+; R26/27/28-52/53 0,25 % ≤ C < 0,5 %: T; R23/24/25-52/53 0,1 % ≤ C < 0,25 %: T; R23/24/25 0,05 % ≤ C < 0,1 %: Xn; R20/21/22 |
1 |
|
050-006-00-2 |
triethyltin compounds, with the exception of those specified elsewhere in this Annex |
A |
— |
— |
T+; R26/27/28 N; R50-53 |
T+; N R: 26/27/28-50/53 S: (1/2-)26-27-28-45-60-61 |
C ≥ 25 %: T+, N; R26/27/28-50/53 2,5 % ≤ C < 25 %: T+, N; R26/27/28-51/53 0,5 % ≤ C < 2,5 %: T+; R26/27/28-52/53 0,25 % ≤ C < 0,5 %: T; R23/24/25-52/53 0,1 % ≤ C < 0,25 %: T; R23/24/25 0,05 % ≤ C < 0,1 %: Xn; R20/21/22 |
1 |
|
050-007-00-8 |
tripropyltin compounds, with the exception of those specified elsewhere in this Annex |
A |
— |
— |
T; R23/24/25 N; R50-53 |
T; N R: 23/24/25-50/53 S: (1/2-)26-27-28-45-60-61 |
C ≥ 25 %: T, N; R23/24/25-50/53 2,5 % ≤ C < 25 %: T, N; R23/24/25-51/53 0,5 % ≤ C < 2,5 %: T; R23/24/25-52/53 0,25 % ≤ C < 0,5 %: Xn; R20/21/22-52/53 0,1 % ≤ C < 0,25 %: Xn; R20/21/22 |
1 |
|
050-008-00-3 |
tributyltin compounds, with the exception of those specified elsewhere in this Annex |
A |
— |
— |
T; R25-48/23/25 Xn; R21 Xi; R36/38 N; R50-53 |
T; N R: 21-25-36/38-48/23/25-50/53 S: (1/2-)35-36/37/39-45-60-61 |
C ≥ 25 %: T, N; R21-25-36/38-48/23/25-50/53 2,5 % ≤ C < 25 %: T, N; R21-25-36/38-48/23/25-51/53 1 % ≤ C < 2,5 %: T; R21-25-36/38-48/23/25-52/53 0,25 % ≤ C < 1 %: Xn; R22-48/20/22-52/53 |
1 |
|
050-009-00-9 |
fluorotripentylstannane [1] hexapentyldistannoxane [2] |
|
243-546-7 [1] 247-143-7 [2] |
20153-49-5 [1] 25637-27-8 [2] |
Xn; R20/21/22 N; R50-53 |
Xn; N R: 20/21/22-50/53 S: (2-)26-28-60-61 |
C ≥ 25 %: Xn, N; R20/21/22-50/53 2,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/53 1 % ≤ C < 2,5 %: Xn; R20/21/22-52/53 0,25 % ≤ C < 1 %: R52/53 |
1 |
|
050-010-00-4 |
fluorotrihexylstannane |
|
243-547-2 |
20153-50-8 |
Xn; R20/21/22 N; R50-53 |
Xn; N R: 20/21/22-50/53 S: (2-)26-28-60-61 |
C ≥ 25 %: Xn, N; R20/21/22-50/53 2,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/53 1 % ≤ C < 2,5 %: Xn; R20/21/22-52/53 0,25 % ≤ C < 1 %: R52/53 |
1 |
|
050-011-00-X |
triphenyltin compounds, with the exception of those specified elsewhere in this Annex |
A |
— |
— |
T; R23/24/25 N; R50-53 |
T; N R: 23/24/25-50/53 S: (1/2-)26-27-28-45-60-61 |
C ≥ 25 %: T, N; R23/24/25-50/53 2,5 % ≤ C < 25 %: T, N; R23/24/25-51/53 1 % ≤ C < 2,5 %: T; R23/24/25-52/53 0,25 % ≤ C < 1 %: Xn; R20/21/22-52/53 |
1 |
|
050-012-00-5 |
tetracyclohexylstannane [1] chlorotricyclohexylstannane [2] butyltricyclohexylstannane [3] |
A |
215-910-5 [1] 221-437-5 [2] 230-358-5 [3] |
1449-55-4 [1] 3091-32-5 [2] 7067-44-9 [3] |
Xn; R20/21/22 N; R50-53 |
Xn; N R: 20/21/22-50/53 S: (2-)26-28-60-61 |
C ≥ 25 %: Xn, N; R20/21/22-50/53 2,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/53 1 % ≤ C < 2,5 %: Xn; R20/21/22-52/53 0,25 % ≤ C < 1 %: R52/53 |
1 |
|
050-013-00-0 |
trioctyltin compounds, with the exception of those specified elsewhere in this Annex |
A |
— |
— |
Xi; R36/37/38 R53 |
Xi R: 36/37/38-53 S: (2-)61 |
C ≥ 25 %: Xi; R36/37/38-53 1 % ≤ C < 25 %: Xi; R36/37/38 |
1 |
|
051-002-00-3 |
antimony pentachloride |
|
231-601-8 |
7647-18-9 |
C; R34 N; R51-53 |
C; N R: 34-51/53 S: (1/2-)26-45-61 |
C ≥ 25 %: C, N; R34-51/53 10 % ≤ C < 25 %: C; R34-52/53 5 % ≤ C < 10 %: Xi; R36/37/38-52/53 2,5 % ≤ C < 5 %: R52/53 |
|
|
051-003-00-9 |
antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex |
A |
— |
— |
Xn; R20/22 N; R51-53 |
Xn; N R: 20/22-51/53 S: (2-)61 |
C ≥ 25 %: Xn, N; R20/22-51/53 2,5 % ≤ C < 25 %: Xn; R20/22-52/53 0,25 % ≤ C < 2,5 %: Xn; R20/22 |
1 |
|
080-002-00-6 |
inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex |
A |
— |
— |
T+; R26/27/28 R33 N; R50-53 |
T+; N R: 26/27/28-33-50/53 S: (1/2-)13-28-45-60-61 |
C ≥ 25 %: T+, N; R26/27/28-33-50/53 2,5 % ≤ C < 25 %: T+, N; R26/27/28-33-51/53 2 % ≤ C < 2,5 %: T+; R26/27/28-33-52/53 0,5 % ≤ C < 2 %: T; R23/24/25-33-52/53 0,25 % ≤ C < 0,5 %: Xn; R20/21/22-33-52/53 0,1 % ≤ C < 0,25 %: Xn; R20/21/22-33 |
1 |
|
080-004-00-7 |
organic compounds of mercury with the exception of those specified elsewhere in this Annex |
A |
— |
— |
T+; R26/27/28 R33 N; R50-53 |
T+; N R: 26/27/28-33-50/53 S: (1/2-)13-28-36-45-60-61 |
C ≥ 25 %: T+, N; R26/27/28-33-50/53 2,5 % ≤ C < 25 %: T+, N; R26/27/28-33-51/53 1 % ≤ C < 2,5 %: T+; R26/27/28-33-52/53 0,5 % ≤ C < 1 %: T; R23/24/25-33-52/53 0,25 % ≤ C < 0,5 %: Xn; R20/21/22-33-52/53 0,05 % ≤ C < 0,25 %: Xn; R20/21/22-33 |
1 |
|
080-007-00-3 |
dimethylmercury [1] diethylmercury [2] |
|
209-805-3 [1] 211-000-7 [2] |
593-74-8 [1] 627-44-1 [2] |
T+; R26/27/28 R33 N; R50-53 |
T+; N R: 26/27/28-33-50/53 S: (1/2-)13-28-36-45-60-61 |
C ≥ 25 %: T+, N; R26/27/28-33-50/53 2,5 % ≤ C < 25 %: T+, N; R26/27/28-33-51/53 0,5 % ≤ C < 2,5 %: T+; R26/27/28-33-52/53 0,25 % ≤ C < 0,5 %: T; R23/24/25-33-52/53 0,1 % ≤ C < 0,25 %: T; R23/24/25-33 0,05 % ≤ C < 0,1 %: Xn; R20/21/22-33 |
1 |
|
082-001-00-6 |
lead compounds with the exception of those specified elsewhere in this Annex |
AE |
— |
— |
Repr. Cat. 1; R61 Repr. Cat. 3; R62 Xn; R20/22 R33 N; R50-53 |
T; N R: 61-20/22-33-62-50/53 S: 53-45-60-61 |
C ≥ 25 %: T, N; R61-20/22-33-62-50/53 5 % ≤ C < 25 %: T, N; R61-20/22-33-62-51/53 2,5 % ≤ C < 5 %: T, N; R61-20/22-33-62-51/53 1 % ≤ C < 2,5 %: T; R61-20/22-33-52/53 0,5 % ≤ C < 1 %: T; R61-33-52/53 0,25 % ≤ C < 0,5 %: R52/53 |
1 |
|
082-002-00-1 |
lead alkyls |
AE |
— |
— |
Repr. Cat. 1; R61 Repr. Cat. 3; R62 T+; R26/27/28 R33 N; R50-53 |
T+; N R: 61-26/27/28-33-62-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R61-26/27/28-33-62-50/53 5 % ≤ C < 25 %: T+, N; R61-26/27/28-33-62-51/53 2,5 % ≤ C < 5 %: T+, N; R61-26/27/28-33-51/53 0,5 % ≤ C < 2,5 %: T+; R61-26/27/28-33-52/53 0,25 % ≤ C < 0,5 %: T; R61-26/27/28-33-52/53 0,1 % ≤ C < 0,25 %: T; R61-23/24/25-33 0,05 % ≤ C < 0,1 %: Xn; R20/21/22-33 |
1 |
|
601-010-00-3 |
ethylene |
|
200-815-3 |
74-85-1 |
F+; R12 R67 |
F+ R: 12-67 S: (2-)9-16-33-46 |
|
|
|
601-014-00-5 |
isoprene (stabilized) 2-methyl-1,3-butadiene |
D |
201-143-3 |
78-79-5 |
F+; R12 Carc. Cat. 2; R45 Muta. Cat. 3; R68 R52-53 |
F+; T R: 45-12-68-52/53 S: 53-45-61 |
|
|
|
601-017-00-1 |
cyclohexane |
|
203-806-2 |
110-82-7 |
F; R11 Xn; R65 Xi; R38 R67 N; R50-53 |
F; Xn; N R: 11-38-65-67-50/53 S: (2-)9-16-25-33-60-61-62 |
|
4 6 |
|
601-020-00-8 |
benzene |
E |
200-753-7 |
71-43-2 |
F; R11 Carc. Cat. 1; R45 Muta. Cat. 2; R46 T; R48/23/24/25 Xn; R65 Xi; R36/38 |
F; T R: 45-46-11-36/38-48/23/24/25-65 S: 53-45 |
|
|
|
601-021-00-3 |
toluene |
|
203-625-9 |
108-88-3 |
F; R11 Repr.Cat.3; R63 Xn; R48/20-65 Xi; R38 R67 |
F; Xn R: 11-38-48/20-63-65-67 S: (2-)36/37-62-46 |
|
4, 6 |
|
601-025-00-5 |
mesitylene 1,3,5-trimethylbenzene |
|
203-604-4 |
108-67-8 |
R10 Xi; R37 N; R51-53 |
Xi; N R: 10-37-51/53 S: (2-)61 |
C ≥ 25 %: Xi, N; R37-51/53 2,5 % ≤ C < 25 %: R52/53 |
|
|
601-027-00-6 |
2-phenylpropene α-methylstryene |
|
202-705-0 |
98-83-9 |
R10 Xi; R36/37 N; R51-53 |
Xi; N R: 10-36/37-51/53 S: (2-)61 |
C ≥ 25 %: Xi, N; R36/37-51/53 2,5 % ≤ C < 25 %: R52/53 |
|
|
601-028-00-1 |
2-methylstyrene 2-vinyltoluene |
|
210-256-7 |
611-15-4 |
Xn; R20 N; R51-53 |
Xn; N R: 20-51/53 S: (2-)24-61 |
C ≥ 25 %: Xn, N; R20-51/53 2,5 % ≤ C < 25 %: R52/53 |
|
|
601-032-00-3 |
benzo[a]pyrene benzo[def]chrysene |
|
200-028-5 |
50-32-8 |
Carc. Cat. 2; R45 Muta. Cat. 2; R46 Repr. Cat. 2; R60-61 R43 N; R50-53 |
T; N R: 45-46-60-61-43-50/53 S: 53-45-60-61 |
C ≥ 25 %: T, N; R43-45-46-50-53-60-61 2,5 % ≤ C < 25 %: T, N; R43-45-46-51-53-60-61 1 % ≤ C < 2,5 %: T; R43-45-46-52-53-60-61 0,5 % ≤ C < 1 %: T; R45-46-52-53-60-61 0,25 % ≤ C < 0,5 %: T; R45-46-52-53 0,1 % ≤ C < 0,25 %: T; R45-46 0,01 % ≤ C < 0,1 %: T; R45 |
|
|
601-037-00-0 |
n-hexane |
|
203-777-6 |
110-54-3 |
F; R11 Repr. Cat. 3; R62 Xn; R65-48/20 Xi; R38 R67 N; R51-53 |
F; Xn; N R: 11-38-48/20-62-65-67-51/53 S: (2-)9-16-29-33-36/37-61-62 |
C ≥ 25 %: Xn, N; R38-48/20-62-51/53 20 % ≤ C < 25 %: Xn; R38-48/20-62-52/53 5 % ≤ C < 20 %: Xn; R48/20-62-52/53 2,5 % ≤ C < 5 %: R52/53 |
4 6 |
|
601-041-00-2 |
dibenz[a,h]anthracene |
|
200-181-8 |
53-70-3 |
Carc. Cat. 2; R45 N; R50-53 |
T; N R: 45-50/53 S: 53-45-60-61 |
C ≥ 25 %: T, N; R45-50/53 2,5 % ≤ C < 25 %: T, N; R45-51/53 0,25 % ≤ C < 2,5 %: T; R45-52/53 0,01 % ≤ C < 0,25 %: T; R45 |
|
|
601-048-00-0 |
chrysene |
|
205-923-4 |
218-01-9 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 N; R50-53 |
T; N R: 45-68-50/53 S: 53-45-60-61 |
|
|
|
601-052-00-2 |
naphthalene |
|
202-049-5 |
91-20-3 |
Carc. Cat.3; R40 Xn; R22 N; R50-53 |
Xn; N R: 22-40-50/53 S: (2-)36/37-46-60-61 |
|
|
|
601-053-00-8 |
nonylphenol [1] 4-nonylphenol, branched [2] |
|
246-672-0 [1] 284-325-5 [2] |
25154-52-3 [1] 84852-15-3 [2] |
Repr.Cat.3; R62 Repr.Cat.3; R63 Xn; R22 C; R34 N; R50-53 |
C; N R: 22-34-62-63-50/53 S: (1/2-)26-36/37/39-45-46-60-61 |
|
|
|
602-003-00-8 |
dibromomethane |
|
200-824-2 |
74-95-3 |
Xn; R20 R52-53 |
Xn R: 20-52/53 S: (2-)24-61 |
C ≥ 25 %: Xn; R20-52/53 12,5 % ≤ C < 25 %: Xn; R20 |
|
|
602-008-00-5 |
carbon tetrachloride tetrachloromethane |
|
200-262-8 |
56-23-5 |
Carc. Cat. 3; R40 T; R23/24/25-48/23 R52-53 N; R59 |
T; N R: 23/24/25-40-48/23-59-52/53 S: (1/2-)23-36/37-45-59-61 |
C ≥ 25 %: T, N; R23/24/25-40-48/23-52/53-59 1 % ≤ C < 25 %: T, N; R23/24/25-40-48/23-59 0,2 % ≤ C < 1 %: Xn, N; R20/21/22-48/20-59 0,1 % ≤ C < 0,2 %: N; R59 |
|
|
602-010-00-6 |
1,2-dibromoethane |
E |
203-444-5 |
106-93-4 |
Carc. Cat. 2; R45 T; R23/24/25 Xi; R36/37/38 N; R51-53 |
T; N R: 45-23/24/25-36/37/38-51/53 S: 53-45-61 |
C ≥ 25 %: T, N; R45-23/24/25-36/37/38-51/53 20 % ≤ C < 25 %: T, N; R45-23/24/25-36/37/38-52/53 2,5 % ≤ C < 20 %: T, N; R45-23/24/25-52/53 1 % ≤ C < 2,5 %: T; R45-23/24/25 0,1 % ≤ C < 1 %: T; R45-20/21/22 |
|
|
602-011-00-1 |
1,1-dichloroethane |
|
200-863-5 |
75-34-3 |
F; R11 Xn; R22 Xi; R36/37 R52-53 |
F; Xn R: 11-22-36/37-52/53 S: (2-)16-23-61 |
C ≥ 25 %: Xn; R22-36/37-52/53 20 % ≤ C < 25 %: Xn; R22-36/37 12,5 % ≤ C < 20 %: Xn; R22 |
|
|
602-014-00-8 |
1,1,2-trichloroethane |
|
201-166-9 |
79-00-5 |
Carc.Cat.3; R40 Xn; R20/21/22 R66 |
Xn R: 20/21/22-40-66 S: (2-)9-36/37-46 |
C ≥ 5 %: Xn; R20/21/22 |
|
|
602-015-00-3 |
1,1,2,2-tetrachloroethane |
|
201-197-8 |
79-34-5 |
T+; R26/27 N; R51-53 |
T+; N R: 26/27-51/53 S: (1/2-)38-45-61 |
C ≥ 25 %: T+, N; R26/27-51/53 7 % ≤ C < 25 %: T+; R26/27-52/53 2,5 % ≤ C < 7 %: T; R23/24-52/53 1 % ≤ C < 2,5 %: T; R23/24 0,1 % ≤ C < 1 %: Xn; R20/21 |
|
|
602-016-00-9 |
1,1,2,2-tetrabromoethane |
|
201-191-5 |
79-27-6 |
T+; R26 Xi; R36 R52-53 |
T+ R: 26-36-52/53 S: (1/2-)24-27-45-61 |
C ≥ 25 %: T+; R26-36-52/53 20 % ≤ C < 25 %: T+; R26-36 7 % ≤ C < 20 %: T+; R26 1 % ≤ C < 7 %: T; R23 0,1 % ≤ C < 1 %: Xn; R20 |
|
|
602-017-00-4 |
pentachloroethane |
|
200-925-1 |
76-01-7 |
Carc. Cat. 3; R40 T; R48/23 N; R51-53 |
T; N R: 40-48/23-51/53 S: (1/2-)23-36/37-45-61 |
C ≥ 25 %: T, N; R40-48/23-51/53 2,5 % ≤ C < 25 %: T; R40-48/23-52/53 1 % ≤ C < 2,5 %: T; R40-48/23 0,2 % ≤ C < 1 %: Xn; R48/20 |
|
|
602-019-00-5 |
1-bromopropane n-propyl bromide |
|
203-445-0 |
106-94-5 |
F; R11 Rep. Cat. 2; R60 Rep. Cat. 3; R63 Xn; R48/20 Xi; R36/37/38 R67 |
T; F R: 60-11-36/37/38-48/20-63-67 S: 53-45 |
|
|
|
602-025-00-8 |
1,1-dichloroethylene vinylidene chloride |
D |
200-864-0 |
75-35-4 |
F; R12 Carc.Cat.3; R40 Xn; R20 |
F+; Xn R: 12-20-40 S: (2-)7-16-29-36/37-46 |
C ≥ 12,5 %: Xn; R20-40 1 % ≤ C < 12,5 %: Xn; R40 |
|
|
602-026-00-3 |
1,2-dichloroethylene [1] cis-dichloroethylene [2] trans-dichloroethylene [3] |
C |
208-750-2 [1] 205-859-7 [2] 205-860-2 [3] |
540-59-0 [1] 156-59-2 [2] 156-60-5 [3] |
F; R11 Xn; R20 R52-53 |
F; Xn R: 11-20-52/53 S: (2-)7-16-29-61 |
C ≥ 25 %: Xn; R20-52/53 12,5 % ≤ C < 25 %: Xn; R20 |
|
|
602-029-00-X |
3-chloropropene allyl chloride |
D |
203-457-6 |
107-05-1 |
F; R11 Carc.Cat.3; R40 Muta.Cat.3; R68 Xn; R20/21/22-48/20 Xi; R36/37/38 N; R50 |
F; Xn; N R: 11-20/21/22-36/37/38-40-48/20-68-50 S: (2-)16-25-26-36/37-46-61 |
|
|
|
602-033-00-1 |
chlorobenzene |
|
203-628-5 |
108-90-7 |
R10 Xn; R20 N; R51-53 |
Xn; N R: 10-20-51/53 S: (2-)24/25-61 |
C ≥ 25 %: Xn, N; R20-51/53 5 % ≤ C < 25 %: Xn, N; R20-52/53 2,5 % ≤ C < 5 %: R52/53 |
|
|
602-034-00-7 |
1,2-dichlorobenzene o-dichlorobenzene |
|
202-425-9 |
95-50-1 |
Xn; R22 Xi; R36/37/38 N; R50-53 |
Xn; N R: 22-36/37/38-50/53 S: (2-)23-60-61 |
C ≥ 25 %: Xn, N; R22-36/37/38-50/53 20 % ≤ C < 25 %: Xn, N; R22-36/37/38-51/53 5 % ≤ C < 20 %: Xn, N; R22-51/53 2,5 % ≤ C < 5 %: N; R51/53 0,25 % ≤ C < 2,5 %: R52/53 |
|
|
602-035-00-2 |
1,4-dichlorobenzene p-dichlorobenzene |
|
203-400-5 |
106-46-7 |
Xi; R36 Carc. Cat. 3; R40 N; R50-53 |
Xn; N R: 36-40-50/53 S: (2-)36/37-46-60-61 |
|
|
|
602-036-00-8 |
chloroprene (stabilized) 2-chlorobuta-1,3-diene |
D E |
204-818-0 |
126-99-8 |
F; R11 Carc. Cat. 2; R45 Xn; R20/22-48/20 Xi; R36/37/38 |
F; T R: 45-11-20/22-36/37/38-48/20 S: 53-45 |
|
|
|
602-039-00-4 |
polychlorobiphenyls PCB |
C |
215-648-1 |
1336-36-3 |
R33 N; R50-53 |
Xn; N R: 33-50/53 S: (2-)35-60-61 |
