4.5.2018 |
EN |
Official Journal of the European Union |
L 115/1 |
COMMISSION REGULATION (EU) 2018/669
of 16 April 2018
amending, for the purposes of its adaptation to technical and scientific progress, Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixtures
(Text with EEA relevance)
THE EUROPEAN COMMISSION,
Having regard to the Treaty on the Functioning of the European Union,
Having regard to Regulation (EC) No 1272/2008 of the European Parliament and of the Council of 16 December 2008 on classification, labelling and packaging of substances and mixtures, amending and repealing Directives 67/548/EEC and 1999/45/EC, and amending Regulation (EC) No 1907/2006 (1), and in particular Article 53(1) thereof,
Whereas:
(1) |
Tables 3.1 and 3.2 of Annex VI to Regulation (EC) No 1272/2008 contain the list of harmonised classification and labelling of hazardous substances but only in English for all language versions of that Regulation. |
(2) |
On 2 December 2008 (2) the Commission committed itself to ensure that the chemical names corresponding to the International Chemical Identifications in Tables 3.1 and 3.2 of Annex VI to Regulation (EC) No 1272/2008 are published in the same language as the language versions in which that Regulation has been published. |
(3) |
Table 3.1 of Annex VI to Regulation (EC) No 1272/2008 has been amended several times to reflect technical and scientific progress, by adding, deleting or modifying substances or their classification. To take account of those changes and to ensure that all the chemical names in Table 3.1 of Annex VI to Regulation (EC) No 1272/2008 are in the same language as the language versions in which that Regulation has been published, Table 3.1 needs to be replaced partially. |
(4) |
In view of the derogation (3) which applies to the translation into Irish of acts which are not adopted jointly by the European Parliament and the Council, the chemical names in Table 3.1 of Annex VI should not be translated into Irish. |
(5) |
Table 3.2 lists the harmonised classification and labelling of hazardous substances based on the criteria set out in Annex VI to Council Directive 67/548/EEC (4), which has been repealed with effect from 1 June 2015. As a consequence, Table 3.2 is to be deleted in accordance with Article 1(2) of Commission Regulation (EU) 2016/1179 (5) with effect from 1 June 2017. That table should therefore not be changed. As a result Table 3.1 has been renamed to Table 3 in accordance with Article 2(2) of Commission Regulation (EU) 2017/776 (6) with effect from 1 June 2017. |
(6) |
Suppliers should be given sufficient time to adapt the labelling and packaging of substances and mixtures to the new translation provisions and to sell existing stocks. |
(7) |
Suppliers should have the possibility of applying this Regulation before its date of application to ensure a high level of protection of human health and of the environment and to provide sufficient flexibility to suppliers. |
(8) |
The measures provided for in this Regulation are in accordance with the opinion of the Committee established under Article 133 of Regulation (EC) No 1907/2006 of the European Parliament and of the Council (7), |
HAS ADOPTED THIS REGULATION:
Article 1
The entries set out in Annex VI to Regulation (EC) No 1272/2008 corresponding to the entries set out in the Annex to this Regulation are replaced by the entries set out in the Annex to this Regulation.
Article 2
This Regulation shall enter into force on the twentieth day following that of its publication in the Official Journal of the European Union.
It shall apply from 1 December 2019.
By way of derogation from the second subparagraph, substances and mixtures may before 1 December 2019 be classified, labelled and packaged in accordance with Regulation (EC) No 1272/2008, as amended by this Regulation.
This Regulation shall be binding in its entirety and directly applicable in all Member States.
Done at Brussels, 16 April 2018.
For the Commission
The President
Jean-Claude JUNCKER
(1) OJ L 353, 31.12.2008, p. 1.
(2) Corrigendum to the position of the European Parliament adopted at first reading on 3 September 2008 with a view to the adoption of Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixtures, amending and repealing Directives 67/548/EEC and 1999/45/EC, and amending Regulation (EC) No 1907/2006 — P6_TA(2008)0392 (COM (2007)0355 — C6-0197/2007 — 2007/0121 (COD)).
(3) Council Regulation (EU) No 1257/2010 of 20 December 2010 extending the temporary derogation measures from Regulation No 1 of 15 April 1958 determining the languages to be used by the European Economic Community and Regulation No 1 of 15 April 1958 determining the languages to be used by the European Atomic Energy Community introduced by Regulation (EC) No 920/2005 (OJ L 343, 29.12.2010, p. 5).
(4) Council Directive 67/548/EEC of 27 June 1967 on the approximation of laws, regulations and administrative provisions relating to the classification, packaging and labelling of dangerous substances (OJ 196, 16.8.1967, p. 1).
(5) Commission Regulation (EU) 2016/1179 of 19 July 2016 amending, for the purposes of its adaptation to technical and scientific progress, Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixtures (OJ L 195 de 20.7.2016, p. 11).
(6) Commission Regulation (EU) 2017/776 of 4 May 2017 amending, for the purposes of its adaptation to technical and scientific progress, Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixtures (OJ L 116, 5.5.2017, p. 1).
(7) Regulation (EC) No 1907/2006 of the European Parliament and of the Council of 18 December 2006 concerning the Registration, Evaluation, Authorisation and Restriction of Chemicals (REACH), establishing a European Chemicals Agency, amending Directive 1999/45/EC and repealing Council Regulation (EEC) No 793/93 and Commission Regulation (EC) No 1488/94 as well as Council Directive 76/769/EEC and Commission Directives 91/155/EEC, 93/67/EEC, 93/105/EC and 2000/21/EC (OJ L 396, 30.12.2006, p. 1).
ANNEX
Index No |
International Chemical Identification |
EC No |
CAS No |
Classification |
Labelling |
Specific Conc. Limits, M-factors |
Notes |
|||
Hazard Class and Category Code(s) |
Hazard statement Code(s) |
Pictogram, Signal Word Code(s) |
Hazard statement Code(s) |
Suppl. Hazard statement Code(s) |
||||||
(1) |
(2) |
(3) |
(4) |
(5) |
(6) |
(7) |
(8) |
(9) |
(10) |
(11) |
001-001-00-9 |
hydrogen |
215-605-7 |
1333-74-0 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
001-002-00-4 |
aluminium lithium hydride |
240-877-9 |
16853-85-3 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
|
|
|
001-003-00-X |
sodium hydride |
231-587-3 |
7646-69-7 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
001-004-00-5 |
calcium hydride |
232-189-2 |
7789-78-8 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
003-001-00-4 |
lithium |
231-102-5 |
7439-93-2 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
003-002-00-X |
n-hexyllithium |
404-950-0 |
21369-64-2 |
Water-react. 1 Pyr. Sol. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
003-003-00-5 |
(2-methylpropyl)lithium; isobutyllithium |
440-620-2 |
920-36-5 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H314 H336 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H260 H250 H314 H336 H410 |
EUH014 |
|
|
004-001-00-7 |
beryllium |
231-150-7 |
7440-41-7 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
004-002-00-2 |
beryllium compounds with the exception of aluminium beryllium silicates, and with those specified elsewhere in this Annex |
— |
— |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
|
|
A |
004-003-00-8 |
beryllium oxide |
215-133-1 |
1304-56-9 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
005-001-00-X |
boron trifluoride |
231-569-5 |
7637-07-2 |
Press. Gas Acute Tox. 2 * Skin Corr. 1A |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
EUH014 |
|
U |
005-002-00-5 |
boron trichloride |
233-658-4 |
10294-34-5 |
Press. Gas Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B |
H330 H300 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
U |
005-003-00-0 |
boron tribromide |
233-657-9 |
10294-33-4 |
Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
|
005-004-00-6 |
trialkylboranes, solid |
— |
— |
Pyr. Sol. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
005-004-01-3 |
trialkylboranes, liquid |
— |
— |
Pyr. Liq. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
005-005-00-1 |
trimethyl borate |
204-468-9 |
121-43-7 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H312 |
GHS02 GHS07 Wng |
H226 H312 |
|
|
|
005-006-00-7 |
dibutyltin hydrogen borate |
401-040-5 |
75113-37-0 |
Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H341 H372** H312 H302 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H360FD H341 H372** H312 H302 H318 H317 H410 |
|
|
|
005-007-00-2 |
boric acid; [1] boric acid; [2] |
233-139-2 [1] 234-343-4 [2] |
10043-35-3 [1] 11113-50-1 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.1B; H360FD: C ≥ 5,5 % |
|
005-008-00-8 |
diboron trioxide; boric oxide |
215-125-8 |
1303-86-2 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.1B; H360FD:C ≥ 3,1 % |
|
005-009-00-3 |
tetrabutylammonium butyltriphenylborate |
418-080-4 |
120307-06-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
005-010-00-9 |
N, N-dimethylanilinium tetrakis(pentafluorophenyl)borate |
422-050-6 |
118612-00-3 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H351 H302 H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H351 H302 H315 H318 |
|
|
|
005-011-00-4 |
disodium tetraborate, anhydrous; boric acid, disodium salt; [1] tetraboron disodium heptaoxide, hydrate; [2] orthoboric acid, sodium salt [3] |
215-540-4 [1] 235-541-3 [2] 237-560-2 [3] |
1330-43-4 [1] 12267-73-1 [2] 13840-56-7 [3] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr. 1B; H360FD: C ≥4,5 % |
|
005-011-01-1 |
disodium tetraborate decahydrate; borax decahydrate |
215-540-4 |
1303-96-4 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.1B; H360FD: C ≥ 8,5 % |
|
005-011-02-9 |
disodium tetraborate pentahydrate; borax pentahydrate |
215-540-4 |
12179-04-3 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.B; H360FD: C ≥ 6,5 % |
|
005-012-00-X |
diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}ammonium butyltriphenylborate |
418-070-1 |
141714-54-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
005-013-00-5 |
diethylmethoxyborane |
425-380-9 |
7397-46-8 |
Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H250 H332 H312 H302 H373** H314 H317 H413 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H250 H332 H312 H302 H373** H314 H317 H413 |
|
|
|
005-014-00-0 |
4-formylphenylboronic acid |
438-670-5 |
87199-17-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
005-015-00-6 |
1-chloromethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
414-380-4 |
140681-55-6 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
005-016-00-1 |
tetrabutylammonium butyl tris-(4-tert-butylphenyl)borate |
431-370-5 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
005-017-00-7 |
sodium perborate; [1] sodium peroxometaborate; [2] sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr.1B; H360Df: C ≥9 % Repr.1B; H360 D: 6,5 % ≤ C <9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
005-017-01-4 |
sodium perborate; [1] sodium peroxometaborate; [2] sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
005-018-00-2 |
perboric acid (H3BO2(O2)), monosodium salt trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] sodium peroxoborate hexahydrate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B STOT SE 3 Eye Dam. 1 |
H360Df H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H335 H318 |
|
Repr. 1B; H360Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
005-018-01-X |
perboric acid (H3BO2(O2)), monosodium salt, trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] sodium peroxoborate hexahydrate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H360Df H332 H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H332 H335 H318 |
|
Repr. 1B; H360 Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
005-019-00-8 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate; [3] sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
005-019-01-5 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate;[3] sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
006-001-00-2 |
carbon monoxide |
211-128-3 |
630-08-0 |
Flam. Gas 1 Press. Gas Repr. 1A Acute Tox. 3 * STOT RE 1 |
H220 H360D *** H331 H372 ** |
GHS02 GHS04 GHS06 GHS08 Dgr |
H220 H360D *** H331 H372 ** |
|
|
U |
006-002-00-8 |
phosgene; carbonyl chloride |
200-870-3 |
75-44-5 |