C ≥ 25 %: Xn, N; R33-50/53 2,5 % ≤ C < 25 %: Xn, N; R33-51/53 0,25 % ≤ C < 2,5 %: Xn, N; R33-52/53 0,005 % ≤ C < 0,25 %: Xn; R33 |
|
|
602-043-00-6 |
γ-HCH or γ-BHC γ-1,2,3,4,5,6-hexachlorocyclohexane lindane |
|
200-401-2 |
58-89-9 |
T; R25 Xn; R20/21-48/22 R64 N; R50-53 |
T; N R: 20/21-25-48/22-64-50/53 S: (1/2-)36/37-45-60-61 |
C ≥ 25 %: T, N; R20/21-25-48/22-64-50-53 10 % ≤ C < 25 %: Xn, N; R22-48/22-64-50-53 3 % ≤ C < 10 %: Xn, N; R22-64-50-53 2,5 % ≤ C < 3 %: N; R64-50-53 1 % ≤ C < 2,5 %: N; R64-51-53 0,25 % ≤ C < 1 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
602-062-00-X |
1,2,3-trichloropropane |
D |
202-486-1 |
96-18-4 |
Carc. Cat. 2; R45 Repr. Cat. 2; R60 Xn; R20/21/22 |
T R: 45-60-20/21/22 S: 53-45 |
|
|
|
602-073-00-X |
1,4-dichlorobut-2-ene |
E |
212-121-8 |
764-41-0 |
Carc. Cat. 2; R45 T+; R26 T; R24/25 C; R34 N; R50-53 |
T+; N R: 45-24/25-26-34-50/53 S: 53-45-60-61 |
C ≥ 25 %: T+, N; R45-24/25-26-34-50/53 10 % ≤ C < 25 %: T+, N; R45-21/22-26-34-51/53 7 % ≤ C < 10 %: T+, N; R45-21/22-26-36/37/38-51/53 5 % ≤ C < 7 %: T, N; R45-21/22-23-36/37/38-51/53 3 % ≤ C < 5 %: T, N; R45-21/22-23-51/53 2,5 % ≤ C < 3 %: T, N; R45-23-51/53 1 % ≤ C < 2,5 %: T; R45-23-52/53 0,25 % ≤ C < 1 %: T; R45-20-52/53 0,1 % ≤ C < 0,25 %: T; R45-20 0,01 % ≤ C < 0,1 %: T; R45 |
|
|
603-006-00-7 |
pentanol isomers, with the exception fo those specified elsewhere in this Annex |
C |
250-378-8 |
30899-19-5 |
R10 Xn; R20 Xi; R37 R66 |
Xn R: 10-20-37-66 S: (2-)46 |
|
|
|
603-007-00-2 |
2-methylbutan-2-ol tert-pentanol |
|
200-908-9 |
75-85-4 |
F; R11 Xn; R20 Xi; R37/38 |
F; Xn R: 11-20-37/38 S: (2-)46 |
|
|
|
603-029-00-2 |
bis(2-chloroethyl) ether |
|
203-870-1 |
111-44-4 |
R10 Carc.Cat.3; R40 T+; R26/27/28 |
T+ R: 10-26/27/28-40 S: (1/2-)7/9-27-28-36/37-45 |
C ≥ 7 %: T+; R26/27/28-40 1 % ≤ C < 7 %: T; R23/24/25-40 0,1 % ≤ C < 1 %: Xn; R20/21/22 |
|
|
603-030-00-8 |
2-aminoethanol ethanolamine |
|
205-483-3 |
141-43-5 |
Xn; R20/21/22 C; R34 |
C R: 20/21/22-34 S: (1/2-)26-36/37/39-45 |
C ≥ 25 %: C; R20/21/22-34 10 % ≤ C < 25 %: C; R34 5 % ≤ C < 10 %: Xi; R36/37/38 |
|
|
603-031-00-3 |
1,2-dimethoxyethane ethylene glycol dimethyl ether EGDME |
|
203-794-9 |
110-71-4 |
Repr.Cat.2; R60 Repr.Cat.2; R61 F; R11 R19 Xn; R20 |
F; T R: 60-61-11-19-20 S: 53-45 |
|
|
|
603-054-00-9 |
di-n-butyl ether dibutyl ether |
|
205-575-3 |
142-96-1 |
R10 Xi; R36/37/38 R52-53 |
Xi R: 10-36/37/38-52/53 S: (2-)61 |
C ≥ 10 %: Xi; R36/37/38 |
|
|
603-063-00-8 |
2,3-epoxypropan-1-ol glycidol oxiranemethanol |
E |
209-128-3 |
556-52-5 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 2; R60 T; R23 Xn; R21/22 Xi; R36/37/38 |
T R: 45-60-21/22-23-36/37/38-68 S: 53-45 |
|
|
|
603-066-00-4 |
1,2-epoxy-4-epoxyethylcyclohexane vinylcyclohexane diepoxide |
|
203-437-7 |
106-87-6 |
T; R23/24/25 Xn; R68 |
T R: 23/24/25-68 S: (1/2-)23-24-45 |
C ≥ 1 %: T; R23/24/25-68 0,1 % ≤ C < 1 %: Xn; R20/21/22 |
|
|
603-067-00-X |
phenyl glycidyl ether 2,3-epoxypropyl phenyl ether 1,2-epoxy-3-phenoxypropane |
E |
204-557-2 |
122-60-1 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Xn; R20 Xi; R37/38 R43 R52-53 |
T R: 45-20-37/38-43-68-52/53 S: 53-45-61 |
|
|
|
603-070-00-6 |
2-amino-2-methylpropanol |
|
204-709-8 |
124-68-5 |
Xi; R36/38 R52-53 |
Xi R: 36/38-52/53 S: (2-)61 |
C ≥ 25 %: Xi; R36/38-52/53 10 % ≤ C < 25 %: Xi; R36/38 |
|
|
603-074-00-8 |
reaction product: bisphenol-A-(epichlorhydrin) epoxy resin (number average molecular weight ≤ 700) |
|
500-033-5 |
25068-38-6 |
Xi; R36/38 R43 N; R51-53 |
Xi; N R: 36/38-43-51/53 S: (2-)28-37/39-61 |
C ≥ 25 %: Xi, N; R36/38-43-51/53 5 % ≤ C < 25 %: Xi; R36/38-43-52/53 2,5 % ≤ C < 5 %: Xi; R43-52/53 1 % ≤ C < 2,5 %: Xi; R43 |
|
|
603-076-00-9 |
but-2-yne-1,4-diol 2-butyne-1,4-diol |
D |
203-788-6 |
110-65-6 |
C; R34 T; R23/25 Xn; R21-48/22 R43 |
C; T R: 21-23/25-34-43-48/22 S: (1/2-)25-26-36/37/39-45-46 |
C ≥ 50 %: T, C; R21-23/25-34-48/22-43 25 % ≤ C < 50 %: T; R21-23/25-36/38-48/22-43 10 % ≤ C < 25 %: Xn; R20/22-48/22-43 3 % ≤ C < 10 %: Xn; R20/22-43 1 % ≤ C < 3 %: Xi; R43 |
|
|
603-095-00-2 |
2-(propyloxy)ethanol EGPE |
|
220-548-6 |
2807-30-9 |
Xn; R21 Xi; R36 |
Xn R: 21-36 S: (2-)26-36/37-46 |
|
|
|
603-105-00-5 |
furan |
E |
203-727-3 |
110-00-9 |
F+; R12 R19 Carc. Cat. 2; R45 Muta. Cat. 3; R68 Xn; R20/22-48/22 Xi; R38 R52-53 |
F+; T R: 45-12-19-20/22-38-48/22-68-52/53 S: 53-45-61 |
|
|
|
604-001-00-2 |
phenol carbolic acid monohydroxybenzene phenylalcohol |
|
203-632-7 |
108-95-2 |
Muta.Cat.3; R68 T; R23/24/25 Xn; R48/20/21/22 C; R34 |
T; C R: 23/24/25-34-48/20/21/22-68 S: (1/2-)24/25-26-28-36/37/39-45 |
C ≥ 10 %: T; R23/24/25-48/20/21/22-34-68 3 % ≤ C < 10 %: C ; Xn ; R20/21/22-34-68 1 % ≤ C < 3 %: Xn ; R36/38-68 |
|
|
604-009-00-6 |
pyrogallol 1,2,3-trihydroxybenzene |
|
201-762-9 |
87-66-1 |
Muta. Cat. 3; R68 Xn; R20/21/22 R52-53 |
Xn R: 20/21/22-68-52/53 S: (2-)36/37-61 |
C ≥ 25 %: Xn; R20/21/22-68-52/53 10 % ≤ C < 25 %: Xn; R20/21/22-68 1 % ≤ C < 10 %: Xn; R68 |
|
|
604-010-00-1 |
resorcinol 1,3-benzenediol |
|
203-585-2 |
108-46-3 |
Xn; R22 Xi; R36/38 N; R50 |
Xn; N R: 22-36/38-50 S: (2-)26-61 |
C ≥ 25 %: Xn, N; R22-36/38-50 20 % ≤ C < 25 %: Xn; R22-36/38 10 % ≤ C < 20 %: Xn; R22 |
|
|
604-012-00-2 |
4-chloro-o-cresol 4-chloro-2-methyl phenol |
|
216-381-3 |
1570-64-5 |
T; R23 C; R35 N; R50 |
T; C; N R: 23-35-50 S: (1/2-)26-36/37/39-45-61 |
C ≥ 25 %: T, C, N; R23-35-50 10 % ≤ C < 25 %: C; R20-35 5 % ≤ C < 10 %: C; R20-34 3 % ≤ C < 5 %: Xn; R20-36/37/38 1 % ≤ C < 3 %: Xi; R36/37/38 |
|
|
604-013-00-8 |
2,3,4,6-tetrachlorophenol |
|
200-402-8 |
58-90-2 |
T; R25 Xi; R36/38 N; R50-53 |
T; N R: 25-36/38-50/53 S: (1/2-)26-28-37-45-60-61 |
C ≥ 25 %: T, N; R25-36/38-50/53 20 % ≤ C < 25 %: T, N; R25-51/53 5 % ≤ C < 20 %: T, N; R25-36/38-51/53 2,5 % ≤ C < 5 %: Xn, N; R22-51/53 0,5 % ≤ C < 2,5 %: Xn; R22-52/53 0,25 % ≤ C < 0,5 %: R52/53 |
|
|
604-014-00-3 |
chlorocresol 4-chloro-m-cresol 4-chloro-3-methylphenol |
|
200-431-6 |
59-50-7 |
Xn; R21/22 Xi; R41 R43 N; R50 |
Xn; N R: 21/22-41-43-50 S: (2-)26-36/37/39-61 |
C ≥ 25 %: Xn, N; R21/22-41-43-50 10 % ≤ C < 25 %: Xn; R21/22-41-43 5 % ≤ C < 10 %: Xn; R21/22-36-43 1 % ≤ C < 5 %: Xi; R43 |
|
|
604-015-00-9 |
2,2′-methylenebis-(3,4,6-trichlorophenol) hexachlorophene |
|
200-733-8 |
70-30-4 |
T; R24/25 N; R50-53 |
T; N R: 24/25-50/53 S: (1/2-)20-37-45-60-61 |
C ≥ 25 %: T, N; R24/25-50/53 2,5 % ≤ C < 25 %: T, N; R24/25-51/53 2 % ≤ C < 2,5 %: T; R24/25-52/53 0,25 % ≤ C < 2 %: Xn; R21/22-52/53 0,2 % ≤ C < 0,25 %: Xn; R21/22 |
|
|
604-017-00-X |
2,4,5-trichlorophenol |
|
202-467-8 |
95-95-4 |
Xn; R22 Xi; R36/38 N; R50-53 |
Xn; N R: 22-36/38-50/53 S: (2-)26-28-60-61 |
C ≥ 25 %: Xn, N; R22-36/38-50/53 20 % ≤ C < 25 %: Xn, N; R22-36/38-51/53 5 % ≤ C < 20 %: Xn, N; R36/38-51/53 2,5 % ≤ C < 5 %: N; R51/53 0,25 % ≤ C < 2,5 %: R52/53 |
|
|
604-030-00-0 |
bisphenol A 4,4′-isopropylidenediphenol |
|
201-245-8 |
80-05-7 |
Repr. Cat. 3; R62 Xi; R37-41 R43 |
Xn R: 37-41-43-62 S: (2-)26-36/37-39-46 |
|
|
|
605-002-00-0 |
1,3,5-trioxan trioxymethylene |
|
203-812-5 |
110-88-3 |
F; R11 Repr.Cat.3; R63 Xi; R37 |
F; Xn R: 11-37-63 S: (2-)36/37-46 |
|
|
|
605-016-00-7 |
glyoxal…% ethandial…% |
B |
203-474-9 |
107-22-2 |
Muta. Cat. 3; R68 Xn; R20 Xi; R36/38 R43 |
Xn R: 20-36/38-43-68 S: (2-)36/37 |
C ≥ 10 %: Xn; R20-36/38-43-68 1 % ≤ C < 10 %: Xn; R43-68 |
|
|
605-020-00-9 |
safrole 5-allyl-1,3-benzodioxole |
E |
202-345-4 |
94-59-7 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Xn; R22 |
T R: 45-22-68 S: 53-45 |
|
|
|
605-022-00-X |
glutaral glutaraldehyde 1,5-pentanedial |
|
203-856-5 |
111-30-8 |
T; R23/25 C; R34 R42/43 N; R50 |
T; N R: 23/25-34-42/43-50 S: (1/2-)26-36/37/39-45-61 |
C ≥ 50 %: T, N; R23/25-34-42/43-50 25 % ≤ C < 50 %: T; R22-23-34-42/43 10 % ≤ C < 25 %: C; R20/22-34-42/43 2 % ≤ C < 10 %: Xn; R20/22-37/38-41-42/43 1 % ≤ C < 2 %: Xn; R36/37/38-42/43 0,5 % ≤ C < 1 %: Xi; R36/37/38-43 |
|
|
605-025-00-6 |
chloroacetaldehyde |
|
203-472-8 |
107-20-0 |
Carc. Cat. 3; R40 T+; R26 T; R24/25 C; R34 N; R50 |
T+; N R: 24/25-26-34-40-50 S: (1/2-)26-28-36/37/39-45-61 |
C ≥ 25 %: T+, N; R24/25-26-34-40-50 10 % ≤ C < 25 %: T+; R21/22-26-34-40 7 % ≤ C < 10 %: T+; R21/22-26-36/37/38-40 5 % ≤ C < 7 %: T; R21/22-23-36/37/38-40 3 % ≤ C < 5 %: T; R21/22-23-40 1 % ≤ C < 3 %: T; R23-40 0,1 % ≤ C < 1 %: Xn; R20 |
|
|
606-037-00-4 |
triadimefon (ISO) 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanone |
|
256-103-8 |
43121-43-3 |
Xn; R22 R43 N; R51-53 |
Xn; N R: 22-43-51/53 S: (2-)24-37-61 |
|
|
|
606-048-00-4 |
2′-anilino-3′-methyl-6′-dipentylaminospiro(isobenzofuran-1(1H),9′-xanthen)-3-one |
|
406-480-1 |
— |
R53 |
R: 53 S: 61 |
|
|
|
607-004-00-7 |
trichloroacetic acid |
|
200-927-2 |
76-03-9 |
C; R35 N; R50-53 |
C; N R: 35-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R35-50/53 10 % ≤ C < 25 %: C, N; R35-51/53 5 % ≤ C < 10 %: C, N; R34-51/53 2,5 % ≤ C < 5 %: Xi, N; R36/37/38-51/53 1 % ≤ C < 2,5 %: Xi; R36/37/38-52/53 0,25 % ≤ C < 1 %: R52/53 |
|
|
607-019-00-9 |
methyl chloroformate |
|
201-187-3 |
79-22-1 |
F; R11 T+; R26 Xn; R21/22 C; R34 |
F; T+ R: 11-21/22-26-34 S: (1/2-)26-14-28-36/37-39-36/37/39-45-46-63 |
|
|
|
607-049-00-2 |
mecoprop (ISO) [1] and its salts 2-(4-chloro-o-tolyloxy) propionic acid (RS)-2-(4-chloro-o-tolyloxy)propionic acid [1] 2-(4-chloro-2-methylphenoxy)propionic acid [2] |
|
230-386-8 [1] 202-264-4 [2] |
7085-19-0 [1] 93-65-2 [2] |
Xn; R22 Xi; R38-41 N; R50-53 |
Xn; N R: 22-38-41-50/53 S: (2-)13-26-37/39-60-61 |
C ≥ 25 %: Xn, N; R22-38-41-50-53 20 % ≤ C < 25 %: Xi, N; R38-41-50-53 10 % ≤ C < 20 %: Xi, N; R41-50-53 5 % ≤ C < 10 %: Xi, N; R36-50-53 0,25 % ≤ C < 5 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
607-053-00-4 |
MCPB (ISO) 4-(4-chloro-o-tolyloxy) butyric acid |
|
202-365-3 |
94-81-5 |
N; R50-53 |
N R: 50/53 S: 60-61 |
|
|
|
607-061-00-8 |
acrylic acid prop-2-enoic acid |
D |
201-177-9 |
79-10-7 |
R10 Xn; R20/21/22 C; R35 N; R50 |
C; N R: 10-20/21/22-35-50 S: (1/2-)26-36/37/39-45-61 |
C ≥ 25 %: C, N; R20/21/22-35-50 10 % ≤ C < 25 %: C; R35 5 % ≤ C < 10 %: C; R34 1 …% ≤ C < 5 %: Xi; R36/37/38 |
|
|
607-064-00-4 |
benzyl chloroformate |
|
207-925-0 |
501-53-1 |
C; R34 N; R50-53 |
C; N R: 34-50/53 S: (1/2-)26-45-60-61 |
C ≥ 25 %: C, N; R34-50/53 10 % ≤ C < 25 %: C, N; R34-51/53 5 % ≤ C < 10 %: Xi, N; R36/37/38-51/53 2,5 % ≤ C < 5 %: N; R51/53 0,25 % ≤ C < 2,5 %: R52/53 |
|
|
607-072-00-8 |
2-hydroxyethyl acrylate |
D |
212-454-9 |
818-61-1 |
T; R24 C; R34 R43 N; R50 |
T; N R: 24-34-43-50 S: (1/2-)26-36/39-45-61 |
C ≥ 25 %: T; R24-34-43-50 10 % ≤ C < 25 %: T; R24-34-43 5 % ≤ C < 10 %: T; R24-36/38-43 2 % ≤ C < 5 %: T; R24-43 0,2 % ≤ C < 2 %: Xn; R21-43 |
|
|
607-086-00-4 |
diallyl phthalate |
|
205-016-3 |
131-17-9 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)24/25-60-61 |
C ≥ 25 %: Xn, N; R22-50/53 2,5 % ≤ C < 25 %: N; R51/53 0,25 % ≤ C < 2,5 %: R52/53 |
|
|
607-091-00-1 |
trifluoroacetic acid … % |
B |
200-929-3 |
76-05-1 |
Xn; R20 C; R35 R52-53 |
C R: 20-35-52/53 S: (1/2-)9-26-27-28-45-61 |
C ≥ 25 %: C; R20-35-52/53 10 % ≤ C < 25 %: C; R20-35 5 % ≤ C < 10 %: C; R34 1 % ≤ C < 5 %: Xi; R36/38 |
|
|
607-094-00-8 |
peracetic acid … % |
|
201-186-8 |
79-21-0 |
R10 O; R7 Xn; R20/21/22 C; R35 N; R50 |
O; C; N R: 7-10-20/21/22-35-50 S: (1/2-)3/7-14-36/37/39-45-61 |
C ≥ 25 %: C, N; R20/21/22-35-50 10 % ≤ C < 25 %: C; R20/21/22-35 5 % ≤ C < 10 %: C; R34 1 % ≤ C < 5 %: Xi, R36/37/38 |
|
|
607-107-00-7 |
2-ethylhexyl acrylate |
D |
203-080-7 |
103-11-7 |
Xi; R37/38 R43 |
Xi R: 37/38-43 S: (2-)36/37-46 |
|
|
|
607-113-00-X |
isobutyl methacrylate |
D |
202-613-0 |
97-86-9 |
R10 Xi; R36/37/38 R43 N; R50 |
Xi; N R: 10-36/37/38-43-50 S: (2-)24-37-61 |
C ≥ 25 %: Xi, N; R36/37/38-43-50 20 % ≤ C < 25 %: Xi; R36/37/38-43 1 % ≤ C < 20 %: Xi; R43 |
|
|
607-116-00-6 |
cyclohexyl acrylate |
D |
221-319-3 |
3066-71-5 |
Xi; R37/38 N; R51-53 |
Xi; N R: 37/38-51/53 S: (2-)61 |
C ≥ 25 %: Xi, N; R37/38-51/53 10 % ≤ C < 25 %: Xi; R37/38-52/53 2,5 % ≤ C < 10 %: R52/53 |
|
|
607-133-00-9 |
monoalkyl or monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex |
A |
— |
— |
Xi; R36/37/38 N; R51-53 |
Xi; N R: 36/37/38-51/53 S: (2-)26-28-61 |
C ≥ 25 %: Xi, N; R36/37/38-51/53 10 % ≤ C < 25 %: Xi; R36/37/38-52/53 2,5 % ≤ C < 10 %: R52/53 |
|
|
607-151-00-7 |
propargite (ISO) 2-(4-tert-butylphenoxy) cyclohexyl prop-2-ynyl sulphite |
|
219-006-1 |
2312-35-8 |
Carc.Cat.3; R40 T; R23 Xi; R38-41 N; R50-53 |
T; N R: 23-38-40-41-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: T, N; R23-38-40-41-50-53 20 % ≤ C < 25 %: Xn, N; R20-38-40-41-50-53 10 % ≤ C < 20 %: Xn, N; R20-40-41-50-53 5 % ≤ C < 10 %: Xn, N; R20-40-36-50-53 3 % ≤ C < 5 %: Xn, N; R20-40-50-53 2,5 % ≤ C < 3 %: Xn, N; R40-50-53 1 % ≤ C < 2,5 %: Xn, N; R40-51-53 0,25 % ≤ C < 1 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
607-189-00-4 |
trimethylenediaminetetraacetic acid |
|
400-400-9 |
1939-36-2 |
Xn; R22 Xi; R41 N; R50-53 |
Xn; N R: 22-41-50/53 S: (2-)22-26-39-60-61 |
|
|
|
607-244-00-2 |
isooctyl acrylate |
|
249-707-8 |
29590-42-9 |
Xi; R36/37/38 N; R50-53 |
Xi; N R: 36/37/38-50/53 S: (2-)26-28-60-61 |
C ≥ 25 %: Xi, N; R36/37/38-50/53 10 % ≤ C < 25 %: Xi, N; R36/37/38-51/53 2,5 % ≤ C < 10 %: N; R51/53 0,25 % ≤ C < 2,5 %: R52/53 |
|
|
607-245-00-8 |
tert-butyl acrylate |
D |
216-768-7 |
1663-39-4 |
F; R11 Xn; R20/21/22 Xi; R37/38 R43 N; R52-53 |
F; Xn R: 11-20/21/22-37/38-43-52/53 S: (2-)16-25-37-61 |
C ≥ 25 %: Xn; R20/21/22-37/38-43-52-53 20 % ≤ C < 25 %: Xi; R37/38-43 1 % ≤ C < 20 %: Xi; R43 |
|
|
607-247-00-9 |
dodecyl methacrylate |
|
205-570-6 |
142-90-5 |
Xi; 36/37/38 N; R50-53 |
Xi; N R: 36/37/38-50/53 S: (2-)26-28-60-61 |
C ≥ 25 %: Xi, N; R36/37/38-50/53 10 % ≤ C < 25 %: Xi, N; R36/37/38-51/53 2,5 % ≤ C < 10 %: N; R51/53 0,25 % ≤ C < 2,50 %: R52/53 |
|
|
607-249-00-X |
(1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate |
|
256-032-2 |
42978-66-5 |
Xi; R36/37/38 R43 N; R51-53 |
Xi; N R: 36/37/38-43-51/53 S: (2-)24-37-61 |
C ≥ 25 %: Xi, N; R36/37/38-43-51/53 10 % ≤ C < 25 %: Xi; R36/37/38-43-52/53 2,5 % ≤ C < 10 %: Xi; R43-52/53 1 % ≤ C < 2,5 %: Xi; R43 |
|
|
608-003-00-4 |
acrylonitrile |
D E |
203-466-5 |
107-13-1 |
F; R11 Carc. Cat. 2; R45 T; R23/24/25 Xi; R37/38-41 R43 N; R51-53 |
F; T; N R: 45-11-23/24/25-37/38-41-43-51/53 S: 9-16-53-45-61 |
C ≥ 25 %: T, N; R45-23/24/25-37/38-41-43-51/53 20 % ≤ C < 25 %: T; R45-23/24/25-37/38-41-43-52/53 10 % ≤ C < 20 %: T; R45-23/24/25-41-43-52/53 5 % ≤ C < 10 %: T; R45-23/24/25-36-43-52/53 2,5 % ≤ C < 5 %: T; R45-23/24/25-43-52/53 1 % ≤ C < 2,5 %: T; R45-23/24/25-43 0,2 % ≤ C < 1 %: T; R45-20/21/22 0,1 % ≤ C < 0,2 %: T; R45 |
|
|
608-006-00-0 |
bromoxynil (ISO) and its salts 3,5-dibromo-4-hydroxybenzonitrile bromoxynil phenol |
|
216-882-7 |
1689-84-5 |
Repr. Cat. 3; R63 T+; R26 T; R25 R43 N; R50-53 |
T+; N R: 25-26-43-63-50/53 S: (1/2-)27/28-36/37-45-63-60-61 |
C ≥ 25 %: T+, N; R25-26-43-63-50-53 7 % ≤ C < 25 %: T+, N; R22-26-43-63-50-53 5 % ≤ C < 7 %: T, N; R22-23-43-63-50-53 3 % ≤ C < 5 %: T, N; R22-23-43-50-53 2,5 % ≤ C < 3 %: T, N; R23-43-50-53 1 % ≤ C < 2,5 %: T, N; R23-43-51-53 0,25 % ≤ C < 1 %: Xn, N; R20-51-53 0,1 % ≤ C < 0,25 %: Xn; R20-52-53 0,025 % ≤ C < 0,1 %: R52-53 |
|
|
608-007-00-6 |
ioxynil (ISO) and its salts 4-hydroxy-3,5-diiodobenzonitrile |
|
216-881-1 |
1689-83-4 |
Repr. Cat. 3; R63 T; R23/25 Xn; R21-48/22 Xi; R36 N; R50-53 |
T; N R: 21-23/25-36-48/22-63-50/53 S: (1/2-)36/37-45-60-61-63 |
C ≥ 25 %: T, N; R21-23/25-36-48/22-63-50-53 20 % ≤ C < 25 %: Xn, N; R20/22-36-48/22-63-50-53 10 % ≤ C < 20 %: Xn, N; R20/22-48/22-63-50-53 5 % ≤ C < 10 %: Xn, N; R20/22-63-50-53 3 % ≤ C < 5 %: Xn, N; R20/22-50-53 2,5 % ≤ C < 3 %: N; R50-53 0,25 % ≤ C < 2,5 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-010-00-2 |
methacrylonitrile 2-methyl-2-propene nitrile |
D |
204-817-5 |
126-98-7 |
F; R11 T; R23/24/25 R43 |
F; T R: 11-23/24/25-43 S: (1/2-)9-16-18-29-45 |
C ≥ 1 %: T; R23/24/25-43 0,2 % ≤ C < 1 %: Xn; R20/21/22-43 |
|
|
608-014-00-4 |
chlorothalonil (ISO) tetrachloroisophthalonitrile |
|
217-588-1 |
1897-45-6 |
Carc. Cat. 3; R40 T+; R26 Xi; R41 Xi; R37 R43 N; R50-53 |
T+; N R: 26-37-40-41-43-50/53 S: (2-)28-36/37/39-45-60-61 |
C ≥ 20 %: T+, N; R26-37-40-41-43-50-53 10 % ≤ C < 20 %: T+, N; R26-40-41-43-50-53 7 % ≤ C < 10 %: T+, N; R26-40-36-43-50-53 5 % ≤ C < 7 %: T, N; R23-40-36-43-50-53 2,5 % ≤ C < 5 %: T, N; R23-40-43-50-53 1 % ≤ C < 2,5 %: T, N; R23-40-43-51-53 0,25 % ≤ C < 1: Xn, N; R20-51-53 0,1 % ≤ C < 0,25 %: Xn; R20-52-53 0,025 % ≤ C < 0,1 %: R52-53 |
|
|
608-017-00-0 |
bromoxynil octanoate (ISO) 2,6-dibromo-4-cyanophenyl octanoate |
|
216-885-3 |
1689-99-2 |
Repr. Cat. 3; R63 T; R23 Xn; R22 R43 N; R50-53 |
T; N R: 22-23-43-63-50/53 S: (1/2-)36/37-45-63-60-61 |
C ≥ 25 %: T, N; R22-23-43-63-50-53 5 % ≤ C < 25 %: Xn, N; R20-43-63-50-53 3 % ≤ C < 5 %: Xn, N; R20-43-50-53 2,5 % ≤ C < 3 %: Xi, N; R43-50-53 1 % ≤ C < 2,5 %: Xi, N; R43-51-53 0,25 % ≤ C < 1 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-018-00-6 |
ioxynil octanoate (ISO) 4-cyano-2,6-diiodophenyl octanoate |
|
223-375-4 |
3861-47-0 |
Repr. Cat. 3; R63 T; R25 Xi; R36 R43 N; R50-53 |
T; N R: 25-36-43-63-50/53 S: (1/2-)26-36/37-45-60-61 |
C ≥ 25 %: T, N; R25-36-43-63-50-53 20 % ≤ C < 25 %: Xn, N; R22-36-43-63-50-53 5 % ≤ C < 20 %: Xn, N; R22-43-63-50-53 3 % ≤ C < 5 %: Xn, N; R22-43-50-53 2,5 % ≤ C < 3 %: N; R43-50-53 1 % ≤ C < 2,5 %: N; R43-51-53 0,25 % ≤ C < 1 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
608-021-00-2 |
3-(2-(diaminomethyleneamino)thiazol-4-ylmethylthio)propionitrile |
|
403-710-2 |
76823-93-3 |
Xn; R22 R43 |
Xn R: 22-43 S: (2-)22-24-37 |
|
|
|
609-007-00-9 |
2,4-dinitrotoluene dinitrotoluene, technical grade [1] dinitrotoluene [2] |
E |
204-450-0 [1] 246-836-1 [2] |
121-14-2 [1] 25321-14-6 [2] |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 3; R62 T; R23/24/25 Xn; R48/22 N; R51-53 |
T; N R: 45-23/24/25-48/22-62-68-51/53 S: 53-45-61 |
|
|
|
609-023-00-6 |
dinocap (ISO) |
E |
254-408-0 |
39300-45-3 |
Repr. Cat. 2; R61 Xn; R20-48/22 Xi; R38 R43 N; R50-53 |
T; N R: 61-20-22-38-43-48/22-50/53 S: 53-45-60-61 |
|
|
|
609-043-00-5 |
quintozene (ISO) pentachloronitrobenzene |
|
201-435-0 |
82-68-8 |
R43 N; R50-53 |
Xi; N R: 43-50/53 S: (2-)13-24-37-60-61 |
|
|
|
609-049-00-8 |
2,6-dinitrotoluene |
E |
210-106-0 |
606-20-2 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 3; R62 T; R23/24/25 Xn; R48/22 R52-53 |
T R: 45-23/24/25-48/22-62-68-52/53 S: 53-45-61 |
|
|
|
609-050-00-3 |
2,3-dinitrotoluene |
E |
210-013-5 |
602-01-7 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 3; R62 T; R23/24/25 Xn; R48/22 N; R50-53 |
T; N R: 45-23/24/25-48/22-62-68-50/53 S: 53-45-60-61 |
|
|
|
609-051-00-9 |
3,4-dinitrotoluene |
E |
210-222-1 |
610-39-9 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 3; R62 T; R23/24/25 Xn; R48/22 N; R51-53 |
T; N R: 45-23/24/25-48/22-62-68-51/53 S: 53-45-61 |
|
|
|
609-052-00-4 |
3,5-dinitrotoluene |
E |
210-566-2 |
618-85-9 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 3; R62 T; R23/24/25 Xn; R48/22 R52-53 |
T R: 45-23/24/25-48/22-62-68-52/53 S: 53-45-61 |
|
|
|
609-055-00-0 |
2,5-dinitrotoluene |
E |
210-581-4 |
619-15-8 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Repr. Cat. 3; R62 T; R23/24/25 Xn; R48/22 N; R51-53 |
T; N R: 45-23/24/25-48/22-62-68-51/53 S: 53-45-61 |
|
|
|
609-056-00-6 |
2,2-dibromo-2-nitroethanol |
|
412-380-9 |
69094-18-4 |
E; R2 Carc. Cat. 3; R40 Xn; R22-48/22 C; R35 R43 N; R50-53 |
E; C; N R: 2-22-35-40-43-48/22-50/53 S: (1/2-)23-26-35-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R22-35-40-43-48/22-50/53 10 % ≤ C < 25 %: C, N; R22-35-40-43-48/22-51/53 5 % ≤ C < 10 %: C, N; R34-40-43-51/53 2,5 % ≤ C < 5 %: Xn, N; R36/37/38-40-43-51/53 1 % ≤ C < 2,5 %: Xn; R36/37/38-40-43-52/53 0,25 % ≤ C < 1 %: R52/53 |
|
|
610-005-00-5 |
1-chloro-4-nitrobenzene |
|
202-809-6 |
100-00-5 |
Carc.Cat.3;R40 Mut.Cat.3;R68 T; R23/24/25 Xn; R48/20/21/22 N; R51-53 |
T; N R: 23/24/25-40-48/20/21/22-68-51/53 S: (1/2-)28-36/37-45-61 |
|
|
|
611-001-00-6 |
azobenzene |
E |
203-102-5 |
103-33-3 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 Xn; R20/22-48/22 N; R50-53 |
T; N R: 45-20/22-48/22-68-50/53 S: 53-45-60-61 |
|
|
|
611-060-00-8 |
A mixture of: sodium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate; ammonium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate; 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonaphthalen-2-ylazo]-isophthalic acid |
|
413-180-4 |
— |
Xi; R41 |
Xi R: 41 S: (2-)22-26-39 |
|
|
|
611-063-00-4 |
trisodium [4′-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4″-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3′,3″,1‴-tetraolato-O,O′,O″,O‴]copper(II) |
|
413-590-3 |
164058-22-4 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
612-008-00-7 |
aniline |
|
200-539-3 |
62-53-3 |
Carc. Cat. 3; R40 Muta.Cat.3; R68 T; R23/24/25-48/23/24/25 Xi; R41 R43 N; R50 |
T; N R: 23/24/25-40-41-43-48/23/24/25-68-50 S: (1/2-)26-27-36/37/39-45-46-61-63 |
C ≥ 25 %: T, N; R23/24/25-40-41-43-48/23/24/25-50-68 10 % ≤ C < 25 %: T; R20/21/22-40-41-43-48/23/24/25-68 1 % ≤ C < 10 %: T; R20/21/22-40-43-48/23/24/25-68 0,2 % ≤ C < 1 %: Xn; R48/20/21/22 |
|
|
612-009-00-2 |
salts of aniline |
A |
— |
— |
Carc. Cat. 3; R40 Muta. Cat. 3; R68 T; R23/24/25 Xi; R41 R43 N; R50 |
T; N R: 23/24/25-40-41-43-48/23/24/25-68-50 S: (1/2-)26-27-36/37/39-45-61-63 |
C ≥ 25 %: T, N; R23/24/25-40-41-43-48/23/24/25-50-68 10 % ≤ C < 25 %: T; R20/21/22-40-41-43-48/23/24/25-68 1 % ≤ C < 10 %: T; R20/21/22-40-43-48/23/24/25-68 0,2 % ≤ C < 1 %: Xn; R48/20/21/22 |
|
|
612-010-00-8 |
chloroanilines (with exception of those specified elsewhere in this Annex) |
C |
— |
— |
T; R23/24/25 R33 N; R50-53 |
T; N R: 23/24/25-33-50/53 S: (1/2-)28-36/37-45-60-61 |
|
|
|
612-022-00-3 |
2-naphthylamine |
E |
202-080-4 |
91-59-8 |
Carc. Cat. 1; R45 Xn; R22 N; R51-53 |
T; N R: 45-22-51/53 S: 53-45-61 |
C ≥ 25 %: T, N; R45-22-51/53 2,5 % ≤ C < 25 %: T; R45-52/53 0,01 % ≤ C < 2,5 %: T; R45 |
|
|
612-023-00-9 |
phenylhydrazine [1] phenylhydrazinium chloride [2] phenylhydrazine hydrochloride [3] phenylhydrazinium sulphate (2:1) [4] |
E |
202-873-5 [1] 200-444-7 [2] 248-259-0 [3] 257-622-2 [4] |
100-63-0 [1] 59-88-1 [2] 27140-08-5 [3] 52033-74-6 [4] |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 T; R23/24/25-48/23/24/25 Xi; R36/3 R438 N; R50 |
T; N R: 45-23/24/25-36/38-43-48/23/24/25-68-50 S: 53-45-61 |
|
|
|
612-025-00-X |
nitrotoluidines, with the exception of those specified elsewhere in this Annex |
C |
— |
— |
T; R23/24/25 R33 N; R51-53 |
T; N R: 23/24/25-33-51/53 S: (1/2-)28-36/37-45-61 |
|
|
|
612-035-00-4 |
2-methoxyaniline o-anisidine |
E |
201-963-1 |
90-04-0 |
Carc. Cat. 2; R45 Muta Cat. 3; R68 T; R23/24/25 |
T R: 45-23/24/25-68 S: 53-45 |
|
|
|
612-042-00-2 |
benzidine 1,1′-biphenyl-4,4′-diamine 4,4′-diaminobiphenyl biphenyl-4,4′-ylenediamine |
E |
202-199-1 |
92-87-5 |
Carc. Cat. 1; R45 Xn; R22 N; R50-53 |
T; N R: 45-22-50/53 S: 53-45-60-61 |
C ≥ 25 %: T, N; R45-22-50/53 2,5 % ≤ C < 25 %: T, N; R45-51/53 0,01 % ≤ C < 2,5 %: T; R45 |
|
|
612-051-00-1 |
4,4′-diaminodiphenylmethane 4,4′-methylenedianiline |
E |
202-974-4 |
101-77-9 |
Carc. Cat. 2; R45 Muta. Cat. 3; R68 T; R39/23/24/25 Xn; R48/20/21/22 R43 N; R51-53 |
T; N R: 45-39/23/24/25-43-48/20/21/22-68-51/53 S: 53-45-61 |
|
|
|
612-054-00-8 |
N,N-diethylaniline |
|
202-088-8 |
91-66-7 |
T; R23/24/25 R33 N; R51-53 |
T; N R: 23/24/25-33-51/53 S: (1/2-)28-37-45-61 |
C ≥ 25 %: T, N; R23/24/25-33-51/53 5 % ≤ C < 25 %: T; R23/24/25-33-52/53 2,5 % ≤ C < 5 %: Xn; R20/21/22-33-52/53 1 % ≤ C < 2,5 %: Xn; R20/21/22-33 |
|
|
612-056-00-9 |
N,N-dimethyl-p-toluidine [1] N,N-dimethyl-m-toluidine [2] N,N-dimethyl-o-toluidine [3] |
C |
202-805-4 [1] 204-495-6 [2] 210-199-8 [3] |
99-97-8 [1] 121-72-2 [2] 609-72-3 [3] |
T; R23/24/25 R33 R52-53 |
T R: 23/24/25-33-52/53 S: (1/2-)28-36/37-45-61 |
C ≥ 25 %: T; R23/24/25-33-52-53 5 % ≤ C < 25 %: T; R23/24/25-33 1 % ≤ C < 5 %: Xn; R20/21/22-33 |
|
|
612-059-00-5 |
3,6-diazaoctanethylenediamin triethylenetetramine |
|
203-950-6 |
112-24-3 |
Xn; R21 C; R34 R43 R52-53 |
C R: 21-34-43-52/53 S: (1/2-)26-36/37/39-45-61 |
C ≥ 25 %: C; R21-34-43-52/53 10 % ≤ C < 25 %: C; R34-43 5 % ≤ C < 10 %: Xi; R36/38-43 1 % ≤ C < 5 %: Xi; R43 |
|
|
612-060-00-0 |
3,6,9-triazaundecamethylenediamine tetraethylenepentamine |
|
203-986-2 |
112-57-2 |
Xn; R21/22 C; R34 R43 N; R51-53 |
C; N R: 21/22-34-43-51/53 S: (1/2-)26-36/37/39-45-61 |
C ≥ 25 %: C, N; R21/22-34-43-51/53 10 % ≤ C < 25 %: C; R34-43-52/53 5 % ≤ C < 10 %: Xi; R36/38-43-52/53 2,5 % ≤ C < 5 %: Xi; R43-52/53 1 % ≤ C < 2,5 %: Xi; R43 |
|
|
612-064-00-2 |
3,6,9,12-tetra-azatetradecamethylenediamine pentacthylenehexamine |
|
223-775-9 |
4067-16-7 |
C; R34 R43 N; R50-53 |
C; N R: 34-43-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R34-43-50/53 10 % ≤ C < 25 %: C, N; R34-43-51/53 5 % ≤ C < 10 %: Xi, N; R36/38-43-51/53 2,5 % ≤ C < 5 %: Xi, N; R43-51/53 1 % ≤ C < 2,5 %: Xi; R43-52/53 0,25 % ≤ C < 1 %: R52/53 |
|
|
612-065-00-8 |
polyethlyenepolyamines with the exception of those specified elsewhere in this Annex |
|
— |
— |
Xn; R21/22 C; R34 R43 N; R50-53 |
C; N R: 21/22-34-43-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R21/22-34-43-50/53 10 % ≤ C < 25 %: C, N; R34-43-51/53 5 % ≤ C < 10 %: Xi, N; R36/38-43-51/53 1 % ≤ C < 2,5 %: Xi; R43-52/53 0,25 % ≤ C < 1 %: R52/53 |
|
|
612-066-00-3 |
dicyclohexylamine |
|
202-980-7 |
101-83-7 |
Xn; R22 C; R34 N; R50-53 |
C; N R: 22-34-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R22-34-50/53 10 % ≤ C < 25 %: C, N; R34-51/53 2,5 % ≤ C < 10 %: Xi, N; R36/38-51/53 2 % ≤ C < 2,5 %: Xi; R36/38-52/53 0,25 % ≤ C < 2 %: R52/53 |
|
|
612-067-00-9 |
3-aminomethyl-3,5,5-trimethylcyclohexylamine |