Press. Gas Acute Tox. 2 * Skin Corr. 1B |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
|
|
U |
006-003-00-3 |
carbon disulphide |
200-843-6 |
75-15-0 |
Flam. Liq. 2 Repr. 2 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H361fd H372 ** H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H361fd H372 ** H319 H315 |
|
Repr. 2; H361fd: C ≥ 1 % STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
006-004-00-9 |
calcium carbide |
200-848-3 |
75-20-7 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
T |
006-005-00-4 |
thiram (ISO); tetramethylthiuram disulphide |
205-286-2 |
137-26-8 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H319 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H373 ** H319 H315 H317 H410 |
|
M = 10 |
|
006-006-00-X |
hydrogen cyanide; hydrocyanic acid |
200-821-6 |
74-90-8 |
Flam. Liq. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H224 H330 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H224 H330 H410 |
|
|
|
006-006-01-7 |
hydrogen cyanide … %; hydrocyanic acid … % |
200-821-6 |
74-90-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
|
B |
006-007-00-5 |
salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide and those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
EUH032 |
|
A |
006-008-00-0 |
antu (ISO); 1-(1-naphthyl)-2-thiourea |
201-706-3 |
86-88-4 |
Acute Tox. 2 * Carc. 2 |
H300 H351 |
GHS06 GHS08 Dgr |
H300 H351 |
|
|
|
006-009-00-6 |
1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate; isolan |
204-318-2 |
119-38-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
006-010-00-1 |
5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate 5,5-dimethyldihydroresorcinol dimethylcarbamate; dimetan |
204-525-8 |
122-15-6 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
006-011-00-7 |
carbaryl (ISO); 1-naphthyl methylcarbamate |
200-555-0 |
63-25-2 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H351 H332 H302 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H302 H400 |
|
M=100 |
|
006-012-00-2 |
ziram (ISO); zinc bis dimethyldithiocarbamate |
205-288-3 |
137-30-4 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H373 ** H335 H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H302 H373 ** H335 H318 H317 H410 |
|
M = 100 |
|
006-013-00-8 |
metam-sodium (ISO); sodium methyldithiocarbamate |
205-293-0 |
137-42-8 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
EUH031 |
|
|
006-014-00-3 |
nabam (ISO); disodium ethylenebis(N, N'-dithiocarbamate) |
205-547-0 |
142-59-6 |
Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H317 H410 |
GHS07 GHS09 Wng |
H302 H335 H317 H410 |
|
|
|
006-015-00-9 |
diuron (ISO); 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
206-354-4 |
330-54-1 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H373** H410 |
|
M = 10 |
|
006-016-00-4 |
propoxur (ISO); 2-isopropyloxyphenyl N-methylcarbamate; 2-isopropoxyphenyl methylcarbamate |
204-043-8 |
114-26-1 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
006-017-00-X |
aldicarb (ISO); 2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime |
204-123-2 |
116-06-3 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
|
|
006-018-00-5 |
aminocarb (ISO); 4-dimethylamino-3-tolyl methylcarbamate |
217-990-7 |
2032-59-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
006-019-00-0 |
di-allate (ISO); S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate |
218-961-1 |
2303-16-4 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
006-020-00-6 |
barban (ISO); 4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate |
202-930-4 |
101-27-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
006-021-00-1 |
linuron (ISO); 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
206-356-5 |
330-55-2 |
Repr. 1B Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H351 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H351 H302 H373 ** H410 |
|
|
|
006-022-00-7 |
decarbofuran (ISO); 2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate |
— |
1563-67-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
006-023-00-2 |
mercaptodimethur (ISO); methiocarb (ISO); 3,5-dimethyl-4-methylthiophenyl N-methylcarbamate |
217-991-2 |
2032-65-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
006-024-00-8 |
proxan-sodium (ISO); sodium O-isopropyldithiocarbonate |
205-443-5 |
140-93-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
006-025-00-3 |
allethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; bioallethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [1] S-bioallethrin; [3] (S)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [2] esbiothrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [3] |
209-542-4 [1] 249-013-5 [2]-[3] |
584-79-2 [1] 28434-00-6 [2] 84030-86-4 [3] |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
C |
006-026-00-9 |
carbofuran (ISO); 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate |
216-353-0 |
1563-66-2 |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
|
|
|
006-028-00-X |
dinobuton (ISO); 2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate |
213-546-1 |
973-21-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
006-029-00-5 |
dioxacarb (ISO); 2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate |
230-253-4 |
6988-21-2 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
006-030-00-0 |
EPTC (ISO); S-ethyl dipropylthiocarbamate |
212-073-8 |
759-94-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
006-031-00-6 |
formetanate (ISO); 3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate |
244-879-0 |
22259-30-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
006-032-00-1 |
monolinuron (ISO); 3-(4-chlorophenyl)-1-methoxy-1-methylurea |
217-129-5 |
1746-81-2 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
006-033-00-7 |
metoxuron (ISO); 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
243-433-2 |
19937-59-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
006-034-00-2 |
pebulate (ISO); N-butyl-N-ethyl-S-propylthiocarbamate |
214-215-4 |
1114-71-2 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
006-036-00-3 |
benzthiazuron (ISO); 1-benzothiazol-2-yl-3-methylurea |
217-685-9 |
1929-88-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
006-037-00-9 |
promecarb (ISO); 3-isopropyl-5-methylphenyl N-methylcarbamate |
220-113-0 |
2631-37-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
006-038-00-4 |
sulfallate (ISO); 2-chloroallyl N, N-dimethyldithiocarbamate |
202-388-9 |
95-06-7 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
006-039-00-X |
tri-allate (ISO); S-2,3,3-trichloroallyl diisopropylthiocarbamate |
218-962-7 |
2303-17-5 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
006-040-00-5 |
3-methylpyrazol-5-yl-dimethylcarbamate; monometilan |
— |
2532-43-6 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
006-041-00-0 |
dimethylcarbamoyl chloride |
201-208-6 |
79-44-7 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H331 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H331 H302 H319 H335 H315 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
006-042-00-6 |
monuron (ISO); 3-(4-chlorophenyl)-1,1-dimethylurea |
205-766-1 |
150-68-5 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
006-043-00-1 |
3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate; monuron-TCA |
— |
140-41-0 |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H410 |
|
|
|
006-044-00-7 |
isoproturon (ISO); 3-(4-isopropylphenyl)-1,1-dimethylurea |
251-835-4 |
34123-59-6 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 10 |
|
006-045-00-2 |
methomyl (ISO); 1-(methylthio)ethylideneamino N-methylcarbamate |
240-815-0 |
16752-77-5 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
|
M=100 |
|
006-047-00-3 |
bufencarb (ISO); reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate |
— |
8065-36-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
006-048-00-9 |
ethiofencarb (ISO); 2-(ethylthiomethyl)phenyl N-methylcarbamate |
249-981-9 |
29973-13-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
006-049-00-4 |
dixanthogen; O, O-diethyl dithiobis(thioformate) |
207-944-4 |
502-55-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
006-050-00-X |
1,1-dimethyl-3-phenyluronium trichloroacetate; fenuron-TCA |
— |
4482-55-7 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
006-051-00-5 |
ferbam (ISO); iron tris(dimethyldithiocarbamate) |
238-484-2 |
14484-64-1 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
006-052-00-0 |
formetanate hydrochloride; 3-(N, N-dimethylaminomethyleneamino)phenyl N-methylcarbamate |
245-656-0 |
23422-53-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
006-053-00-6 |
isoprocarb (ISO); 2-isopropylphenyl N-methylcarbamate |
220-114-6 |
2631-40-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
006-054-00-1 |
mexacarbate (ISO); 3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate |
206-249-3 |
315-18-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
006-055-00-7 |
xylylcarb (ISO); 3,4-dimethylphenyl N-methylcarbamate; 3,4-xylyl methylcarbamate; MPMC |
219-364-9 |
2425-10-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
006-056-00-2 |
metolcarb (ISO); m-tolyl methylcarbamate; MTMC |
214-446-0 |
1129-41-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
006-057-00-8 |
nitrapyrin (ISO); 2-chloro-6-trichloromethylpyridine |
217-682-2 |
1929-82-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
006-058-00-3 |
noruron (ISO); 1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea |
— |
2163-79-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
006-059-00-9 |
oxamyl (ISO); N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate; |
245-445-3 |
23135-22-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Chronic 2 |
H330 H300 H312 H411 |
GHS06 GHS09 Dgr |
H330 H300 H312 H411 |
|
|
|
006-060-00-4 |
oxycarboxin (ISO); 2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide |
226-066-2 |
5259-88-1 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
006-061-00-X |
S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride; prothiocarb hydrochloride |
243-193-9 |
19622-19-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
006-062-00-5 |
methyl 3,4-dichlorophenylcarbanilate; SWEP. |
— |
1918-18-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
006-063-00-0 |
thiobencarb (ISO); S-4-chlorobenzyl diethylthiocarbamate |
248-924-5 |
28249-77-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
006-064-00-6 |
thiofanox (ISO); 3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime |
254-346-4 |
39196-18-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
006-065-00-1 |
3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime; triamid |
— |
15271-41-7 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Chronic 2 |
H300 H311 H411 |
GHS06 GHS09 Dgr |
H300 H311 H411 |
|
|
|
006-066-00-7 |
vernolate (ISO); S-propyl dipropylthiocarbamate |
217-681-7 |
1929-77-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
006-067-00-2 |
XMC; 3,5-xylyl methylcarbamate |
— |
2655-14-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
006-068-00-8 |
diazomethane |
206-382-7 |
334-88-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
006-069-00-3 |
thiophanate-methyl (ISO); 1,2-di-(3-methoxycarbonyl-2-thioureido)benzene |
245-740-7 |
23564-05-8 |
Muta. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H332 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H332 H317 H410 |
|
|
|
006-070-00-9 |
furmecyclox (ISO); N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide |
262-302-0 |
60568-05-0 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
006-071-00-4 |
cyclooct-4-en-1-yl methyl carbonate |
401-620-8 |
87731-18-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
006-072-00-X |
prosulfocarb (ISO); S-benzyl N, N-dipropylthiocarbamate |
401-730-6 |
52888-80-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
006-073-00-5 |
3-(dimethylamino)propylurea |
401-950-2 |
31506-43-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
006-074-00-0 |
2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate |
402-440-2 |
2094-99-7 |
Acute Tox. 2 * Skin Corr. 1B STOT RE 2 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H314 H373 ** H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H314 H373 ** H334 H317 H410 |
|
|
|
006-076-00-1 |
mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt |
— |
8018-01-7 |
Repr. 2 Skin Sens. 1 Aquatic Acute 1 |
H361d*** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H361d*** H317 H400 |
|
M=10 |
|
006-077-00-7 |
maneb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) |
235-654-8 |
12427-38-2 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H332 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d*** H332 H319 H317 H410 |