|
220-666-8 |
2855-13-2 |
Xn; R21/22 C; R34 R43 R52-53 |
C R: 21/22-34-43-52/53 S: (1/2-)26-36/37/39-45-61 |
C ≥ 25 %: C; R21/22-34-43-52/53 10 % ≤ C < 25 %: C; R34-43 5 % ≤ C < 10 %: Xi; R36/38-43 1 % ≤ C < 5 %: Xi; R43 |
|
|
612-077-00-3 |
dimethylnitrosoamine N-nitrosodimethylamine |
E |
200-549-8 |
62-75-9 |
Carc. Cat. 2; R45 T+; R26 T; R25-48/25 N; R51-53 |
T+; N R: 45-25-26-48/25-51/53 S: 53-45-61 |
C ≥ 25 %: T+, N; R45-25-26-48/25-51/53 10 % ≤ C < 25 %: T+; R45-22-26-48/25-52/53 7 % ≤ C < 10 %: T+; R45-22-26-48/22-52/53 3 % ≤ C < 7 %: T; R45-22-23-48/22-52/53 2,5 % ≤ C < 3 %: T; R45-23-48/22-52/53 1 % ≤ C < 2,5 %: T; R45-23-48/22 0,1 % ≤ C < 1 %: T; R45-20 0,001 % ≤ C < 0,1 %: T; R45 |
|
|
612-086-00-2 |
amitraz (ISO) N,N-bis(2,4-xylyliminomethyl) methylamine |
|
251-375-4 |
33089-61-1 |
Xn; R22-48/22 R43 N; R50-53 |
Xn; N R: 22-43-48/22-50/53 S: (2-)22-60-24-61-36/37 |
C ≥ 25 %: Xn, N; R22-43-48/22-50-53 10 % ≤ C < 25 %: Xn, N; R43-48/22-50-53 2,5 % ≤ C < 10 %: N; R43-50-53 1 % ≤ C < 2,5 %: N; R43-51-53 0,25 % ≤ C < 1 %: N; R51-53 0,025 % ≤ C < 0,25 %: R52-53 |
|
|
612-087-00-8 |
guazatine |
|
236-855-3 |
13516-27-3 |
T+; R26 Xn; R21/22 Xi; R37/38-41 N; R50-53 |
T+; N R: 21/22-26-37/38-41-50/53 S: (1/2-)26-28-36/37/39-38-45-46-60-61-63 |
|
|
|
612-094-00-6 |
4-(2-chloro-4-trifluoromethyl)phenoxy-2-fluoroaniline hydrochloride |
|
402-190-4 |
— |
T; R48/25 Xn; R22-48/20 Xi; R41 R43 N; R50-53 |
T; N R: 22-41-43-48/20-48/25-50/53 S: (1/2-)26-36/37/39-45-60-61 |
|
|
|
612-121-00-1 |
amines, polyethylenepoly- HEPA |
|
268-626-9 |
68131-73-7 |
Xn; R21/22 C; R34 R43 N; R50-53 |
C; N R: 21/22-34-43-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R21/22-34-43-50/53 10 % ≤ C < 25 %: C, N; R34-43-51/53 5 % ≤ C < 10 %: Xi, N; R36/38-43-51/53 2,5 % ≤ C < 5 %: Xi, N; R43-51/53 1 % ≤ C < 2,5 %: Xi; R43-52/53 0,25 % ≤ C < 1 %: R52/53 |
|
|
612-136-00-3 |
N-isopropyl-N′-phenyl-p-phenylenediamine |
|
202-969-7 |
101-72-4 |
Xn; R22 R43 N; R50-53 |
Xn; N R: 22-43-50/53 S: (2-)24-37-60-61 |
C ≥ 25 %: Xn, N; R22-43-50/53 2,5 % ≤ C < 25 %: Xi, N; R43-51/53 0,25 % ≤ C < 2,5 %: Xi; R43-52/53 0,1 % ≤ C < 0,25 %: Xi; R43 |
|
|
612-151-00-5 |
diaminotoluene, technical product - mixture of [2] and [3] methyl-phenylenediamine [1] 4-methyl-m-phenylene diamine [2] 2-methyl-m-phenylene diamine [3] |
E |
246-910-3 [1] 202-453-1 [2] 212-513-9 [3] |
25376-45-8 [1] 95-80-7 [2] 823-40-5 [3] |
Carc. Cat. 2; R45 T; R25 Xn; R20/21 Xi; R36 R43 N; R51-53 |
T; N R: 45-20/21-25-36-43-51/53 S: 53-45-61 |
|
|
|
613-009-00-5 |
2,4,6-trichloro-1,3,5-triazine cyanuric chloride |
|
203-614-9 |
108-77-0 |
T+; R26 Xn; R22 C; R34 R43 R14 |
T+; C R: 14-22-26-34-43 S: (1/2-)26-28-36/37/39-45-46-63 |
C ≥ 25 %: T+; R22-26-34-43 10 % ≤ C < 25 %: T+; R26-34-43 7 % ≤ C < 10 %: T+; R26-36/37/38-43 5 % ≤ C < 7 %: T; R23-36/37/38-43 1 % ≤ C < 5 %: T; R23-43 0,1 % ≤ C < 1 %: Xn; R20 |
|
|
613-011-00-6 |
amitrole (ISO) 1,2,4-triazol-3-ylamine |
|
200-521-5 |
61-82-5 |
Repr.Cat.3; R63 Xn; R48/22 N; R51-53 |
Xn; N R: 48/22-63-51/53 S: (2-)13-36/37-61 |
|
|
|
613-033-00-6 |
2-methylaziridine propyleneimine |
E |
200-878-7 |
75-55-8 |
F; R11 Carc. Cat. 2; R45 T+; R26/27/28 Xi; R41 N; R51-53 |
F; T+; N R: 45-11-26/27/28-41-51/53 S: 53-45-61 |
C ≥ 25 %: T+, N; R45-26/27/28-41-51/53 10 % ≤ C < 25 %: T+; R45-26/27/28-41-52/53 7 % ≤ C < 10 %: T+; R45-26/27/28-36-52/53 5 % ≤ C < 7 %: T; R45-23/24/25-36-52/53 2,5 % ≤ C < 5 %: T; R45-23/24/25-52/53 1 % ≤ C < 2,5 %: T; R45-23/24/25 0,1 % ≤ C < 1 %: T; R45-20/21/22 0,01 % ≤ C < 0,1 %: T; R45 |
|
|
613-040-00-4 |
azaconazole (ISO) 1-{[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}-1H-1,2.4-triazole |
|
262-102-3 |
60207-31-0 |
Xn; R22 |
Xn R: 22 S: (2-)46 |
|
|
|
613-043-00-0 |
imazalil sulphate (ISO) powder 1-[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [1] (±)-1-[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] |
|
261-351-5 [1] 281-291-3 [2] |
58594-72-2 [1] 83918-57-4 [2] |
Xn; R22 R43 N; R50-53 |
Xn; N R: 22-43-50/53 S: (2-)24/25-37-46-60-61 |
|
|
|
613-048-00-8 |
carbendazim (ISO) methyl benzimidazol-2-ylcarbamate |
|
234-232-0 |
10605-21-7 |
Muta. Cat. 2; R46 Repr.Cat.2; R60-61 N; R50-53 |
T; N R: 46-60-61-50/53 S: 53-45-60-61 |
|
|
|
613-049-00-3 |
benomyl (ISO) methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate |
|
241-775-7 |
17804-35-2 |
Muta. Cat. 2; R46 Repr.Cat.2; R60-61 Xi; R37/38 R43 N; R50-53 |
T; N R: 46-60-61-37/38-43-50/53 S: 53-45-60-61 |
C ≥ 20 %: T, N; R46-60-61-37/38-43-50-53 2,5 % ≤ C < 20 %: T, N; R46-60-61-43-50-53 1 % ≤ C < 2,5 %: T, N; R46-60-61-43-51-53 0,5 % ≤ C < 1 %: T, N; R46-60-61-51-53 0,25 % ≤ C < 0,5 %: T, N; R46-51-53 0,1 % ≤ C < 0,25 %: T; R46-52-53 0,025 % ≤ C < 0,1 %: R52-53 |
|
|
613-051-00-4 |
molinate (ISO) S-ethyl 1-perhydroazepinecarbothioate S-ethyl perhydroazepine-1-carbothioate |
|
218-661-0 |
2212-67-1 |
Carc.Cat3; R40 Repr.Cat3; R62 Xn; R20/22 Xn; R48/22 R43 N; R50-53 |
T; N R: 20/22-40-43-48/22-63-50/53 S: (2-)36/37-46-60-61 |
C ≥ 25 %: Xn, N; R20/22-40-43-48/22-62-50-53 10 % ≤ C < 25 %: Xn, N; R40-43-48/22-62-50-53 5 % ≤ C < 10 %: Xn, N; R40-43-62-50-53 1 % ≤ C < 5 %: Xn, N; R40-43-50-53 0,25 % ≤ C < 1 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
613-058-00-2 |
permethrin (ISO) m-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
|
258-067-9 |
52645-53-1 |
Xn; R20/22 R43 N; R50-53 |
Xn; N R: 20/22-43-50/53 S: (2-)13-24-36/37/39-60-61 |
C ≥ 25 %: Xn, N; R20/22-43-50-53 1 % ≤ C < 25 %: N; R43-50-53 0,025 % ≤ C < 1 %: N; R50-53 0,0025 % ≤ C < 0,025 %: N; R51-53 0,00025 % ≤ C < 0,0025 %: R52-53 |
|
|
613-075-00-5 |
1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione |
|
401-570-7 |
89415-87-2 |
O; R8 T; R23 C; R34 Xn; R22 R43 N; R50 |
O; T; N R: 8-22-23-34-43-50 S: (1/2-)8-26-36/37/39-45-61 |
|
|
|
613-088-00-6 |
1,2-benzisothiazol-3(2H)-one 1,2-benzisothiazolin-3-one |
|
220-120-9 |
2634-33-5 |
Xn; R22 Xi; R38-41 R43 N; R50 |
Xn; N R: 22-38-41-43-50 S: (2-)24-26-37/39-61 |
C ≥ 25 %: Xn, N; R22-38-41-43-50 20 % ≤ C < 25 %: Xi; R38-41-43 10 % ≤ C < 20 %: Xi; R41-43 5 % ≤ C < 10 %: Xi; R36-43 0,05 % ≤ C < 5 %: Xi; R43 |
|
|
613-112-00-5 |
2-octyl-2H-isothiazol-3-one |
|
247-761-7 |
26530-20-1 |
T; R23/24 Xn; R22 C; R34 R43 N; R50-53 |
T; N R: 22-23/24-34-43-50/53 S: (1/2-)26-36/37/39-45-60-61 |
C ≥ 25 %: T, N; R22-23/24-34-43-50/53 10 % ≤ C < 25 %: C, N; R20/21-34-43-51/53 5 % ≤ C < 10 %: Xn, N; R20/21-36/38-43-51/53 3 % ≤ C < 5 %: Xn, N; R20/21-43-51/53 2,5 % ≤ C < 3 %: Xi, N; R43-51/53 0,25 % ≤ C < 2,5 %: Xi; R43-52/53 0,05 % ≤ C < 0,25 %: Xi; R43 |
|
|
613-124-00-0 |
fenpropimorph cis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
|
266-719-9 |
67564-91-4 |
Repr. Cat. 3; R63 Xn; R22 Xi; R38 N; R51-53 |
Xn; N R: 22-38-63-51/53 S: (2-)36/37-46-61 |
|
|
|
613-129-00-8 |
metamitron 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one |
|
255-349-3 |
41394-05-2 |
Xn; R22 N; R50 |
Xn; N R: 22-50 S: (2-)61 |
|
|
|
613-167-00-5 |
mixture of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7] and 2-methyl-2Hisothiazol-3-one [EC no. 220-239-6] (3:1) mixture of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7] and 2-methyl-4-isothiazolin-3-one [EC no. 220-239-6] (3:1) |
|
— |
55965-84-9 |
T; R23/24/25 C; R34 R43 N; R50-53 |
T; N R: 23/24/25-34-43-50/53 S: (2-)26-28-36/37/39-45-60-61 |
C ≥ 25 %: T, N; R23/24/25-34-43-50/53 3 % ≤ C < 25 %: C, N; R20/21/22-34-43-51/53 2,5 % ≤ C < 3 %: C, N; R34-43-51/53 0,6 % ≤ C < 2,5 %: Xi; R34-43-52/53 0,25 % ≤ C < 0,6 %: Xi; R33/38-43-52/53 0,06 % ≤ C < 0,25 %: Xi; R36/38-43 0,0015 % ≤ C < 0,06 %: Xi; R43 |
|
|
613-175-00-9 |
Epoxiconazole (2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxirane |
|
406-850-2 |
133855-98-8 |
Carc. Cat. 3; R40 Repr. Cat. 3; R62 Repr. Cat. 3; R63 N; R51-53 |
Xn; N R: 40-62-63-51/53 S: (2-)36/37-46-61 |
|
|
|
615-001-00-7 |
methyl isocyanate |
|
210-866-3 |
624-83-9 |
F+; R12 Repr.Cat.3; R63 T+; R26 T; R24/25 R42/43 Xi; R37/38-41 |
F+; T+ R: 12-24/25-26-37/38-41-42/43-63 S: (1/2-)26-27/28-36/37/39-45-63 |
|
|
|
615-004-00-3 |
salts of thiocyanic acid |
A |
— |
— |
Xn; R20/21/22 R32 R52-53 |
Xn R: 20/21/22-32-52/53 S: (2-)13-61 |
|
|
|
615-006-00-4 |
2-methyl-m-phenylene diisocyanate toluene-2,4-di-isocyanate [1] 4-methyl-m-phenylene diisocyanate toluene-2,6-di-isocyanate [2] m-tolylidene diisocyanate toluene-diisocyanate [3] |
|
202-039-0 [1] 209-544-5 [2] 247-722-4 [3] |
91-08-7 [1] 584-84-9 [2] 26471-62-5 [3] |
Carc. Cat. 3; R40 T+; R26 Xi; R36/37/38 R42/43 R52-53 |
T+ R: 26-36/37/38-40-42/43-52/53 S: (1/2-)23-36/37-45-61 |
C ≥ 25 %: T+; R26-36/37/38-40-42/43-52/53 20 % ≤ C < 25 %: T+; R26-36/37/38-40-42/43 7 % ≤ C < 20 %: T+; R26-40-42/43 1 % ≤ C < 7 %: T; R23-40-42/43 0,1 % ≤ C < 1 %: Xn; R20-42 |
|
|
615-008-00-5 |
3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate isophorone di-isocyanate |
|
223-861-6 |
4098-71-9 |
T; R23 Xi; R36/37/38 R42/43 N; R51-53 |
T; N R: 23-36/37/38-42/43-51/53 S: (1/2-)26-28-38-45-61 |
C ≥ 25 %: T, N; R23-36/37/38-42/43-51/53 20 % ≤ C < 25 %: T; R23-36/37/38-42/43-52/53 2,5 % ≤ C < 20 %: T; R23-42/43-52/53 2 % ≤ C < 2,5 %: T; R23-42/43 0,5 % ≤ C < 2 %: Xn; R20-42/43 |
2 |
|
615-015-00-3 |
1,7,7-trimethylbicyclo(2,2,1)hept-2-yl thiocyanatoacetate isobornyl thiocyanoacetate |
|
204-081-5 |
115-31-1 |
Xn; R22 N; R50-53 |
Xn; N R: 22-50/53 S: (2-)24/25-60-61 |
|
|
|
616-015-00-6 |
alachlor (ISO) 2-chloro-2′,6′-diethyl-N-(methoxymethyl)acetanilide |
|
240-110-8 |
15972-60-8 |
Carc. Cat. 3; R40 Xn; R22 R43 N; R50-53 |
Xn; N R: 22-40-43-50/53 S: (2-)36/37-46-60-61 |
C ≥ 25 %: Xn, N; R22-40-43-50-53 1 % ≤ C < 25 %: Xn, N; R40-43-50-53 0,25 % ≤ C < 1 %: N; R50-53 0,025 % ≤ C < 0,25 %: N; R51-53 0,0025 % ≤ C < 0,025 %: R52-53 |
|
|
616-024-00-5 |
2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2-chloro-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilide |
|
402-260-4 |
— |
R53 |
R: 53 S: 61 |
|
|
|
617-002-00-8 |
α,α-dimethylbenzyl hydroperoxide cumene hydroperoxide |
|
201-254-7 |
80-15-9 |
O; R7 T; R23 Xn; R21/22-48/20/22 C; R34 N; R51-53 |
O; T; N R: 7-21/22-23-34-48/20/22-51/53 S: (1/2-)3/7-14-36/37/39-45-50-61 |
C ≥ 25 %: T, N; R21/22-23-34-48/20/22-51/53 10 % ≤ C < 25 %: C; R20-34-48/20/22-52/53 3 % ≤ C < 10 %: Xn; R20-37/38-41-52/53 2,5 % ≤ C < 3 %: Xi; R36/37-52/53 1 % ≤ C < 2,5 %: Xi; R36/37 |
|
|
617-004-00-9 |
1,2,3,4-tetrahydro-1-naphthyl hydroperoxide |
|
212-230-0 |
771-29-9 |
O; R7 Xn; R22 C; R34 N; R50-53 |
O; C; N R: 7-22-34-50/53 S: (1/2-)3/7-14-26-36/37/39-45-60-61 |
C ≥ 25 %: C, N; R22-34-50/53 10 % ≤ C < 25 %: C, N; R34-51/53 5 % ≤ C < 10 %: Xi, N; R36/37/38-51/53 2,5 % ≤ C < 5 %: N; R51/53 0,25 % ≤ C < 2,5 %: R52/53 |
|
|
648-043-00-X |
Creosote oil, acenaphthene fraction, acenaphthene-free Wash Oil Redistillate [The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] |
H |
292-606-9 |
90640-85-0 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
648-080-00-1 |
Residues (coal tar), creosote oil distn. Wash Oil Redistillate [The residue from the fractional distillation of wash oil boiling in the approximate range of 270 °C to 330 °C (518 °F to 626 °F). It consists predominantly of dinuclear aromatic and heterocyclic hydrocarbons.] |
H |
295-506-3 |
92061-93-3 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
648-098-00-X |
Creosote oil, acenaphthene fraction Wash Oil [A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240 °C to 280 °C (464 °F to 536 °F). Composed primarily of acenaphthene, naphthalene and alkyl naphthalene.] |
H |
292-605-3 |
90640-84-9 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
648-099-00-5 |
Creosote oil [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200 °C to 325 °C (392 °F to 617 °F).] |
H |
263-047-8 |
61789-28-4 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
648-100-00-9 |
Creosote oil, high-boiling distillate Wash Oil [The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillates, removed. It is crystal free at approximately 5 °C (41 °F).] |
H |
274-565-9 |
70321-79-8 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
648-101-00-4 |
Creosote [The distillate of coal tar produced by the high temperature carbonization of bituminous coal. It consists primarily of aromatic hydrocarbons, tar acids and tar bases.] |
H |
232-287-5 |
8001-58-9 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
648-102-00-X |
Extract residues (coal), creosote oil acid Wash Oil Extract Residue [A complex combination of hydrocarbons from the base-freed fraction from the distillation of coal tar, boiling in the range of approximately 250 °C to 280 °C (482 °F to 536 °F). It consists predominantly of biphenyl and isomeric diphenylnaphthalenes.] |
H |
310-189-4 |
122384-77-4 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
648-138-00-6 |
Creosote oil, low-boiling distillate Wash Oil [The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillate, removed. It is crystal free at approximately 38 °C (100 °F).] |
H |
274-566-4 |
70321-80-1 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
649-001-00-3 |
Extracts (petroleum), light naphthenic distillate solvent |
H |
265-102-1 |
64742-03-6 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
649-002-00-9 |
Extracts (petroleum), heavy paraffinic distillate solvent |
H |
265-103-7 |
64742-04-7 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
649-003-00-4 |
Extracts (petroleum), light paraffinic distillate solvent |
H |
265-104-2 |
64742-05-8 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
649-004-00-X |
Extracts (petroleum), heavy naphthenic distillate solvent |
H |
265-111-0 |
64742-11-6 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
649-005-00-5 |
Extracts (petroleum), light vacuum gas oil solvent |
H |
295-341-7 |
91995-78-7 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
649-006-00-0 |
hydrocarbons C26-55, arom-rich |
H |
307-753-7 |
97722-04-8 |
Carc. Cat. 2; R45 |
T R: 45 S: 53-45 |
|
|
|
649-062-00-6 |
Gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free Petroleum gas [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked hydrocarbons and treated to remove acidic impurities. It consists of hydrocarbons having carbon numbers in the range of C2 through C4, predominantly C3.] |
H K |
270-755-0 |
68477-73-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-063-00-1 |
Gases (petroleum), catalytic cracker Petroleum gas [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-756-6 |
68477-74-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-064-00-7 |
Gases (petroleum), catalytic cracker, C1-5-rich Petroleum gas [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C5.] |
H K |
270-757-1 |
68477-75-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-065-00-2 |
Gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic polymerized naphtha. It consists of aliphatic hydrocarbons having carbon numbers in the range of C2 through C6, predominantly C2 through C4.] |
H K |
270-758-7 |
68477-76-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-066-00-8 |
Gases (petroleum), catalytic reformer, C1-4-rich Petroleum gas [A complex combination of hydrocarbons produced by distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C4.] |
H K |
270-760-8 |
68477-79-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-067-00-3 |
Gases (petroleum), C3-5 olefinic-paraffinic alkylation feed Petroleum gas [A complex combination of olefinic and paraffinic hydrocarbons having carbon numbers in the range of C3 through C5 which are used as alkylation feed. Ambient temperatures normally exceed the critical temperature of these combinations.] |
H K |
270-765-5 |
68477-83-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-068-00-9 |
Gases (petroleum), C4-rich Petroleum gas [A complex combination of hydrocarbons produced by distillation of products from a catalytic fractionation process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] |
H K |
270-767-6 |
68477-85-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-069-00-4 |
Gases (petroleum), deethanizer overheads Petroleum gas [A complex combination of hydrocarbons produced from distillation of the gas and gasoline fractions from the catalytic cracking process. It contains predominantly ethane and ethylene.] |
H K |
270-768-1 |
68477-86-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-070-00-X |
Gases (petroleum), deisobutanizer tower overheads Petroleum gas [A complex combination of hydrocarbons produced by the atmospheric distillation of a butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] |
H K |
270-769-7 |
68477-87-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-071-00-5 |
Gases (petroleum), depropanizer dry, propene-rich Petroleum gas [A complex combination of hydrocarbons produced by the distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists predominantly of propylene with some ethane and propane.] |
H K |
270-772-3 |
68477-90-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-072-00-0 |
Gases (petroleum), depropanizer overheads Petroleum gas [A complex combination of hydrocarbons produced by distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] |
H K |
270-773-9 |
68477-91-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-073-00-6 |
Gases (petroleum), gas recovery plant depropanizer overheads Petroleum gas [A complex combination of hydrocarbons obtained by fractionation of miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4, predominantly propane.] |
H K |
270-777-0 |
68477-94-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-074-00-1 |
Gases (petroleum), Girbatol unit feed Petroleum gas [A complex combination of hydrocarbons that is used as the feed into the Girbatol unit to remove hydrogen sulfide. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] |
H K |
270-778-6 |
68477-95-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-075-00-7 |
Gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free Petroleum gas |
H K |
270-782-8 |
68477-99-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-076-00-2 |
Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum Petroleum gas [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked clarified oil and thermal cracked vacuum residue. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-802-5 |
68478-21-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-077-00-8 |
Tail gas (petroleum), catalytic cracked naphtha stabilization absorber Petroleum gas [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-803-0 |
68478-22-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-078-00-3 |
Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation of products from catalytic cracking, catalytic reforming and hydrodesulfurizing processes treated to remove acidic impurities. It consists predominantly of hydrocarbons having cabon numbers predominantly in the range of C1 through C5.] |
H K |
270-804-6 |
68478-24-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-079-00-9 |
Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic reformed naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
270-806-7 |
68478-26-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-080-00-4 |
Tail gas (petroleum), saturate gas plant mixed stream, C4-rich Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation stabilization of straight-run naphtha, distillation tail gas and catalytic reformed naphtha stabilizer tail gas. It consists of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly butane and isobutane.] |
H K |
270-813-5 |
68478-32-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-081-00-X |
Tail gas (petroleum), saturate gas recovery plant, C1-2-rich Petroleum gas [A complex combination of hydrocarbons obtained from fractionation of distillate tail gas, straight-run naphtha, catalytic reformed naphtha stabilizer tail gas. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C5, predominantly methane and ethane.] |
H K |
270-814-0 |
68478-33-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-082-00-5 |
Tail gas (petroleum), vacuum residues thermal cracker Petroleum gas [A complex combination of hydrocarbons obtained from the thermal cracking of vacuum residues. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
270-815-6 |
68478-34-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-083-00-0 |
Hydrocarbons, C3-4-rich, petroleum distillate Petroleum gas [A complex combination of hydrocarbons produced by distillation and condensation of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C3 through C4.] |
H K |
270-990-9 |
68512-91-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-084-00-6 |
Gases (petroleum), full-range straight-run naphtha dehexanizer off petroleum gas [A complex combination of hydrocarbons obtained by the fractionation of the full-range straight-run naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] |
H K |
271-000-8 |
68513-15-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-085-00-1 |
Gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich Petroleum gas [A complex combination of hydrocarbon produced by the distillation of products from a hydrocracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4. It may also contain small amounts of hydrogen and hydrogen sulfide.] |
H K |
271-001-3 |
68513-16-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-086-00-7 |
Gases (petroleum), light straight-run naphtha stabilizer off Petroleum gas [A complex combination of hydrocarbons obtained by the stabilization of light straight-run naphtha. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] |
H K |
271-002-9 |
68513-17-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-087-00-2 |
Residues (petroleum), alkylation splitter, C4-rich Petroleum gas [A complex residuum from the distillation of streams various refinery operations. It consists of hydrocarbons having carbon numbers in the range of C4 through C5, predominantly butane and boiling in the range of approximately -11.7 °C to 27.8 °C (11 °F to 82 °F).] |
H K |
271-010-2 |
68513-66-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-088-00-8 |
Hydrocarbons, C1-4 Petroleum gas [A complex combination of hydrocarbons provided by thermal cracking and absorber operations and by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately minus 164 °C to minus 0.5 °C (-263 °F to 31 °F).] |
H K |
271-032-2 |
68514-31-8 |
Carc. Cat 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-089-00-3 |
Hydrocarbons, C1-4, sweetened Petroleum gas [A complex combination of hydrocarbons obtained by subjecting hydrocarbon gases to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately -164 °C to -0.5 °C (-263 °F to 31 °F).] |
H K |
271-038-5 |
68514-36-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-090-00-9 |
Hydrocarbons, C1-3 Petroleum gas [A complex combination of hydrocarbons having carbon numbers predominantly in the range of C1 through C3 and boiling in the range of approximately minus 164 °C to minus 42 °C (-263 °F to -44 °F).] |
H K |
271-259-7 |
68527-16-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-091-00-4 |
Hydrocarbons, C1-4, debutanizer fraction Petroleum gas |
H K |
271-261-8 |
68527-19-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-092-00-X |
Gases (petroleum), C1-5, wet Petroleum gas [A complex combination of hydrocarbons produced by the distillation of crude oil and/or the cracking of tower gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
271-624-0 |
68602-83-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-093-00-5 |
Hydrocarbons, C2-4 Petroleum gas |
H K |
271-734-9 |
68606-25-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-094-00-0 |
Hydrocarbons, C3 Petroleum gas |
H K |
271-735-4 |
68606-26-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-095-00-6 |
Gases (petroleum), alkylation feed Petroleum gas [A complex combination of hydrocarbons produced by the catalytic cracking of gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] |
H K |
271-737-5 |
68606-27-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-096-00-1 |
Gases (petroleum), depropanizer bottoms fractionation off Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists predominantly of butane, isobutane and butadiene.] |
H K |
271-742-2 |
68606-34-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-097-00-7 |
Gases (petroleum), refinery blend Petroleum gas [A complex combination obtained from various processes. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
272-183-7 |
68783-07-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-098-00-2 |
Gases (petroleum), catalytic cracking Petroleum gas [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] |
H K |
272-203-4 |
68783-64-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-099-00-8 |
Gases (petroleum), C2-4, sweetened Petroleum gas [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C2 through C4 and boiling in the range of approximately -51 °C to -34 °C (-60 °F to -30 °F).] |
H K |
272-205-5 |
68783-65-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-100-00-1 |
Gases (petroleum), crude oil fractionation off Petroleum gas [A complex combination of hydrocarbons produced by the fractionation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
272-871-7 |
68918-99-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-101-00-7 |
Gases (petroleum), dehexanizer off Petroleum gas [A complex combination of hydrocarbons obtained by the fractionation of combined naphtha streams. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
272-872-2 |
68919-00-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-102-00-2 |
Gases (petroleum), light straight run gasoline fractionation stabilizer off Petroleum gas [A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