|
M=10 |
|
006-078-00-2 |
zineb (ISO); zinc ethylenebis(dithiocarbamate) (polymeric) |
235-180-1 |
12122-67-7 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
|
|
006-079-00-8 |
disulfiram; tetraethylthiuramdisulfide |
202-607-8 |
97-77-8 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
006-080-00-3 |
tetramethylthiuram monosulphide |
202-605-7 |
97-74-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
006-081-00-9 |
zinc bis(dibutyldithiocarbamate) |
205-232-8 |
136-23-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
006-082-00-4 |
zinc bis(diethyldithiocarbamate) |
238-270-9 |
14324-55-1 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H317 H410 |
|
|
|
006-083-00-X |
butocarboxim (ISO); 3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime |
252-139-3 |
34681-10-2 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H331 H311 H301 H319 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H311 H301 H319 H410 |
|
|
|
006-084-00-5 |
carbosulfan (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate |
259-565-9 |
55285-14-8 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H317 H410 |
|
|
|
006-085-00-0 |
fenobucarb (ISO); 2-butylphenyl methylcarbamate |
223-188-8 |
3766-81-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
006-086-00-6 |
fenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate |
276-696-7 |
72490-01-8 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 M = 10 000 |
|
006-087-00-1 |
furathiocarb (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate |
265-974-3 |
65907-30-4 |
Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H373** H319 H315 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H301 H373** H319 H315 H317 H410 |
|
M = 100 |
|
006-088-00-7 |
benfuracarb (ISO); ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl-β-alaninate |
— |
82560-54-1 |
Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H331 H302 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361f*** H331 H302 H410 |
|
|
|
006-090-00-8 |
2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate |
408-010-0 |
88558-41-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H332 H318 H412 |
GHS05 GHS07 Dgr |
H332 H318 H412 |
|
|
|
006-091-00-3 |
propineb (ISO); polymeric zinc propylenebis(dithiocarbamate) |
— |
9016-72-2 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 |
H332 H373** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H332 H373** H317 H400 |
|
|
|
006-092-00-9 |
tert-butyl (1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamate |
425-420-5 |
98737-29-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
006-093-00-4 |
2,2'-dithio di(ethylammonium)-bis(dibenzyldithiocarbamate) |
427-180-7 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
006-094-00-X |
O-isobutyl-N-ethoxy carbonylthiocarbamate |
434-350-4 |
103122-66-3 |
Flam. Liq. 3 Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H226 H350 H340 H302 H373** H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H340 H302 H373** H317 H411 |
|
|
|
006-095-00-5 |
fosetyl-aluminium (ISO); aluminium triethyl triphosphonate |
254-320-2 |
39148-24-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
006-096-00-0 |
chlorpropham (ISO); isopropyl 3-chlorocarbanilate |
202-925-7 |
101-21-3 |
Carc. 2 STOT RE 2 * Aquatic Chronic 2 |
H351 H373** H411 |
GHS08 GHS09 Wng |
H351 H373** H411 |
|
|
|
006-097-00-6 |
1-phenyl-3-(p-toluenesulfonyl)urea |
424-620-1 |
13909-63-2 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373** H412 |
GHS08 GHS07 Wng |
H302 H373** H412 |
|
|
|
006-098-00-1 |
tert-butyl (1R,5S)-3-azabicyclo[3.1.0]hex-6-ylcarbamate |
429-170-8 |
134575-17-0 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373** H318 H317 |
|
|
|
006-099-00-7 |
N-(p-toluenesulfonyl)-N'-(3-(p-toluenesulfonyloxy)phenyl)urea; 3-][(4-methylphenyl)sulfonyl]carbamoyl}amino)phenyl4-methylbenzenesulfonate |
520-2 |
232938-43-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
006-101-00-6 |
reaction mass of: N, N''-(methylenedi-4,1-phenylene)bis[N'-phenylurea]; N-(4-[[4-[[(phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylurea; N, N''-(methylenedi-4,1-phenylene)bis[N'-cyclohexylurea] |
423-070-8 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
006-102-00-1 |
O-hexyl-N-ethoxycarbonylthiocarbamate |
432-750-3 |
— |
Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H340 H302 H373** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H302 H373** H317 H411 |
|
|
|
006-103-00-7 |
N, N''-(methylenedi-4,1-phenylene)bis[N'-octyl]urea |
445-760-8 |
— |
Eye Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H318 H334 H410 |
|
M=100 |
|
007-001-00-5 |
ammonia, anhydrous |
231-635-3 |
7664-41-7 |
Flam. Gas 2 Press. Gas Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H221 H331 H314 H400 |
GHS04 GHS06 GHS05 GHS09 Dgr |
H221 H331 H314 H400 |
|
|
U |
007-001-01-2 |
ammonia ….% |
215-647-6 |
1336-21-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
STOT SE 3; H335: C ≥ 5 % |
B |
007-002-00-0 |
nitrogen dioxide; [1] dinitrogen tetraoxide [2] |
233-272-6 [1] 234-126-4 [2] |
10102-44-0 [1] 10544-72-6 [2] |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
* STOT SE 3; H335: C ≥0,5 % |
5 |
007-003-00-6 |
chlormequat chloride (ISO); 2-chloroethyltrimethylammonium chloride |
213-666-4 |
999-81-5 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
007-006-00-2 |
ethyl nitrite |
203-722-6 |
109-95-5 |
Flam. Gas 1 Press. Gas Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H220 H332 H312 H302 |
GHS02 GHS04 GHS07 Dgr |
H220 H332 H312 H302 |
|
|
U |
007-007-00-8 |
ethyl nitrate |
210-903-3 |
625-58-1 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
007-008-00-3 |
hydrazine |
206-114-9 |
302-01-2 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H350 H331 H311 H301 H314 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H226 H350 H331 H311 H301 H314 H317 H410 |
|
Skin Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
|
007-009-00-9 |
dicyclohexylammonium nitrite |
221-515-9 |
3129-91-7 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
|
007-010-00-4 |
sodium nitrite |
231-555-9 |
7632-00-0 |
Ox. Sol. 3 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
007-011-00-X |
potassium nitrite |
231-832-4 |
7758-09-0 |
Ox. Sol. 2 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
007-012-00-5 |
N,N-dimethylhydrazine |
200-316-0 |
57-14-7 |
Flam. Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H331 H301 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H301 H314 H411 |
|
|
|
007-013-00-0 |
1,2-dimethylhydrazine |
— |
540-73-8 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
007-014-00-6 |
salts of hydrazine |
— |
— |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
|
|
A |
007-015-00-1 |
O-ethylhydroxylamine |
402-030-3 |
624-86-2 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
|
|
|
007-016-00-7 |
butyl nitrite |
208-862-1 |
544-16-1 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H301 |
GHS02 GHS06 Dgr |
H225 H331 H301 |
|
|
|
007-017-00-2 |
isobutyl nitrite |
208-819-7 |
542-56-3 |
Flam. Liq. 2 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H341 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H341 H332 H302 |
|
|
|
007-018-00-8 |
sec-butyl nitrite |
213-104-8 |
924-43-6 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
007-019-00-3 |
tert-butyl nitrite |
208-757-0 |
540-80-7 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
007-020-00-9 |
pentyl nitrite; [1] ‘amyl nitrite’, mixed isomers [2] |
207-332-7 [1] 203-770-8 [2] |
463-04-7 [1] 110-46-3 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
007-021-00-4 |
hydrazobenzene; 1,2-diphenylhydrazine |
204-563-5 |
122-66-7 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
007-022-00-X |
hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) |
405-030-1 |
— |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H302 H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H350 H302 H314 H317 H412 |
|
|
|
007-023-00-5 |
sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate |
405-510-0 |
— |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
007-024-00-0 |
2-(decylthio)ethylammonium chloride |
405-640-8 |
36362-09-1 |
STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H315 H318 H410 |
|
|
|
007-025-00-6 |
(4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride |
406-090-1 |
81880-96-8 |
Muta. 2 Acute Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H301 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H301 H372 ** H317 H410 |
|
|
|
007-026-00-1 |
oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide |
413-230-5 |
122035-71-6 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
007-027-00-7 |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane |
420-190-2 |
771478-66-1 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H317 H410 |
|
|
|
007-028-00-2 |
hydroxylammonium nitrate |
236-691-2 |
13465-08-2 |
Expl. 1.1 **** Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
|
|
|
007-029-00-8 |
diethyldimethylammonium hydroxide |
419-400-5 |
95500-19-9 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
008-001-00-8 |
oxygen |
231-956-9 |
7782-44-7 |
Ox. Gas 1 Press. Gas |
H270 |
GHS03 GHS04 Dgr |
H270 |
|
|
U |
008-003-00-9 |
hydrogen peroxide solution… % |
231-765-0 |
7722-84-1 |
Ox. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H271 H332 H302 H314 |
GHS03 GHS05 GHS07 Dgr |
H271 H332 H302 H314 |
|
Ox. Liq. 1; H271: C ≥70 %**** Ox. Liq. 2; H272: 50 % ≤ C < 70 % **** * Skin Corr. 1A; H314: C ≥ 70 % Skin Corr. 1B; H314: 50 % ≤ C < 70 % Skin Irrit. 2; H315: 35 % ≤ C < 50 % Eye Dam. 1; H318: 8 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C< 8 % STOT SE 3; H335; C ≥ 35 % |
B |
009-001-00-0 |
fluorine |
231-954-8 |
7782-41-4 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1A |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
|
|
009-002-00-6 |
hydrogen fluoride |
231-634-8 |
7664-39-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
009-003-00-1 |
hydrofluoric acid … % |
231-634-8 |
7664-39-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
Skin Corr. 1A; H314: C ≥ 7 % Skin Corr. 1B; H314: 1 % ≤ C< 7 % Eye Irrit. 2; H319: 0,1 % ≤C < 1 % |
B |
009-004-00-7 |
sodium fluoride |
231-667-8 |
7681-49-4 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
EUH032 |
|
|
009-005-00-2 |
potassium fluoride |
232-151-5 |
7789-23-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
009-006-00-8 |
ammonium fluoride |
235-185-9 |
12125-01-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
009-007-00-3 |
sodium bifluoride; sodium hydrogen difluoride |
215-608-3 |
1333-83-1 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
*Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
009-008-00-9 |
potassium bifluoride; potassium hydrogen difluoride |
232-156-2 |
7789-29-9 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
009-009-00-4 |
ammonium bifluoride; ammonium hydrogen difluoride |
215-676-4 |
1341-49-7 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit.2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
009-010-00-X |
fluoroboric acid … % |
240-898-3 |
16872-11-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
009-011-00-5 |
fluorosilicic acid … % |
241-034-8 |
16961-83-4 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
B |
009-012-00-0 |
alkali fluorosilicates(Na); [1] alkali fluorosilicates(K); [2] alkali fluorosilicates(NH4) [3] |
240-934-8 [1] 240-896-2 [2] 240-968-3 [3] |
16893-85-9 [1] 16871-90-2 [2] 16919-19-0 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
* |
A |
009-013-00-6 |
fluorosilicates, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
* |
A |
009-014-00-1 |
lead hexafluorosilicate |
247-278-1 |
25808-74-6 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
|
1 |
009-015-00-7 |
sulphuryl difluoride |
220-281-5 |
2699-79-8 |
Press. Gas Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H373 ** H400 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H331 H373 ** H400 |
|
|
U |
009-016-00-2 |
trisodium hexafluoroaluminate [1] trisodium hexafluoroaluminate(cryolite) [2] |
237-410-6 [1] 239-148-8 [2] |
13775-53-6 [1] 15096-52-3 [2] |
STOT RE 1 Acute Tox. 4 Aquatic Chronic 2 |
H372 H332 H411 |
GHS07 GHS08 GHS09 Dgr |
H372 H332 H411 |
|
|
|
009-017-00-8 |
potassium mu-fluoro-bis(triethylaluminium) |
400-040-2 |
12091-08-6 |
Flam. Sol. 1 Water-react. 1 Skin Corr. 1A Acute Tox. 4 * |
H228 H270 H314 H332 |
GHS02 GHS05 GHS07 Dgr |
H228 H270 H314 H332 |
EUH014 |
|
T |
009-018-00-3 |
magnesium hexafluorosilicate |
241-022-2 |
16949-65-8 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