272-878-5 |
68919-05-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-103-00-8 |
Gases (petroleum), naphtha unifiner desulfurization stripper off Petroleum gas [A complex combination of hydrocarbons produced by a naphtha unifiner desulfurization process and stripped from the naphtha product. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
272-879-0 |
68919-06-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-104-00-3 |
Gases (petroleum), straight-run naphtha catalytic reforming off Petroleum gas [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and fractionation of the total effluent. It consists of methane, ethane, and propane.] |
H K |
272-882-7 |
68919-09-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-105-00-9 |
Gases (petroleum), fluidized catalytic cracker splitter overheads Petroleum gas [A complex combination of hydrocarbons produced by the fractionation of the charge to the C3-C4 splitter. It consists predominantly of C3 hydrocarbons.] |
H K |
272-893-7 |
68919-20-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-106-00-4 |
Gases (petroleum), straight-run stabilizer off Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation of the liquid from the first tower used in the distillation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
272-883-2 |
68919-10-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45 S: 53-45 |
|
|
|
649-107-00-X |
Gases (petroleum), catalytic cracked naphtha debutanizer Petroleum gas [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
273-169-3 |
68952-76-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-108-00-5 |
Tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer Petroleum gas [A complex combination of hydrocarbons obtained by the fractionation of catalytic cracked naphtha and distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
273-170-9 |
68952-77-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-109-00-0 |
Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber petroleum gas [A complex combination of hydrocarbons obtained from the separation of thermal-cracked distillates, naphtha and gas oil. It consists pedrominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
273-175-6 |
68952-81-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-110-00-6 |
Tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation stabilization of thermal cracked hydrocarbons from petroleum coking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
273-176-1 |
68952-82-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-111-00-1 |
Gases (petroleum, light steam-cracked, butadiene conc. Petroleum gas [A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process, It consists of hydrocarbons having a carbon number predominantly of C4.] |
H K |
273-265-5 |
68955-28-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-112-00-7 |
Gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead Petroleum gas [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] |
H K |
273-270-2 |
68955-34-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-113-00-2 |
Hydrocarbons, C4 Petroleum gas |
H K |
289-339-5 |
87741-01-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-114-00-8 |
Alkanes, C1-4, C3-rich Petroleum gas |
H K |
292-456-4 |
90622-55-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-115-00-3 |
Gases (petroleum), steam-cracker C3-rich Petroleum gas [A complex combination of hydrocarbons produced by the distillation of products from a steam cracking process. It consists predominantly of propylene with some propane and boils in the range of approximately -70 °C to 0 °C (-94 °F to 32 °F).] |
H K |
295-404-9 |
92045-22-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-116-00-9 |
Hydrocarbons, C4, steam-cracker distillate Petroleum gas [A complex combination of hydrocarbons produced by the distillation of the products of a steam cracking process. It consists predominantly of hydrocarbons having a carbon number of C4, predominantly 1-butene and 2-butene, containing also butane and isobutene and boiling in the range of approximately minus 12 °C to 5 °C (10.4 °F to 41 °F).] |
H K |
295-405-4 |
92045-23-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-117-00-4 |
Petroleum gases, liquefied, sweetened, C4 fraction Petroleum gas [A complex combination of hydrocarbons obtained by subjecting a liquified petroleum gas mix to a sweetening process to oxidize mercaptans or to remove acidic impurities. It consists predominantly of C4 saturated and unsaturated hydrocarbons.] |
HKS |
295-463-0 |
92045-80-2 |
F+; R12 Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
F+; T R: 12-45-46 S: 53-45 |
|
|
|
649-119-00-5 |
Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free Petroleum gas |
H K |
307-769-4 |
97722-19-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-120-00-0 |
Gases (petroleum), amine system feed Refinery gas [The feed gas to the amine system for removal of hydrogen sulfide. It consists of hydrogen. Carbon monoxide, carbon dioxide, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 may also be present.] |
H K |
270-746-1 |
68477-65-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-121-00-6 |
Gases (petroleum), benzene unit hydrodesulfurizer off Refinery gas [Off gases produced by the benzene unit. It consists primarily of hydrogen. Carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6, including benzene, may also be present.] |
H K |
270-747-7 |
68477-66-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-122-00-1 |
Gases (petroleum), benzene unit recycle, hydrogen-rich Refinery gas [A complex combination of hydrocarbons obtained by recycling the gases of the benzene unit. It consists primarily of hydrogen with various small amounts of carbon monoxide and hydrocarbons having carbon numbers in the range of C1 through C6.] |
H K |
270-748-2 |
68477-67-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-123-00-7 |
Gases (petroleum), blend oil, hydrogen-nitrogen-rich Refinery gas [A complex combination of hydrocarbons obtained by distillation of a blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide, and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
270-749-8 |
68477-68-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-124-00-2 |
Gases (petroleum), catalytic reformed naphtha stripper overheads Refinery gas [A complex combination of hydrocarbons obtained from stabilization of catalytic reformed naphtha. Its consists of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
270-759-2 |
68477-77-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-125-00-8 |
Gases (petroleum), C6-8 catalytic reformer recycle Refinery gas [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed and recycled to conserve hydrogen. It consists primarily of hydrogen. It may also contain various small amounts of carbon monoxide, carbon dioxide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-761-3 |
68477-80-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-126-00-3 |
Gases (petroleum), C6-8 catalytic reformer Refinery gas [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed. It consists of hydrocarbons having carbon numbers in the range of C1 through C5 and hydrogen.] |
H K |
270-762-9 |
68477-81-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-127-00-9 |
Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich Refinery gas |
H K |
270-763-4 |
68477-82-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-128-00-4 |
Gases (petroleum), C2-return stream Refinery gas [A complex combination of hydrocarbons obtained by the extraction of hydrogen from a gas stream which consists primarily of hydrogen with small amounts of nitrogen, carbon monoxide, methane, ethane, and ethylene. It contains predominantly hydrocarbons such as methane, ethane, and ethylene with small amounts of hydrogen, nitrogen and carbon monoxide.] |
H K |
270-766-0 |
68477-84-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-129-00-X |
Gases (petroleum), dry sour, gas-concn.-unit-off Refinery gas [The complex combination of dry gases from a gas concentration unit. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
H K |
270-774-4 |
68477-92-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-130-00-5 |
Gases (petroleum), gas concn. reabsorber distn. Refinery gas [A complex combination of hydrocarbons produced by distillation of products from combined gas streams in a gas concentration reabsorber. It consists predominantly of hydrogen, carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide and hydrocarbons having carbon numbers in the range of C1 through C3.] |
H K |
270-776-5 |
68477-93-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-131-00-0 |
Gases (petroleum), hydrogen absorber off Refinery gas [A complex combination obtained by absorbing hydrogen from a hydrogen rich stream. It consists of hydrogen, carbon monoxide, nitrogen, and methane with small amounts of C2 hydrocarbons.] |
H K |
270-779-1 |
68477-96-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-132-00-6 |
Gases (petroleum), hydrogen-rich Refinery gas [A complex combination separated as a gas from hydrocarbon gases by chilling. It consists primarily of hydrogen with various small amounts of carbon monoxide, nitrogen, methane, and C2 hydrocarbons.] |
H K |
270-780-7 |
68477-97-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-133-00-1 |
Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich Refinery gas [A complex combination obtained from recycled hydrotreated blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
270-781-2 |
68477-98-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-134-00-7 |
Gases (petroleum), recycle, hydrogen-rich Refinery gas [A complex combination obtained from recycled reactor gases. It consists primarily of hydrogen with various small amounts of carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] |
H K |
270-783-3 |
68478-00-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-135-00-2 |
Gases (petroleum), reformer make-up, hydrogen-rich Refinery gas [A complex combination obtained from the reformers. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
270-784-9 |
68478-01-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-136-00-8 |
Gases (petroleum), reforming hydrotreater Refinery gas [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen, methane, and ethane with various small amounts of hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 thorugh C5.] |
H K |
270-785-4 |
68478-02-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-137-00-3 |
Gases (petroleum), reforming hydrotreater, hydrogen-methane-rich Refinery gas [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen and methane with various small amounts of carbon monoxide, carbon dioxide, nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C5.] |
H K |
270-787-5 |
68478-03-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-138-00-9 |
Gases (petroleum), reforming hydrotreater make-up, hydrogen-rich Refinery gas [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
270-788-0 |
68478-04-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-139-00-4 |
Gases (petroleum), thermal cracking distn. Refinery gas [A complex combination produced by distillation of products from a thermal cracking process. It consists of hydrogen, hydrogen sulfide, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-789-6 |
68478-05-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-140-00-X |
Tail gas (petroleum), catalytic cracker refractionation absorber Refinery gas [A complex combination of hydrocarbons obtained from refractionation of products from a catalytic cracking process. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
H K |
270-805-1 |
68478-25-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-141-00-5 |
Tail gas (petroleum), catalytic reformed naphtha separator Refinery gas [A complex combination of hydrocarbons obtained from the catalytic reforming of straight run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-807-2 |
68478-27-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-142-00-0 |
Tail gas (petroleum), catalytic reformed naphtha stabilizer Refinery gas [A complex combination of hydrocarbons obtained from the stabilization of catalytic reformed naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-808-8 |
68478-28-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-143-00-6 |
Tail gas (petroleum), cracked distillate hydrotreater separator Refinery gas [A complex combination of hydrocarbons obtained by treating cracked distillates with hydrogen in the presence of a catalyst. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
270-809-3 |
68478-29-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-144-00-1 |
Tail gas (petroleum), hydrodesulfurized straight-run naphtha separator Refinery gas [A complex combination of hydrocarbons obtained from hydrodesulfurization of straight-run naphtha. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
270-810-9 |
68478-30-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-145-00-7 |
Gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads Refinery gas [A complex combination of hydrocarbons obtained from the catalytic reforming of straight-run naphtha followed by fractionation of the total effluent. It consists of hydrogen, methane, ethane and propane.] |
H K |
270-999-8 |
68513-14-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-146-00-2 |
Gases (petroleum), reformer effluent high-pressure flash drum off Refinery gas [A complex combination produced by the high-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] |
H K |
271-003-4 |
68513-18-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-147-00-8 |
Gases (petroleum), reformer effluent low-pressure flash drum off Refinery gas [A complex combination produced by low-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] |
H K |
271-005-5 |
68513-19-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-148-00-3 |
Gases (petroleum), oil refinery gas distn. off Refinery gas [A complex combination separated by distillation of a gas stream containing hydrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers in the range of C1 through C6 or obtained by cracking ethane and propane. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C2, hydrogen, nitrogen, and carbon monoxide.] |
H K |
271-258-1 |
68527-15-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-149-00-9 |
Gases (petroleum), benzene unit hydrotreater depentanizer overheads Refinery gas [A complex combination produced by treating the feed from the benzene unit with hydrogen in the presence of a catalyst followed by depentanizing. It consists primarily of hydrogen, ethane and propane with various small amounts of nitrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6. It may contain trace amounts of benzene.] |
H K |
271-623-5 |
68602-82-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-150-00-4 |
Gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator Refinery gas [A complex combination produced by the fractionation of the overhead products from the catalytic cracking process in the fluidized catalytic cracker. It consists of hydrogen, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
H K |
271-625-6 |
68602-84-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-151-00-X |
Petroleum products, refinery gases Refinery gas [A complex combination which consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] |
H K |
271-750-6 |
68607-11-4 |
Car. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-152-00-5 |
Gases (petroleum), hydrocracking low-pressure separator Refinery gas [A complex combination obtained by the liquid-vapor separation of the hydrocracking process reactor effluent. It consists predominantly of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
H K |
272-182-1 |
68783-06-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-153-00-0 |
Gases (petroleum), refinery Refinery gas [A complex combination obtained from various petroleum refining operations. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
H K |
272-338-9 |
68814-67-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-154-00-6 |
Gases (petroleum), platformer products separator off Refinery gas [A complex combination obtained from the chemical reforming of naphthenes to aromatics. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] |
H K |
272-343-6 |
68814-90-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-155-00-1 |
Gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off Refinery gas [The complex combination obtained from the depentanizer stabilization of hydrotreated kerosine. It consists primarily of hydrogen, methane, ethane, and propane with various small amounts of nitrogen, hydrogen sulfide, carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C4 through C5.] |
H K |
272-775-5 |
68911-58-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-156-00-7 |
Gases (petroleum), hydrotreated sour kerosine flash drum Refinery gas [A complex combination obtained from the flash drum of the unit treating sour kerosine with hydrogen in the presence of a catalyst. It consists primarily of hydrogen and methane with various small amounts of nitrogen, carbon monoxide, and hydro-carbons having carbon numbers predominantly in the range of C2 through C5.] |
H K |
272-776-0 |
68911-59-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-157-00-2 |
Gases (petroleum), distillate unifiner desulfurization stripper off Refinery gas [A complex combination stripped from the liquid product of the unifiner desulfurization process. It consists of hydrogen sulfide, methane, ethane, and propane.] |
H K |
272-873-8 |
68919-01-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-158-00-8 |
Gases (petroleum), fluidized catalytic cracker fractionation off Refinery gas [A complex combination produced by the fractionation of the overhead product of the fluidized catalytic cracking process. It consists of hydrogen, hydrogen sulfide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
272-874-3 |
68919-02-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-159-00-3 |
Gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off Refinery gas [A complex combination produced by scrubbing the overhead gas from the fluidized catalytic cracker. It consists of hydrogen, nitrogen, methane, ethane and propane.] |
H K |
272-875-9 |
68919-03-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-160-00-9 |
Gases (petroleum), heavy distillate hydrotreater desulfurization stripper off Refinery gas [A complex combination stripped from the liquid product of the heavy distillate hydrotreater desulfurization process. It consists of hydrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
272-876-4 |
68919-04-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-161-00-4 |
Gases (petroleum), platformer stabilizer off, light ends fractionation Refinery gas [A complex combination obtained by the fractionation of the light ends of the platinum reactors of the plattformer unit. It consists of hydrogen, methane, ethane and propane.] |
H K |
272-880-6 |
68919-07-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-162-00-X |
Gases (petroleum), preflash tower off, crude distn. Refinery gas [A complex combination produced from the first tower used in the distillation of crude oil. It consists of nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
272-881-1 |
68919-08-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-163-00-5 |
Gases (petroleum), tar stripper off Refinery gas [A complex combination obtained by the fractionation of reduced crude oil. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
272-884-8 |
68919-11-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-164-00-0 |
Gases (petroleum), unifiner stripper off Refinery gas [A combination of hydrogen and methane obtained by fractionation of the products from the unifiner unit.] |
H K |
272-885-3 |
68919-12-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-165-00-6 |
Tail gas (petroleum), catalytic hydrodesulfurized naphtha separator Refinery gas [A complex combination of hydrocarbons obtained from the hydrodesulfurization of naphtha. It consists of hydrogen, methane, ethane, and propane.] |
H K |
273-173-5 |
68952-79-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-166-00-1 |
Tail gas (petroleum), straight-run naphtha hydrodesulfurizer Refinery gas [A complex combination obtained from the hydrodesulfurization of straight-run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
273-174-0 |
68952-80-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-167-00-7 |
Gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation Refinery gas [A complex combination obtained by the fractionation of products from the fluidized catalytic cracker and gas oil desulfurizer. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
273-269-7 |
68955-33-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-168-00-2 |
Gases (petroleum), crude distn. and catalytic cracking Refinery gas [A complex combination produced by crude distillation and catalytic cracking processes. It consists of hydrogen, hydrogen sulfide, nitrogen, carbon monoxide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
273-563-5 |
68989-88-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-169-00-8 |
Gases (petroleum), gas oil diethanolamine scrubber off Refinery gas [A complex combination produced by desulfurization of gas oils with diethanolamine. It consists predominantly of hydrogen sulfide, hydrogen and aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] |
H K |
295-397-2 |
92045-15-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-170-00-3 |
Gases (petroleum), gas oil hydrodesulfurization effluent Refinery gas [A complex combination obtained by separation of the liquid phase from the effluent from the hydrogenation reaction. It consists predominantly of hydrogen, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] |
H K |
295-398-8 |
92045-16-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-171-00-9 |
Gases (petroleum), gas oil hydrodesulfurization purge Refinery gas [A complex combination of gases obtained from the reformer and from the purges from the hydrogenation reactor. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
295-399-3 |
92045-17-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-172-00-4 |
Gases (petroleum), hydrogenator effluent flash drum off Refinery gas [A complex combination of gases obtained from flash of the effluents after the hydrogenation reaction. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
295-400-7 |
92045-18-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-173-00-X |
Gases (petroleum), naphtha steam cracking high-pressure residual Refinery gas [A complex combination obtained as a mixture of the non-condensable portions from the product of a naphtha steam cracking process as well as residual gases obtained during the preparation of subsequent products. It consists predominantly of hydrogen and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 with which natural gas may also be mixed.] |
H K |
295-401-2 |
92045-19-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-174-00-5 |
Gases (petroleum), residue visbaking off Refinery gas [A complex combination obtained from viscosity reduction of residues in a furnace. It consists predominantly of hydrogen sulfide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] |
H K |
295-402-8 |
92045-20-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-177-00-1 |
Gases (petroleum), C3-4 Petroleum gas [A complex combination of hydrocarbons produced by distillation of products from the cracking of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C4, predominantly of propane and propylene, and boiling in the range of approximately -51 °C to -1 °C (-60 °F to 30 °F.)] |
H K |
268-629-5 |
68131-75-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-178-00-7 |
Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber Petroleum gas [The complex combination of hydrocarbons from the distillation of the products from catalytic cracked distillates and catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] |
H K |
269-617-2 |
68307-98-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-179-00-2 |
Tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer Petroleum gas [A complex combination of hydrocarbons from the fractionation stabilization products from polymerization of naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] |
H K |
269-618-8 |
68307-99-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-180-00-8 |
Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free Petroleum gas [A complex combination of hydrocarbons obtained from fractionation stabilization of catalytic reformed naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
269-619-3 |
68308-00-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-181-00-3 |
Tail gas (petroleum), cracked distillate hydrotreater stripper Petroleum gas [A complex combination of hydrocarbons obtained by treating thermal cracked distillates with hydrogen in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] |
H K |
269-620-9 |
68308-01-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-182-00-9 |
Tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free Petroleum gas [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of straight run distillates and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] |
H K |
269-630-3 |
68308-10-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-183-00-4 |