* |
|
011-001-00-0 |
sodium |
231-132-9 |
7440-23-5 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
011-002-00-6 |
sodium hydroxide; caustic soda |
215-185-5 |
1310-73-2 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit.2; H319: 0,5 % ≤ C < 2 % |
|
011-003-00-1 |
sodium peroxide |
215-209-4 |
1313-60-6 |
Ox. Sol. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
|
|
011-004-00-7 |
sodium azide |
247-852-1 |
26628-22-8 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H400 H410 |
EUH032 |
|
|
011-005-00-2 |
sodium carbonate |
207-838-8 |
497-19-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
011-006-00-8 |
sodium cyanate |
213-030-6 |
917-61-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
011-007-00-3 |
propoxycarbazone-sodium |
— |
181274-15-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
012-001-00-3 |
magnesium powder (pyrophoric) |
231-104-6 |
7439-95-4 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T |
012-002-00-9 |
magnesium, powder or turnings |
231-104-6 |
— |
Flam. Sol. 1 Water-react. 2 Self-heat. 1 |
H228 H261 H252 |
GHS02 Dgr |
H228 H261 H252 |
|
|
T |
012-003-00-4 |
magnesium alkyls |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
012-004-00-X |
aluminium-magnesium-carbonate-hydroxide-perchlorate-hydrate |
422-150-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
013-001-00-6 |
aluminium powder (pyrophoric) |
231-072-3 |
7429-90-5 |
Water-react. 2 Pyr. Sol. 1 |
H261 H250 |
GHS02 Dgr |
H261 H250 |
|
|
T |
013-002-00-1 |
aluminium powder (stabilised) |
231-072-3 |
7429-90-5 |
Water-react. 2 Flam. Sol. 1 |
H261 H228 |
GHS02 Dgr |
H261 H228 |
|
|
T |
013-003-00-7 |
aluminium chloride, anhydrous |
231-208-1 |
7446-70-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
013-004-00-2 |
aluminium alkyls |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
013-005-00-8 |
diethyl(ethyldimethylsilanolato) aluminium |
401-160-8 |
55426-95-4 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
013-006-00-3 |
(ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised |
402-370-2 |
— |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
013-007-00-9 |
poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) |
403-430-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
013-008-00-4 |
di-n-octylaluminium iodide |
408-190-0 |
7585-14-0 |
Pyr. Liq. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H314 H410 |
EUH014 |
|
|
013-009-00-X |
sodium (n-butyl)x(ethyl)y-1,5-dihydro)aluminate x = 0,5 y =1,5 |
418-720-2 |
— |
Flam. Sol. 1 Water-react. 1 Pyr. Sol. 1 Acute Tox. 4 * Skin Corr. 1A |
H228 H260 H250 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H228 H260 H250 H332 H314 |
EUH014 |
|
T |
013-010-00-5 |
hydroxy aluminium bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d, g][1.3.2]dioxaphosphocin-6-oxide) |
430-650-4 |
151841-65-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
014-001-00-9 |
trichlorosilane |
233-042-5 |
10025-78-2 |
Flam. Liq. 1 Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H224 H250 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H224 H250 H332 H302 H314 |
EUH014 EUH029 |
* STOT SE 3; H335: C ≥ 1 % |
T |
014-002-00-4 |
silicon tetrachloride |
233-054-0 |
10026-04-7 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
EUH014 |
|
|
014-003-00-X |
dimethyldichlorosilane |
200-901-0 |
75-78-5 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
014-004-00-5 |
trichloro(methyl)silane; methyltrichlorosilane |
200-902-6 |
75-79-6 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
EUH014 |
Skin Irrit.2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
014-005-00-0 |
tetraethyl silicate; ethyl silicate |
201-083-8 |
78-10-4 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H226 H332 H319 H335 |
GHS02 GHS07 Wng |
H226 H332 H319 H335 |
|
|
|
014-006-00-6 |
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride |
401-380-4 |
— |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
014-007-00-1 |
triethoxyisobutylsilane |
402-810-3 |
17980-47-1 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
014-008-00-7 |
(chloromethyl)bis(4-fluorophenyl)methylsilane |
401-200-4 |
85491-26-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
014-009-00-2 |
isobutylisopropyldimethoxysilane |
402-580-4 |
111439-76-0 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H315 |
GHS02 GHS07 Wng |
H226 H332 H315 |
|
|
|
014-010-00-8 |
disodium metasilicate |
229-912-9 |
6834-92-0 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
014-011-00-3 |
cyclohexyldimethoxymethylsilane |
402-140-1 |
17865-32-6 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
014-012-00-9 |
bis(3-(trimethoxysilyl)propyl)amine |
403-480-3 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
014-013-00-4 |
α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) |
404-920-7 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H312 H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H411 |
|
|
|
014-014-00-X |
etacelasil (ISO); 6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
253-704-7 |
37894-46-5 |
Repr. 1B Acute Tox. 4 * STOT RE 2 * |
H360D *** H302 H373 ** |
GHS08 GHS07 Dgr |
H360D *** H302 H373 ** |
|
|
|
014-015-00-5 |
α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]-co-oxy(dimethylsilane)) |
406-420-4 |
69430-40-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
014-016-00-0 |
reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane; 1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane |
406-490-6 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
014-017-00-6 |
flusilazole (ISO); bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silane |
— |
85509-19-9 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
014-018-00-1 |
octamethylcyclotetrasiloxane |
209-136-7 |
556-67-2 |
Repr. 2 Aquatic Chronic 4 |
H361f *** H413 |
GHS08 Wng |
H361f *** H413 |
|
|
|
014-019-00-7 |
reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole; 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole |
403-250-2 |
— |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
014-020-00-2 |
bis(1,1-dimethyl-2-propynyloxy)dimethylsilane |
414-960-7 |
53863-99-3 |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
014-021-00-8 |
tris(isopropenyloxy)phenyl silane |
411-340-8 |
52301-18-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H400 H410 |
|
|
|
014-022-00-3 |
reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) |
401-530-9 |
— |
Flam. Sol. 1 STOT SE 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H228 H370 ** H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H228 H370 ** H332 H312 H302 |
|
|
T |
014-023-00-9 |
α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole |
408-160-7 |
125613-45-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
014-024-00-4 |
1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene |
412-620-2 |
121626-74-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
014-025-00-X |
4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine |
411-400-3 |
102089-33-8 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 H412 |
|
|
|
014-026-00-5 |
dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane |
407-180-3 |
770722-36-6 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
014-027-00-0 |
chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane |
410-270-5 |
770722-46-8 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
014-028-00-6 |
α-[3-(1-oxoprop-2-enyl)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) |
415-290-8 |
193159-06-7 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
014-029-00-1 |
O, O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] |
421-870-1 |
156145-66-3 |
Repr. 2 Acute Tox. 4 * STOT RE 2 * |
H361f *** H302 H373 ** |
GHS08 GHS07 Wng |
H361f *** H302 H373 ** |
|
|
|
014-030-00-7 |
[(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium |
422-060-0 |
137390-08-0 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
014-031-00-2 |
bis(1-methylethyl)-dimethoxysilane |
421-540-7 |
18230-61-0 |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H226 H315 H317 H412 |
GHS02 GHS07 Wng |
H226 H315 H317 H412 |
|
|
|
014-032-00-8 |
dicyclopentyldimethoxysilane |
404-370-8 |
126990-35-0 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
014-033-00-3 |
2-methyl-3-(trimethoxysilyl)propyl-2-propenoate hydrolysis product with silica |
419-030-4 |
125804-20-8 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
014-034-00-9 |
3-hexylheptamethyltrisiloxane |
428-700-5 |
1873-90-1 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
014-035-00-4 |
2-(3,4-epoxycyclohexyl)ethyltriethoxy silane |
425-050-4 |
10217-34-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
014-036-00-X |
(4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane |
405-020-7 |
105024-66-6 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360F*** H400 H410 |
GHS08 GHS09 Dgr |
H360F*** H410 |
|
M=1000 |
|
014-037-00-5 |
2-butanone-O, O',O''-(phenylsilylidyne)trioxime |
433-360-6 |
34036-80-1 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373** H317 H412 |
GHS08 GHS07 Wng |
H373** H317 H412 |
|
|
|
014-038-00-0 |
S-(3-(triethoxysilyl)propyl)octanethioate |
436-690-9 |
220727-26-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
014-039-00-6 |
(2,3-dimethylbut-2-yl)-trimethoxysilane |
439-360-2 |
142877-45-0 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
014-041-00-7 |
N, N-bis(trimethylsilyl)aminopropylmethyldiethoxysilane |
445-890-5 |
201290-01-9 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
014-042-00-2 |
reaction mass of: O,O',O'',O'''-silanetetrayl tetrakis(4-methyl-2-pentanone oxime) (3 stereoisomers) |
423-010-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
014-043-00-8 |
reaction product of amorphous silica (50-85 %), butyl (1-methylpropyl) magnesium (3-15 %), tetraethyl orthosilicate (5-15 %) and titanium tetrachloride (5-20 %) |
432-200-2 |
— |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H335 H315 H318 H412 |
GHS05 GHS07 Dgr |
H335 H315 H318 H412 |
|
|
|
014-044-00-3 |
3-[(4'-acetoxy-3'-methoxyphenyl) propyl]trimethoxysilane |
433-050-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
014-045-00-9 |
magnesium sodium fluoride silicate |
442-650-1 |
— |
STOT RE 2 * |
H373** |
GHS08 Wng |
H373** |
|
|
|
015-001-00-1 |
white phosphorus |
231-768-7 |
12185-10-3 |
Pyr. Sol. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H250 H330 H300 H314 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H250 H330 H300 H314 H400 |
|
|
|
015-002-00-7 |
red phosphorus |
231-768-7 |
7723-14-0 |
Flam. Sol. 1 Aquatic Chronic 3 |
H228 H412 |
GHS02 Dgr |
H228 H412 |
|
|
|
015-004-00-8 |
aluminium phosphide |
244-088-0 |
20859-73-8 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
015-005-00-3 |
magnesium phosphide; trimagnesium diphosphide |
235-023-7 |
12057-74-8 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
015-006-00-9 |
trizinc diphosphide; zinc phosphide |
215-244-5 |
1314-84-7 |
Water-react. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H260 H300 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H410 |
EUH029 EUH032 |
M=100 |
T |
015-007-00-4 |
phosphorus trichloride |
231-749-3 |
7719-12-2 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Skin Corr. 1A |
H330 H300 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H300 H373 ** H314 |
EUH014 EUH029 |
|
|
015-008-00-X |
phosphorus pentachloride |
233-060-3 |
10026-13-8 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H330 H302 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H373 ** H314 |
EUH014 EUH029 |
|
|
015-009-00-5 |
phosphoryl trichloride |
233-046-7 |
10025-87-3 |
Acute Tox. 2 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1A |
H330 H372 ** H302 H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H372 ** H302 H314 |
EUH014 EUH029 |
|
|
015-010-00-0 |
phosphorus pentoxide |
215-236-1 |
1314-56-3 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
015-011-00-6 |
phosphoric acid . %, orthophosphoric acid . % |
231-633-2 |
7664-38-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
015-012-00-1 |
tetraphosphorus trisulphide; phosphorus sesquisulphid |
215-245-0 |
1314-85-8 |
Flam. Sol. 2 Water-react. 1 Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H302 H400 |
|
|
T |
015-013-00-7 |
triethyl phosphate |
201-114-5 |
78-40-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
015-014-00-2 |
tributyl phosphate |
204-800-2 |
126-73-8 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 |
H351 H302 H315 |
GHS08 GHS07 Wng |
H351 H302 H315 |
|
|
|
015-015-00-8 |
tricresyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); tritolyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); |