Tail gas (petroleum), gas oil catalytic cracking absorber Petroleum gas [A complex combination of hydrocarbons obtained from the distillation of products from the catalytic cracking of gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1through C5.] |
H K |
269-623-5 |
68308-03-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-184-00-X |
Tail gas (petroleum), gas recovery plant Petroleum gas [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1through C5.] |
H K |
269-624-0 |
68308-04-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-185-00-5 |
Tail gas (petroleum), gas recovery plant deethanizer Petroleum gas [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists of hydrocarbon having carbon numbers predominantly in the range of C1through C4.] |
H K |
269-625-6 |
68308-05-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-186-00-0 |
Tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free Petroleum gas [A complex combination of hydrocarbons obtained from fractionation of hydrodesulfurized naphtha and distillate hydrocarbon streams and treated to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1through C5.] |
H K |
269-626-1 |
68308-06-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-187-00-6 |
Tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free Petroleum gas [A complex combination of hydrocarbons obtained from stripping stabilization of catalytic hydrodesulfurized vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1through C6.] |
H K |
269-627-7 |
68308-07-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-188-00-1 |
Tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free petroleum gas [A complex combination of hydrocarbons obtained from fractionation stabilization of light straight run naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1through C5.] |
H K |
269-629-8 |
68308-09-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-189-00-7 |
Tail gas (petroleum), propane-propylene alkylation feed prep deethanizer Petroleum gas [A complex combination of hydrocarbons obtained from the distillation of the reaction products of propane with propylene. It consists of hydrocarbons having carbon numbers predominantly in the range of C1through C4.] |
H K |
269-631-9 |
68308-11-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-190-00-2 |
Tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free Petroleum gas [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1through C6.] |
H K |
269-632-4 |
68308-12-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-191-00-8 |
Gases (petroleum), catalytic cracked overheads Petroleum gas [A complex combination of hydrocarbons produced by the distillation of products from the catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3through C5and boiling in the range of approximately -48 °C to 32 °C (-54 °F to 90 °F).] |
H K |
270-071-2 |
68409-99-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-193-00-9 |
Alkanes, C1-2 Petroleum gas |
H K |
270-651-5 |
68475-57-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-194-00-4 |
Alkanes, C2-3 Petroleum gas |
H K |
270-652-0 |
68475-58-1 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-195-00-X |
Alkanes, C3-4 petroleum gas |
H K |
270-653-6 |
68475-59-2 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-196-00-5 |
Alkanes, C4-5 Petroleum gas |
H K |
270-654-1 |
68475-60-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-197-00-0 |
Fuel gases Petroleum gas [A combination of light gases. It consists predominantly of hydrogen and/or low molecular weight hydrocarbons.] |
H K |
270-667-2 |
68476-26-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-198-00-6 |
Fuel gases, crude oil of distillates Petroleum gas [A complex combination of light gases produced by distillation of crude oil and by catalytic reforming of naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1through C4and boiling in the range of approximately -217 °C to -12 °C (-423 °F to 10 °F).] |
H K |
270-670-9 |
68476-29-9 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-199-00-1 |
Hydrocarbons, C3-4 Petroleum gas |
H K |
270-681-9 |
68476-40-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-200-00-5 |
Hydrocarbons, C4-5 Petroleum gas |
H K |
270-682-4 |
68476-42-6 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-201-00-0 |
Hydrocarbons, C2-4, C3-rich Petroleum gas |
H K |
270-689-2 |
68476-49-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-202-00-6 |
Petroleum gases, liquefied Petroleum gas [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3through C7and boiling in the range of approximately -40 °C to 80 °C (-40 °F to 176 °F).] |
HKS |
270-704-2 |
68476-85-7 |
F+; R12 Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
F+; T R: 12-45-46 S: 53-45 |
|
|
|
649-203-00-1 |
Petroleum gases, liquefied, sweetened Petroleum gas [A complex combination of hydrocarbons obtained by subjecting liquefied petroleum gas mix to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C3through C7and boiling in the range of approximately -40 °C to 80 °C (-40 °F to 176 °F).] |
HKS |
270-705-8 |
68476-86-8 |
F+; R12 Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
F+; T R: 12-45-46 S: 45-53 |
|
|
|
649-204-00-7 |
gases (petroleum), C3-4, isobutane-rich Petroleum gas [A complex combination of hydrocarbons from the distillation of saturated and unsaturated hydrocarbons usually ranging in carbon numbers from C3through C6, predominantly butane and isobutane. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3through C4, predominantly isobutane.] |
H K |
270-724-1 |
68477-33-8 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-205-00-2 |
Distillates (petroleum), C3-6, piperylene-rich Petroleum gas [A complex combination of hydrocarbons from the distillation of saturated and unsaturated aliphatic hydrocarbons usually ranging in the carbon numbers C3through C6. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3through C6, predominantly piperylenes.] |
H K |
270-726-2 |
68477-35-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-206-00-8 |
Gases (petroleum), butane splitter overheads Petroleum gas [A complex combination of hydrocarbons obtained from the distillation of the butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3through C4.] |
H K |
270-750-3 |
68477-69-0 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-207-00-3 |
Gases (petroleum), C2- Petroleum gas [A complex combination of hydrocarbons produced by the distillation of products from a catalytic fractionation process. It contains predominantly ethane, ethylene, propane, and propylene.] |
H K |
270-751-9 |
68477-70-3 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-208-00-9 |
Gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free Petroleum gas [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked gas oil hydrocarbon stream and treated to remove hydrogen sulfide and other acidic components. It consists of hydrocarbons having carbon numbers in the range of C3through C5, predominantly C4.] |
H K |
270-752-4 |
68477-71-4 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-209-00-4 |
Gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich Petroleum gas [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3through C5.] |
H K |
270-754-5 |
68477-72-5 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-210-00-X |
Tail gas (petroleum), isomerized naphtha fractionation stabilizer Petroleum gas [A complex combination of hydrocarbons obtained from the fractionation stabilization products from isomerized naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1through C4.] |
H K |
269-628-2 |
68308-08-7 |
Carc. Cat. 1; R45 Muta. Cat. 2; R46 |
T R: 45-46 S: 53-45 |
|
|
|
649-224-00-6 |
Fuels, diesel Gasoil - unspecified [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9through C20and boiling in the range of approximately 163 °C to 357 °C (325 °F to 675 °F).] |
H N |
269-822-7 |
68334-30-5 |
Carc. Cat. 3; R40 |
Xn R: 40 S: (2-)36/37’ |
|
|
ANNEX 1C
|
Index No |
chemical name |
Notes related to substances |
EC No |
CAS No |
Classification |
Labelling |
Concentration Limits |
Notes related to preparations |
|
‘005-009-00-3 |
tetrabutylammonium butyltriphenylborate |
|
418-080-4 |
120307-06-4 |
R 43 N; R50-53 |
Xi; N R: 43-50/53 S: (2-)24-37-56-61 |
|
|
|
005-010-00-9 |
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate |
|
422-050-6 |
118612-00-3 |
Carc.Cat.3; R40 Xn; R22 Xi; R38-41 |
Xn R: 22-38-40-41 S: (2-)22-26-36/37/39 |
|
|
|
005-012-00-X |
diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}ammonium butyltriphenylborate |
|
418-070-1 |
141714-54-7 |
R 43 N; R50-53 |
Xi; N R: 43-50/53 S: (2-)24-37-60-61 |
|
|
|
011-007-00-3 |
propoxycarbazone-sodium |
|
— |
— |
N; R50-53 |
N R: 50/53 S: 60-61 |
C ≥ 2,5 %: N; R50/53 0,25 % ≤ C < 2,5 %: N; R51/53 0,025 ≤ C < 0,25 %: R52/53 |
|
|
013-009-00-X |
sodium((n-butyl)x(ethyl)y-1,5-dihydro)aluminate) x = 0.5 y = 1.5 |
|
418-720-2 |
— |
F; R11 R14/15 R 17 Xn; R20 C; R35 |
F; C R: 11-14/15-17-20-35 S: (1/2-)6-16-26-30-36/37/39-43-45 |
|
|
|
014-026-00-5 |
dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane |
|
407-180-3 |
— |
C; R35 |
C R: 35 S: (1/2-)26-36/37/39-45 |
|
|
|
014-027-00-0 |
chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane |
|
410-270-5 |
— |
C; R35 |
C R: 35 S: (1/2-)8-26-28-36/37/39-45 |
|
|
|
014-028-00-6 |
α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) |
|
415-290-8 |
— |
R 43 |
Xi R: 43 S: (2-)24-37 |
|
|
|
014-029-00-1 |
O,O′-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] |
|
421-870-1 |
— |
Repr.Cat.3; R62 Xn; R22-48/22 |
Xn R: 22-48/22-62 S: (2-)36/37 |
|
|
|
014-030-00-7 |
[(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium |
|
422-060-0 |
137390-08-0 |
T+; R28 |
T+ R: 28 S: (1/2-)6-22-28-36/37-45 |
|
|
|
014-031-00-2 |
bis(1-methylethyl)-dimethoxysilane |
|
421-540-7 |
18230-61-0 |
R 10 Xi; R38 R43 R 52-53 |
Xi R: 10-38-43-52/53 S: (2-)24-37-61 |
|
|
|
014-032-00-8 |
dicyclopentyldimethoxysilane |
|
404-370-8 |
126990-35-0 |
Xi; R38-41 N; R50-53 |
Xi; N R: 38-41-50/53 S: (2-)26-37/39-60-61 |
|
|
|
015-180-00-6 |
[R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt |
|
415-820-8 |
137590-32-0 |
Xi; R41 R 43 R 52-53 |
Xi R: 41-43-52/53 S: (2-)24-26-37/39-61 |
|
|
|
015-181-00-1 |
phosphine |
|
232-260-8 |
7803-51-2 |
F+; R12 R17 T+; R26 C; R34 N; R50 |
F+; T+; N R: 12-17-26-34-50 S: (1/2-)28-36/37-45-61-63 |
|
|
|
015-184-00-8 |
Salts of glyphosate, with the exception of those specified elsewhere in this Annex |
|
— |
— |
N; R51-53 |
N R: 51/53 S: 61 |
|
|
|
015-186-00-9 |
chlorpyrifos-methyl |
|
227-011-5 |
5598-13-0 |
R43 N; R50-53 |
Xi; N R: 43-50/53 S: (2-)36/37-60-61 |
C ≥ 1 %: N; R43-50-53 0,0025 % ≤C < 1 %: N; R50-53 0,00025 % ≤C < 0,0025 %: N; R51-53 0,000025 % ≤C < 0,00025 %: R52-53 |
|
|
015-187-00-4 |
A mixture of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide |
|
417-540-1 |
— |
Xi; R41 N; R51-53 |
Xi; N R: 41-51/53 S: (2-)26-39-61 |
|
|
|
015-189-00-5 |
phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide |
|
423-340-5 |
162881-26-7 |
R43 R53 |
Xi R: 43-53 S: (2-)22-24-37-61 |
|
|
|
016-086-00-8 |
tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate |
|
402-590-9 |
109125-56-6 |
Xi; R41 |
Xi R: 41 S: (2-)22-26-39 |
|
|
|
016-087-00-3 |
A mixture of: thiobis(4,1-phenylene)-S,S,S′,S′-tetraphenyldisulfonium bishexafluorophosphate diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate propylene carbonate |
|
403-490-8 |
74227-35-3 |
Xi; R36 R 43 N; R50-53 |
Xi; N R: 36-43-50/53 S: (2-)24-26-37-60-61 |
|
|
|
016-088-00-9 |
4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid |
|
407-280-7 |
71297-11-5 |
R 52-53 |
R: 52/53 S: 61 |
|
|
|
016-089-00-4 |
A mixture of esters of 5,5′,6,6′,7,7′-hexahydroxy-3,3,3′,3′-tetramethyl-1,1′-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene |
|
413-840-1 |
— |
E; R2 F; R11 R 53 |
E R: 2-11-53 S: (2-)33-35-40-61 |
|
|
|
016-090-00-X |
4-methyl-N-(methylsulfonyl)benzenesulfonamide |
|
415-040-8 |
14653-91-9 |
Xn; R22 Xi; R37-41 |
Xn R: 22-37-41 S: (2-)26-39 |
|
|
|
016-091-00-5 |
C12-14-tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate |
|
414-110-5 |
— |
Xi; R41 N; R50-53 |
Xi; N R: 41-50/53 S: (2-)26-39-60-61 |
|
|
|
016-093-00-6 |
A 2:1 mixture of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) |
|
414-770-4 |
140698-96-0 |
F; R11 Carc.Cat.3; R40 |
F; Xn R: 11-40 S: (2-)7-36/37 |
|
|
|
016-095-00-7 |
A mixture of: reaction product of 4,4′-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2) Reaction product of 4,4′-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:3) |
|
417-980-4 |
— |
F; R11 Carc.Cat.3; R40 |
F; Xn R: 11-40 S: (2-)7-36/37 |
|
|
|
016-096-00-2 |
thifensulfuron-methyl |
|
— |
79277-27-3 |
N; R50-53 |
N R: 50/53 S: 60-61 |
|
|
|
017-015-00-3 |
(2-(aminomethyl)phenyl)acetylchloride hydrochloride |
|
417-410-4 |
61807-67-8 |
Xn; R22 C; R35 R43 |
C R: 22-35-43 S: (1/2-)26-36/37/39-45 |
|
</ |