201-103-5 |
78-30-8 |
STOT SE 1 Aquatic Chronic 2 |
H370 ** H411 |
GHS08 GHS09 Dgr |
H370 ** H411 |
|
STOT SE 1; H370: C ≥ 1 % STOT SE 2; H371: 0,2 % ≤ C < 1 % |
C |
015-016-00-3 |
tricresyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); |
201-105-6 |
78-32-0 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
|
* |
C |
015-019-00-X |
dichlorvos (ISO); 2,2-dichlorovinyl dimethyl phosphate |
200-547-7 |
62-73-7 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 |
H330 H311 H301 H317 H400 |
GHS06 GHS09 Dgr |
H330 H311 H301 H317 H400 |
|
M=1000 |
|
015-020-00-5 |
mevinphos (ISO); 2-methoxycarbonyl-1-methylvinyl dimethyl phosphate |
232-095-1 |
7786-34-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10000 |
|
015-021-00-0 |
trichlorfon (ISO); dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate |
200-149-3 |
52-68-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H400 H410 |
|
M = 1000 |
|
015-022-00-6 |
phosphamidon (ISO); 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate |
236-116-5 |
13171-21-6 |
Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H300 H311 H410 |
|
|
|
015-023-00-1 |
pyrazoxon; diethyl 3-methylpyrazol-5-yl phosphate |
— |
108-34-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
015-024-00-7 |
triamiphos (ISO); 5-amino-3-phenyl-1,2,4-triazol-1-yl-N, N,N',N'-tetramethylphosphonic diamide |
— |
1031-47-6 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-025-00-2 |
TEPP (ISO); tetraethyl pyrophosphate |
203-495-3 |
107-49-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
015-026-00-8 |
schradan (ISO); octamethylpyrophosphoramide |
205-801-0 |
152-16-9 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-027-00-3 |
sulfotep (ISO); O, O,O, O-tetraethyl dithiopyrophosphate |
222-995-2 |
3689-24-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
015-028-00-9 |
demeton-O (ISO); O,O-diethyl-O-2-ethylthioethyl phosphorothioate |
206-053-8 |
298-03-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
015-029-00-4 |
demeton-S (ISO); diethyl-S-2-ethylthioethyl phosphorothioate |
204-801-8 |
126-75-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-030-00-X |
demeton-O-methyl (ISO); O-2-ethylthioethyl O,O-dimethyl phosphorothioate |
212-758-1 |
867-27-6 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
015-031-00-5 |
demeton-S-methyl (ISO); S-2-ethylthioethyl dimethyl phosphorothioate |
213-052-6 |
919-86-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H311 H301 H411 |
GHS06 GHS09 Dgr |
H311 H301 H411 |
|
|
|
015-032-00-0 |
prothoate (ISO); O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate |
218-893-2 |
2275-18-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 3 |
H310 H300 H412 |
GHS06 Dgr |
H310 H300 H412 |
|
|
|
015-033-00-6 |
phorate (ISO); O,O-diethyl ethylthiomethyl phosphorodithioate |
206-052-2 |
298-02-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
015-034-00-1 |
parathion (ISO); O,O-diethyl O-4-nitrophenyl phosphorothioate |
200-271-7 |
56-38-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H311 H372 ** H410 |
|
M = 100 |
|
015-035-00-7 |
parathion — methyl (ISO); O,O-dimethyl O-4-nitrophenyl phosphorothioate |
206-050-1 |
298-00-0 |
Flam. Liq. 3 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H330 H300 H311 H373 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H330 H300 H311 H373 ** H410 |
|
M = 100 |
|
015-036-00-2 |
O-ethyl O-4-nitrophenyl phenylphosphonothioate; EPN |
218-276-8 |
2104-64-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
015-037-00-8 |
phenkapton (ISO); S-(2,5-dichlorophenylthiomethyl) O, O-diethyl phosphorodithioate |
218-892-7 |
2275-14-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
015-038-00-3 |
coumaphos (ISO); O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate |
200-285-3 |
56-72-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
015-039-00-9 |
azinphos-methyl (ISO); O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
201-676-1 |
86-50-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H317 H410 |
|
|
|
015-040-00-4 |
diazinon (ISO); O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate |
206-373-8 |
333-41-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
015-041-00-X |
malathion (ISO); 1,2-bis(ethoxycarbonyl)ethyl O, O-dimethyl phosphorodithioate; [containing ≤ 0,03 % isomalathion] |
204-497-7 |
121-75-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M=1000 |
|
015-042-00-5 |
chlorthion O-(3-chloro-4-nitrophenyl) O, O-dimethyl phosphorothioate |
207-902-5 |
500-28-7 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 100 |
|
015-043-00-0 |
phosnichlor (ISO); O-4-chloro-3-nitrophenyl O, O-dimethyl phosphorothioate |
— |
5826-76-6 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
015-044-00-6 |
carbophenothion (ISO); 4-chlorophenylthiomethyl O, O-diethyl phosphorodithioate |
212-324-1 |
786-19-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
015-045-00-1 |
mecarbam (ISO); N-ethoxycarbonyl-N-methylcarbamoylmethyl O, O-diethyl phosphorodithioate |
219-993-9 |
2595-54-2 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H400 H410 |
|
|
|
015-046-00-7 |
oxydemeton-methyl; S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate |
206-110-7 |
301-12-2 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H311 H301 H400 |
GHS06 GHS09 Dgr |
H311 H301 H400 |
|
|
|
015-047-00-2 |
ethion (ISO); O, O,O',O'-tetraethyl S, S'-methylenedi (phosphorodithioate); diethion |
209-242-3 |
563-12-2 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 10000 |
|
015-048-00-8 |
fenthion (ISO); O, O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate |
200-231-9 |
55-38-9 |
Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H312 H302 H372** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H312 H302 H372** H410 |
|
M=100 |
|
015-049-00-3 |
endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate |
220-472-3 |
2778-04-3 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
015-050-00-9 |
thiometon (ISO); S-2-ethylthioethyl O,O-dimethyl phosphorodithioate |
211-362-6 |
640-15-3 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
015-051-00-4 |
dimethoate (ISO); O, O-dimethyl methylcarbamoylmethyl phosphorodithioate |
200-480-3 |
60-51-5 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
015-052-00-X |
fenchlorphos (ISO); O, O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate |
206-082-6 |
299-84-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
015-053-00-5 |
menazon (ISO); S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O, O-dimethyl phosphorodithioate |
201-123-4 |
78-57-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
015-054-00-0 |
fenitrothion (ISO); O, O-dimethyl O-4-nitro-m-tolyl phosphorothioate |
204-524-2 |
122-14-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
015-055-00-6 |
naled (ISO); 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
206-098-3 |
300-76-5 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 |
H312 H302 H319 H315 H400 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H400 |
|
M = 1000 |
|
015-056-00-1 |
azinphos-ethyl (ISO); O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
220-147-6 |
2642-71-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M=100 |
|
015-057-00-7 |
formothion (ISO); N-formyl-N-methylcarbamoylmethyl O, O-dimethyl phosphorodithioate |
219-818-6 |
2540-82-1 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
015-058-00-2 |
morphothion (ISO); O, O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate |
205-628-0 |
144-41-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
015-059-00-8 |
vamidothion (ISO); O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate |
218-894-8 |
2275-23-2 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
015-060-00-3 |
disulfoton (ISO); O,O-diethyl 2-ethylthioethyl phosphorodithioate |
206-054-3 |
298-04-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
015-061-00-9 |
dimefox (ISO); tetramethylphosphorodiamidic fluoride |
204-076-8 |
115-26-4 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-062-00-4 |
mipafox (ISO); N,N'-di-isopropylphosphorodiamidic fluoride |
206-742-3 |
371-86-8 |
STOT SE 1 |
H370 ** |
GHS08 Dgr |
H370 ** |
|
|
|
015-063-00-X |
dioxathion (ISO); 1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) |
201-107-7 |
78-34-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
M = 1000 |
|
015-064-00-5 |
bromophos-ethyl (ISO); O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate |
225-399-0 |
4824-78-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
015-065-00-0 |
S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate |
— |
2703-37-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H330 H310 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
|
|
|
015-066-00-6 |
omethoate (ISO); O, O-dimethyl S-methylcarbamoylmethyl phosphorothioate |
214-197-8 |
1113-02-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
015-067-00-1 |
phosalone (ISO); S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O, O-diethyl phosphorodithioate |
218-996-2 |
2310-17-0 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H410 |
|
M=1000 |
|
015-068-00-7 |
dichlofenthion (ISO); O—2,4-dichlorophenyl O,O-diethyl phosphorothioate |
202-564-5 |
97-17-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
015-069-00-2 |
methidathion (ISO); 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate |
213-449-4 |
950-37-8 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
015-070-00-8 |
cyanthoate (ISO); S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate |
223-099-4 |
3734-95-0 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
015-071-00-3 |
chlorfenvinphos (ISO); 2-chloro-1-(2,4 dichlorophenyl)vinyl diethyl phosphate |
207-432-0 |
470-90-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
015-072-00-9 |
monocrotophos (ISO); dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate |
230-042-7 |
6923-22-4 |
Muta. 2 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H330 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H330 H300 H311 H410 |
|
|
|
015-073-00-4 |
dicrotophos (ISO); (Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate |
205-494-3 |
141-66-2 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
015-074-00-X |
crufomate (ISO); 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate |
206-083-1 |
299-86-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
015-075-00-5 |
S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate |
— |
2635-50-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
015-076-00-0 |
potasan; O, O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate |
— |
299-45-6 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M = 1000 |
|
015-077-00-6 |
2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate |
— |
7076-53-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
015-078-00-1 |
demeton-S-methylsulphon(ISO); S-2-ethylsulphonylethyl dimethyl phosphorothioate |
241-109-5 |
17040-19-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H301 H312 H411 |
GHS06 GHS09 Dgr |
H301 H312 H411 |
|
|
|
015-079-00-7 |
acephate (ISO); O, S-dimethyl acetylphosphoramidothioate |
250-241-2 |
30560-19-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
015-080-00-2 |
amidithion (ISO); 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
— |
919-76-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
015-081-00-8 |
O,O,O',O'-tetrapropyl dithiopyrophosphate |
221-817-0 |
3244-90-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
015-082-00-3 |
azothoate (ISO); O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate |
227-419-3 |
5834-96-8 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
015-083-00-9 |
bensulide (ISO); O, O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate |
212-010-4 |
741-58-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
015-084-00-4 |
chlorpyrifos (ISO); O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
220-864-4 |
2921-88-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H400 H410 |
|
M = 10000 |
|
015-085-00-X |
chlorphonium chloride (ISO); tributyl (2,4-dichlorobenzyl) phosphonium chloride |
204-105-4 |
115-78-6 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H312 H319 H315 |
GHS06 Dgr |
H301 H312 H319 H315 |
|
|
|
015-086-00-5 |
coumithoate (ISO); O,O-diethyl O-7,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate |
— |
572-48-5 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
015-087-00-0 |
cyanophos (ISO); O-4-cyanophenyl O,O-dimethyl phosphorothioate |
220-130-3 |
2636-26-2 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
015-088-00-6 |
dialifos (ISO); 2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate |
233-689-3 |
10311-84-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H400 H410 |
|
|
|
015-089-00-1 |
ethoate-methyl (ISO); ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
204-121-1 |
116-01-8 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
015-090-00-7 |
fensulfothion (ISO); O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate |
204-114-3 |
115-90-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
015-091-00-2 |
fonofos (ISO); O-ethyl phenyl ethylphosphonodithioate |
213-408-0 |
944-22-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
015-092-00-8 |
phosacetim (ISO); O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate |
223-874-7 |
4104-14-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
015-093-00-3 |
leptophos (ISO); O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate |
244-472-8 |
21609-90-5 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H370 ** H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H410 |
|
|
|
015-094-00-9 |
mephosfolan (ISO); diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate |
213-447-3 |
950-10-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H310 H300 H411 |
GHS06 GHS09 Dgr |
H310 H300 H411 |
|
|
|
015-095-00-4 |
methamidophos (ISO); O,S-dimethyl phosphoramidothioate |
233-606-0 |
10265-92-6 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 |
H330 H300 H311 H400 |
GHS06 GHS09 Dgr |
H330 H300 H311 H400 |
|
|
|
015-096-00-X |
oxydisulfoton (ISO); O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate |
219-679-1 |
2497-07-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 10 |
|
015-097-00-5 |
phenthoate (ISO); ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate |
219-997-0 |
2597-03-7 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
015-098-00-0 |
trichloronate (ISO); O-ethyl O-2,4,5-trichlorophenyl ethylphosphonothioate |
206-326-1 |
327-98-0 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
015-099-00-6 |
pirimiphos-ethyl (ISO); O, O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate |
245-704-0 |
23505-41-1 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
015-100-00-X |
phoxim (ISO); α-(diethoxyphosphinothioylimino) phenylacetonitrile |
238-887-3 |
14816-18-3 |
Repr. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f*** H302 H317 H410 |
|
M=1000 |
|
015-101-00-5 |
phosmet (ISO); O, O-dimethyl phthalimidomethyl S-phosphorodithioate |
211-987-4 |
732-11-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
015-102-00-0 |
tris(2-chloroethyl)phosphate |
204-118-5 |
115-96-8 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360F*** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F*** H302 H411 |
|
|
|
015-103-00-6 |
phosphorus tribromide |
232-178-2 |
7789-60-8 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
015-104-00-1 |
diphosphorus pentasulphide; phosphorus pentasulphide |
215-242-4 |
1314-80-3 |
Flam. Sol. 1 Water-react. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H332 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H332 H302 H400 |
EUH029 |
|
T |
015-105-00-7 |
triphenyl phosphite |
202-908-4 |
101-02-0 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
|
015-106-00-2 |
hexamethylphosphoric triamide; hexamethylphosphoramide |
211-653-8 |
680-31-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
015-107-00-8 |
ethoprophos (ISO); ethyl-S,S-dipropyl phosphorodithioate |
236-152-1 |
13194-48-4 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H301 H317 H410 |
|
|
|
015-108-00-3 |
bromophos (ISO); O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
218-277-3 |
2104-96-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 100 |
|
015-109-00-9 |
crotoxyphos (ISO); 1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate |
231-720-5 |
7700-17-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 10 |
|
015-110-00-4 |
cyanofenphos (ISO); O-4-cyanophenyl O-ethyl phenylphosphonothioate |
— |
13067-93-1 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H301 H370 ** H312 H319 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H319 H411 |
|
|
|
015-111-00-X |
phosfolan (ISO); diethyl 1,3-dithiolan-2-ylidenephosphoramidate |
213-423-2 |
947-02-4 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-112-00-5 |
thionazin (ISO); O,O-diethyl O-pyrazin-2-yl phosphorothioate; |
206-049-6 |
297-97-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-113-00-0 |
tolclofos-methyl (ISO); O-(2,6-dichloro-p-tolyl)-O,O-dimethyl thiophosphate |
260-515-3 |
57018-04-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
015-114-00-6 |
chlormephos (ISO); S-chloromethyl O,O-diethyl phosphorodithioate |
246-538-1 |
24934-91-6 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10 |
|
015-115-00-1 |
chlorthiophos (ISO); [isomeric reaction mass in which O-2,5-dichlorophenyl-4-methylthiophenyl O, O-diethyl phosphorothioate predominates] |
244-663-6 |
21923-23-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 1000 |
|
015-116-00-7 |
demephion-O (ISO); O, O-dimethyl O-2-methylthioethyl phosphorothioate |
211-666-9 |
682-80-4 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
015-117-00-2 |
demephion-S (ISO); O, O-dimethyl S-2-methylthioethyl phosphorothioate |
219-971-9 |
2587-90-8 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
015-118-00-8 |
demeton |
— |
8065-48-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
015-119-00-3 |
dimethyl 4-(methylthio)phenyl phosphate |
— |
3254-63-5 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-120-00-9 |
ditalimfos (ISO); O, O-diethyl phthalimidophosphonothioate |
225-875-8 |
5131-24-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
015-121-00-4 |
edifenphos (ISO); O-ethyl S, S-diphenyl phosphorodithioate |
241-178-1 |
17109-49-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
|
|
|
015-122-00-X |
etrimfos (ISO); O-6-ethoxy-2-ethylpyrimidin-4-yl O, O-dimethylphosphorothioate |
253-855-9 |
38260-54-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
015-123-00-5 |
fenamiphos (ISO); ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate |
244-848-1 |
22224-92-6 |
Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H300 H310 H330 H319 H400 H410 |
GHS06 GHS09 Dgr |
H300 H310 H330 H319 H410 |
|
M = 100 M = 100 |
|
015-124-00-0 |
fosthietan (ISO); diethyl 1,3-dithietan-2-ylidenephosphoramidate |
244-437-7 |
21548-32-3 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
015-125-00-6 |
glyphosine (ISO); N,N-bis(phosphonomethyl)glycine |
219-468-4 |
2439-99-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
015-126-00-1 |
heptenophos (ISO); 7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate |
245-737-0 |
23560-59-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
015-127-00-7 |
iprobenfos(ISO); S-benzyl diisopropyl phosphorothioate |
247-449-0 |
26087-47-8 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
015-128-00-2 |
IPSP; S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate |
— |
5827-05-4 |
Acute Tox. 1 Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H301 H400 H410 |
GHS06 GHS09 Dgr |
H310 H301 H410 |
|
M = 100 |
|
015-129-00-8 |
isofenphos (ISO); O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate |
246-814-1 |
25311-71-1 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 100 |
|
015-130-00-3 |
isothioate (ISO); S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate; |
— |
36614-38-7 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
015-131-00-9 |
isoxathion (ISO); O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate |
242-624-8 |
18854-01-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
015-132-00-4 |
S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate; methylcarbophenothione |
— |
953-17-3 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 1000 |
|
015-133-00-X |
piperophos (ISO); S-2-methylpiperidinocarbonylmethyl-O, O-dipropyl phosphorodithioate |
— |
24151-93-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
015-134-00-5 |
pirimiphos-methyl (ISO); O-(2-diethylamino-6-methylpyrimidin-4-yl) O, O-dimethyl phosphorothioate |
249-528-5 |
29232-93-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
015-135-00-0 |
profenofos (ISO)O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate; |
255-255-2 |
41198-08-7 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 1000 |
|
015-136-00-6 |
trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate; propetamphos (ISO) |
250-517-2 |
31218-83-4 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
015-137-00-1 |
pyrazophos (ISO); O, O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate |
236-656-1 |
13457-18-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
|
015-138-00-7 |
quinalphos (ISO); O, O-diethyl-O-quinoxalin-2-yl phosphorothioate |
237-031-6 |
13593-03-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 1000 |
|
015-139-00-2 |
terbufos (ISO); S-tert-butylthiomethyl O, O-diethylphosphorodithioate; |
235-963-8 |
13071-79-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
015-140-00-8 |
triazophos (ISO); O, O-diethyl-O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
245-986-5 |
24017-47-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H410 |
|
M=100 |
|
015-141-00-3 |
ethylenediammonium O, O-bis(octyl) phosphorodithioate, mixed isomers |
400-520-1 |
— |
Skin Corr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H314 H302 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
|
|
|
015-142-00-9 |
butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate |
401-100-0 |
— |
Flam. Liq. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H225 H319 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H319 H411 |
|
|
T |
015-143-00-4 |
reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate, reaction mass of isomers |
401-740-0 |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
015-144-00-X |
reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate |
402-090-0 |
87025-52-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
015-145-00-5 |
reaction mass of copper(I) O, O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O, O-bis(4-methylpent-2-yl) phosphorodithioate |
401-520-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
015-146-00-0 |
S-(tricyclo(5.2.1.0 2,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate |
401-850-9 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
015-147-00-6 |
reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) |
400-930-0 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
015-148-00-1 |
2-(diphosphonomethyl)succinic acid |
403-070-4 |
51395-42-7 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
015-149-00-7 |
reaction mass of: hexyldioctylphosphineoxide; dihexyloctylphosphineoxide; trioctylphosphineoxide |
403-470-9 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
015-150-00-2 |
(2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide |
404-940-6 |
86608-70-0 |
Acute Tox. 4 * Eye Dam. 1 STOT RE 2 * Aquatic Chronic 3 |
H302 H318 H373 ** H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H318 H373 ** H412 |
|
|
|
015-151-00-8 |
tris(isopropyl/tert-butylphenyl)phosphate |
405-010-2 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
015-152-00-3 |
dioxabenzofos (ISO); 2-methoxy-4H-1,3,2-benzodioxaphosphorin 2-sulphide |
223-292-3 |
3811-49-2 |
Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 Aquatic Chronic 2 |
H311 H301 H370 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H311 H301 H370 ** H411 |
|
|
|
015-153-00-9 |
isazofos (ISO); O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O, O-diethyl phosphorothioate |
255-863-8 |
42509-80-8 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H373 ** H317 H410 |
|
|
|
015-154-00-4 |
ethephon; 2-chloroethylphosphonic acid |
240-718-3 |
16672-87-0 |
Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 Skin Corr. 1C Aquatic Chronic 2 |
H311 H332 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H332 H302 H314 H411 |
EUH071 |
|
|
015-155-00-X |
glufosinate ammonium (ISO); ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate |
278-636-5 |
77182-82-2 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H360Fd H332 H312 H302 H373** |
GHS08 GHS07 Dgr |
H360Fd H332 H312 H302 H373** |
|
|
|
015-156-00-5 |
methyl 3-[(dimethoxyphosphinothioyl)oxy]methacrylate; [1] methacrifos (ISO); methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] |
250-366-9 [1]-[2] |
30864-28-9 [1] 62610-77-9 [2] |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
015-157-00-0 |
phosphonic acid; [1] phosphorous acid [2] |
237-066-7 [1] 233-663-1 [2] |
13598-36-2 [1] 10294-56-1 [2] |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
015-158-00-6 |
(η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) |
402-340-9 |
32760-80-8 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
015-159-00-1 |
hydroxyphosphonoacetic acid |
405-710-8 |
23783-26-8 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H302 H373 ** H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H317 |
|
|
|
015-160-00-7 |
vanadyl pyrophosphate |
406-260-5 |
58834-75-6 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
015-161-00-2 |
divanadyl pyrophosphate |
407-130-0 |
65232-89-5 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
015-162-00-8 |
vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped |
407-350-7 |
— |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H373 ** H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H373 ** H318 H411 |
|
|
|
015-163-00-3 |
bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide |
412-010-6 |
145052-34-2 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
015-164-00-9 |
calcium P, P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate |
400-480-5 |
36669-85-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
015-165-00-4 |
reaction mass of: thiobis(4,1-phenylene)-S, S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate |
404-986-7 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
015-166-00-X |
3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
410-290-4 |
80693-00-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
015-167-00-5 |
3-(hydroxyphenylphosphinyl)propanoic acid |
411-200-6 |
14657-64-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
015-168-00-0 |
fosthiazate (ISO); (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate |
— |
98886-44-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
EUH070 |
|
|
015-169-00-6 |
tributyltetradecylphosphonium tetrafluoroborate |
413-520-1 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
|
|
|
015-170-00-1 |
reaction mass of: di-(1-octane-N, N,N-trimethylammonium) octylphosphate; 1-octane-N, N,N-trimethylammonium di-octylphosphate; 1-octane-N, N,N-trimethylammonium octylphosphate |
407-490-9 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
015-171-00-7 |
O, O,O-tris(2(or 4)-C 9-10-isoalkylphenyl) phosphorothioate |
406-940-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
015-172-00-2 |
reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate; isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate |
406-240-6 |
— |
Flam. Liq. 3 Skin Corr. 1B Aquatic Chronic 2 |
H226 H314 H411 |
GHS02 GHS05 GHS09 Dgr |
H226 H314 H411 |
|
|
|
015-173-00-8 |
methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate |
414-080-3 |
117291-73-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
015-174-00-3 |
1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine |
411-370-1 |
82857-68-9 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Chronic 2 |
H301 H318 H411 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H411 |
|
|
|
015-175-00-9 |
tert-butyl (triphenylphosphoranylidene) acetate |
412-880-7 |
35000-38-5 |
Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H319 H317 H411 |
|
|
|
015-176-00-4 |
P, P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine |
413-430-2 |
116163-96-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
015-177-00-X |
((4-phenylbutyl)hydroxyphosphoryl)acetic acid |
412-170-7 |
83623-61-4 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373 ** H318 H317 |
GHS08 GHS05 Dgr |
H373 ** H318 H317 |
|
|
|
015-178-00-5 |
(R)-α-phenylethylammonium(-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate |
418-570-8 |
25383-07-7 |
Repr. 2 Aquatic Chronic 2 |
H361f *** H411 |
GHS08 GHS09 Wng |
H361f *** H411 |
|
|
|
015-179-00-0 |
UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine |
422-720-8 |
166242-53-1 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H373 ** H314 H317 H410 |
|
|
|
015-180-00-6 |
[R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt |
415-820-8 |
137590-32-0 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
015-181-00-1 |
phosphine |
232-260-8 |
7803-51-2 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 |
H220 H330 H314 H400 |
GHS02 GHS04 GHS06 GHS05 GHS09 Dgr |
H220 H330 H314 H400 |
|
|
U |
015-182-00-7 |
tetrapropan-2-yl (dichloromethanediyl)bis(phosphonate) |
430-630-5 |
10596-22-2 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
015-183-00-2 |
(1-hydroxydodecylidene)diphosphonic acid |
425-230-2 |
16610-63-2 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
015-184-00-8 |
salts of glyphosate, with the exception of those specified elsewhere in this Annex |
— |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
A |
015-186-00-9 |
chlorpyrifos-methyl (ISO) O, O-dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
227-011-5 |
5598-13-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10000 |
|
015-187-00-4 |
reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide |
417-540-1 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
015-189-00-5 |
phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide |
423-340-5 |
162881-26-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
015-190-00-0 |
bis(2,4-dicumylphenyl)neopentyl diphosphite; 3,9-bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
421-920-2 |
154862-43-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
015-191-00-6 |
dodecyldiphenyl phosphate |
431-760-5 |
27460-02-2 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
015-192-00-1 |
tetrakis(2,6-dimethylphenyl)-m-phenylene biphosphate |
432-770-2 |
139189-30-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
015-193-00-7 |
triphenyl(phenylmethyl)phosphonium 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
442-960-7 |
332350-93-3 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H400 H410 |
GHS05 GHS06 GHS09 Dgr |
H301 H318 H410 |
|
|
|
015-194-00-2 |
tetrabutyl-phosphonium nonafluoro-butane-1-sulfonate |
444-440-5 |
220689-12-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
015-195-00-8 |
reaction mass of: potassium o-toluenephosphonate; potassium m-toluenephosphonate; potassium p-toluenephosphonate |
433-860-4 |
— |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
015-196-00-3 |
reaction mass of: dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate |
435-960-3 |
— |
Carc. 1B Muta. 1B Skin Sens. 1 |
H350 H340 H317 |
GHS08 GHS07 Dgr |
H350 H340 H317 |
|
|
|
015-197-00-9 |
bis(2,4,4-trimethylpentyl)dithiophosphonic acid |
420-160-9 |
107667-02-7 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H302 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H302 H314 H411 |
|
|
|
015-198-00-4 |
(4-phenylbutyl)phosphinic acid |
420-450-5 |
86552-32-1 |
Carc. 2 Eye Dam. 1 |
H351 H318 |
GHS05 GHS08 Dgr |
H351 H318 |
|
|
|
015-199-00-X |
tris[2-chloro-1-chloromethyl)ethyl] phosphate |
237-159-2 |
13674-87-8 |
Carc. 2 |
H351 |
GSH08 Wng |
H351 |
|
|
|
015-200-00-3 |
indium phosphide |
244-959-5 |
22398-80-7 |
Carc. 1B Repr. 2 STOT RE 1 |
H350 H361f H372 (lungs) |
GHS08 Dgr |
H350 H361f H372 (lungs) |
|
STOT RE 1; H372: C ≥0,1 % Carc 1B; H350: C ≥0,01 % STOT RE 2; H373: 0,01 % ≤ C < 0,1 % |
|
015-201-00-9 |
trixylyl phosphate |
246-677-8 |
25155-23-1 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
015-202-00-4 |
tris(nonylphenyl) phosphite |
247-759-6 |
26523-78-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
015-203-00-X |
diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide |
278-355-8 |
75980-60-8 |
Repr. 2 |
H361f (causing atrophy of the testes) |
GHS08 Wng |
H361f (causing atrophy of the testes) |
|
|
|
016-001-00-4 |
hydrogen sulphide |
231-977-3 |
7783-06-4 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * Aquatic Acute 1 |
H220 H330 H400 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H330 H400 |
|
|
U |
016-002-00-X |
barium sulphide |
244-214-4 |
21109-95-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
EUH031 |
|
|
016-003-00-5 |
barium polysulphides |
256-814-3 |
50864-67-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
016-004-00-0 |
calcium sulphide |
243-873-5 |
20548-54-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
016-005-00-6 |
calcium polysulphides |
215-709-2 |
1344-81-6 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
016-006-00-1 |
dipotassium sulphide; potassium sulphide |
215-197-0 |
1312-73-8 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
016-007-00-7 |
potassium polysulphides |
253-390-1 |
37199-66-9 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
016-008-00-2 |
ammonium polysulphides |
232-989-1 |
9080-17-5 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031: C ≥1 % |
|
016-009-00-8 |
disodium sulfide; sodium sulfide |
215-211-5 |
1313-82-2 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H311 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H400 |
|
|
|
016-010-00-3 |
sodium polysulphides |
215-686-9 |
1344-08-7 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
EUH031 |
|
|
016-011-00-9 |
sulphur dioxide |
231-195-2 |
7446-09-5 |
Press. Gas Acute Tox. 3 * Skin Corr. 1B |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
|
* |
U5 |
016-012-00-4 |
disulphur dichloride; sulfur monochloride |
233-036-2 |
10025-67-9 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H301 H332 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H332 H314 H400 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
016-013-00-X |
sulphur dichloride |
234-129-0 |
10545-99-0 |
Skin Corr. 1B STOT SE 3 Aquatic Acute 1 |
H314 H335 H400 |
GHS05 GHS07 GHS09 Dgr |
H314 H335 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
016-014-00-5 |
sulphur tetrachloride |
— |
13451-08-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
016-015-00-0 |
thionyl dichloride; thionyl chloride |
231-748-8 |
7719-09-7 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H332 H302 H314 |
GHS05 GHS07 Dgr |
H332 H302 H314 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
016-016-00-6 |
sulphuryl chloride |
232-245-6 |
7791-25-5 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
016-017-00-1 |
chlorosulphonic acid |
232-234-6 |
7790-94-5 |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
016-018-00-7 |
fluorosulphonic acid |
232-149-4 |
7789-21-1 |
Acute Tox. 4 * Skin Corr. 1A |
H332 H314 |
GHS05 GHS07 Dgr |
H332 H314 |
|
|
|
016-019-00-2 |
oleum … % SO3 |
— |
— |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
B |
016-020-00-8 |
sulphuric acid … % |
231-639-5 |
7664-93-9 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 15 % Skin Irrit. 2; H315: 5 % ≤ C < 15 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
B |
016-021-00-3 |
methanethiol; methyl mercaptan |
200-822-1 |
74-93-1 |
Flam. Gas. 1 Press. Gas Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
|
|
U |
016-022-00-9 |
ethanethiol; ethyl mercaptan |
200-837-3 |
75-08-1 |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H410 |
|
|
|
016-023-00-4 |
dimethyl sulphate |
201-058-1 |
77-78-1 |
Carc. 1B Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H330 H301 H314 H317 |
GHS06 GHS08 GHS05 Dgr |
H350 H341 H330 H301 H314 H317 |
|
Carc. 1B; H350: C ≥ 0,01 % Muta. 2 H341: C ≥ 0,01 % STOT SE 3; H335: C ≥ 5 % |
|
016-024-00-X |
dimexano(ISO); bis(methoxythiocarbonyl) disulphide |
215-993-8 |
1468-37-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
016-025-00-5 |
disul (ISO); 2-(2,4-dichlorophenoxy)ethyl hydrogensulphate; 2,4-DES |
205-259-5 |
149-26-8 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
|
|
|
016-026-00-0 |
sulphamidic acid; sulphamic acid; sulfamic acid |
226-218-8 |
5329-14-6 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
016-027-00-6 |
diethyl sulphate |
200-589-6 |
64-67-5 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H340 H332 H312 H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H350 H340 H332 H312 H302 H314 |
|
|
|
016-028-00-1 |
sodium dithionite; sodium hydrosulphite |
231-890-0 |
7775-14-6 |
Self-heat. 1 Acute Tox. 4 * |
H251 H302 |
GHS02 GHS07 Dgr |
H251 H302 |
EUH031 |
|
|
016-029-00-7 |
p-toluenesulphonic acid, (containing more than 5 % H2SO4) |
— |
— |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
016-030-00-2 |
p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) |
203-180-0 |
104-15-4 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 20 % |
|
016-031-00-8 |
tetrahydrothiophene-1,1-dioxide; sulpholane |
204-783-1 |
126-33-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
016-032-00-3 |
1,3-propanesultone; 1,2-oxathiolane 2,2-dioxide |
214-317-9 |
1120-71-4 |
Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H350 H312 H302 |
GHS08 GHS07 Dgr |
H350 H312 H302 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
016-033-00-9 |
dimethylsulfamoylchloride |
236-412-4 |
13360-57-1 |
Carc. 1B Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H330 H312 H302 H314 |
GHS06 GHS05 GHS08 Dgr |
H350 H330 H312 H302 H314 |
|
|
|
016-034-00-4 |
tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) |
400-010-9 |
81898-60-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-035-00-X |
pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate |
400-120-7 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
016-036-00-5 |
tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate |
400-130-1 |
— |
Resp. Sens. 1 Aquatic Chronic 2 |
H334 H411 |
GHS08 GHS09 Dgr |
H334 H411 |
|
|
|
016-037-00-0 |
disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate |
400-350-8 |
85153-93-1 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
016-038-00-6 |
disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate |
400-380-1 |
86393-35-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-039-00-1 |
tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate |
400-430-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-040-00-7 |
reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate |
400-570-4 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
016-041-00-2 |
calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate |
400-710-4 |
— |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
016-042-00-8 |
tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate |
400-790-0 |
85665-97-0 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
016-043-00-3 |
dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl) phenylazo)naphthalene-2-sulphonate |
401-010-1 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-044-00-9 |
disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate |
401-320-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
016-045-00-4 |
lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate |
401-560-2 |
108624-00-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-046-00-X |
sodium hydrogensulphate |
231-665-7 |
7681-38-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
016-047-00-5 |
hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5-trisulphonate |
401-650-1 |
85665-96-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-048-00-0 |
sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate |
401-870-8 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
016-049-00-6 |
calcium octadecylxylenesulphonate |
402-040-8 |
— |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
016-050-00-1 |
potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat |
402-150-6 |
— |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
016-051-00-7 |
trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulphonate |
402-170-5 |
106359-91-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-052-00-2 |
benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate |
402-240-5 |
102561-46-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
016-053-00-8 |
(C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate |
402-460-1 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
016-054-00-3 |
sodium 4-(2,4,4-trimethylpentylcarbonyloxy)benzenesulfonate |
400-030-8 |
— |
Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Sens. 1 |
H331 H372 ** H302 H319 H335 H317 |
GHS06 GHS08 Dgr |
H331 H372 ** H302 H319 H335 H317 |
|
|
|
016-055-00-9 |
tetrasodium 4-amino-3,6-bis(5-(6-chloro-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-sulfonate (containing > 35 % sodium chloride and sodium acetate) |
400-510-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
016-056-00-4 |
potassium hydrogensulphate |
231-594-1 |
7646-93-7 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
016-057-00-X |
styrene-4-sulfonyl chloride |
404-770-2 |
2633-67-2 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
016-058-00-5 |
thionyl chloride, reaction products with 1,3,4-thiadiazol-2,5-dithiol, tert-nonanethiol andC 12-14-tert-alkylamine |
404-820-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
|
|
|
016-059-00-0 |
N, N,N',N'-tetramethyldithiobis(ethylene)diamine dihydrochloride |
405-300-9 |
17339-60-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H317 H410 |
|
|
|
016-060-00-6 |
diammonium peroxodisulphate; ammonium persulphate |
231-786-5 |
7727-54-0 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
016-061-00-1 |
dipotassium peroxodisulphate; potassium persulphate |
231-781-8 |
7727-21-1 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
016-062-00-7 |
bensultap (ISO); 1,3-bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propane |
— |
17606-31-4 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
016-063-00-2 |
sodium metabisulphite |
231-673-0 |
7681-57-4 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
EUH031 |
|
|
016-064-00-8 |
sodium hydrogensulphite … %; sodium bisulphite . . . % |
231-548-0 |
7631-90-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
EUH031 |
|
B |
016-065-00-3 |
sodium 1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthraquinone-2-sulfonate |
400-100-8 |
84057-97-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
016-066-00-9 |
tetrasodium [5-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2-sulfonatobenzylidenehydrazino)benzoate]copper(II) |
404-070-7 |
116912-62-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
016-067-00-4 |
(4-methylphenyl)mesitylene sulfonate |
407-530-5 |
67811-06-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
016-068-00-X |
sodium 3,5-bis(tetradecyloxycarbonyl)benzenesulfinate |
407-720-8 |
155160-86-4 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
016-069-00-5 |
3,5-bis-(tetradecyloxycarbonyl)benzenesulfinic acid |
407-990-7 |
141915-64-2 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
016-070-00-0 |
4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfone |
408-220-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
016-071-00-6 |
trisodium 3-amino-6,13-dichloro-10-((3-((4-chloro-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazinedisulfonate |
410-130-3 |
136248-03-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
016-072-00-1 |
3-amino-4-hydroxy-N-(2-methoxyethyl)-benzenesulfonamide |
411-520-6 |
112195-27-4 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
016-073-00-7 |
tetrakis(phenylmethyl)thioperoxydi(carbothioamide) |
404-310-0 |
10591-85-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
016-074-00-2 |
6-fluoro-2-methyl-3-(4-methylthiobenzyl)indene |
405-410-7 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
016-075-00-8 |
2,2'-diallyl-4,4'-sulfonyldiphenol |
411-570-9 |
41481-66-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
016-076-00-3 |
2,3-bis((2-mercaptoethyl)thio)-1-propanethiol |
411-290-7 |
131538-00-6 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
016-077-00-9 |
2-chloro-p-toluenesulfochloride |
412-890-1 |
42413-03-6 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H314 H317 H412 |
GHS05 GHS07 Dgr |
H314 H317 H412 |
|
|
|
016-078-00-4 |
4-methyl-N, N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)benzenesulfonamide |
413-300-5 |
56187-04-3 |
Aquatic Chronic 4 |
H413 |
— |
|
|
|
|
016-079-00-X |
N, N-bis(2-(p-toluenesulfonyloxy)ethyl)-p-toluenesulfonamide |
412-920-3 |
16695-22-0 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
016-080-00-5 |
sodium 2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzenesulfonate |
412-320-1 |
31361-99-6 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
016-081-00-0 |
hexahydrocyclopenta[c]pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide |
418-350-1 |
— |
Muta. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H302 H319 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H319 H317 H411 |
|
|
|
016-082-00-6 |
ethoxysulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea |
— |
126801-58-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
016-083-00-1 |
acibenzolar-S-methyl; benzo[1,2,3]thiadiazole-7-carbothioic acid S-methyl ester |
420-050-0 |
135158-54-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
016-084-00-7 |
prosulfuron (ISO); 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea |
— |
94125-34-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M=100 |
|
016-085-00-2 |
flazasulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urea |
— |
104040-78-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
016-086-00-8 |
tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate |
402-590-9 |
109125-56-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
016-087-00-3 |
reaction mass of: thiobis(4,1-phenylene)-S, S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate; propylene carbonate |
403-490-8 |
104558-95-4 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H317 H410 |
|
|
|
016-088-00-9 |
4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid |
407-280-7 |
71297-11-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
016-089-00-4 |
reaction mass of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene |
413-840-1 |
— |
Self-react. C **** Aquatic Chronic 4 |
H242 H413 |
GHS02 Dgr |
H242 H413 |
|
|
|
016-090-00-X |
4-methyl-N-(methylsulfonyl)benzenesulfonamide |
415-040-8 |
14653-91-9 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
|
|
|
016-091-00-5 |
C12-14-tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate |
414-110-5 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
016-092-00-0 |
reaction mass of: 4,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 4,8-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 5,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol |
427-050-1 |
— |
Repr. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f H315 H317 H410 |
|
|
|
016-093-00-6 |
reaction mass of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate); 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) (2:1) |
414-770-4 |
140698-96-0 |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
016-094-00-1 |
sulfur |
231-722-6 |
7704-34-9 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
016-095-00-7 |
reaction mass of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2); reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:3) |
417-980-4 |
— |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
016-096-00-2 |
thifensulfuron-methyl (ISO); methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate |
— |
79277-27-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
016-097-00-8 |
1-amino-2-methyl-2-propanethiol hydrochloride |
434-480-1 |
32047-53-3 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H302 H314 H317 H412 |
|
|
|
017-001-00-7 |
chlorine |
231-959-5 |
7782-50-5 |
Ox. Gas 1 Press. Gas Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H270 H331 H319 H335 H315 H400 |
GHS03 GHS04 GHS06 GHS09 Dgr |
H270 H331 H319 H335 H315 H400 |
|
M = 100 |
U |
017-002-00-2 |
hydrogen chloride |
231-595-7 |
7647-01-0 |
Press. Gas Acute Tox. 3 * Skin Corr. 1A |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
|
|
U5 |
017-002-01-X |
hydrochloric acid … % |
231-595-7 |
— |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % EyeIrrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B |
017-003-00-8 |
barium chlorate |
236-760-7 |
13477-00-4 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
|
|
|
017-004-00-3 |
potassium chlorate |
223-289-7 |
3811-04-9 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
|
|
|
017-005-00-9 |
sodium chlorate |
231-887-4 |
7775-09-9 |
Ox. Sol. 1 Acute Tox. 4 * Aquatic Chronic 2 |
H271 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H302 H411 |
|
|
|
017-006-00-4 |
perchloric acid … % |
231-512-4 |
7601-90-3 |
Ox. Liq. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
Skin Corr. 1A; H314: C ≥ 50 % Skin Corr. 1B; H314: 10 % ≤ C < 50 % Skin Irrit. 2; H315: 1 % ≤ C < 10 % Eye Irrit. 2; H319: 1 % ≤ C < 10 % Ox. Liq. 1; H271: C > 50 %: Ox. Liq. 2; H272: C ≤ 50 %: |
B |
017-007-00-X |
barium perchlorate |
236-710-4 |
13465-95-7 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * |
H271 H332 H302 |
GHS03 GHS07 Dgr |
H271 H332 H302 |
|
|
|
017-008-00-5 |
potassium perchlorate |
231-912-9 |
7778-74-7 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
017-009-00-0 |
ammonium perchlorate |
232-235-1 |
7790-98-9 |
Expl. 1.1 Ox. Sol. 1 |
H201 H271 |
GHS01 Dgr |
H201 H271 |
|
|
T |
017-010-00-6 |
sodium perchlorate |
231-511-9 |
7601-89-0 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
017-011-00-1 |
sodium hypochlorite, solution… % Cl active |
231-668-3 |
7681-52-9 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031: C ≥5 % |
B |
017-012-00-7 |
calcium hypochlorite |
231-908-7 |
7778-54-3 |
Ox. Sol. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H272 H302 H314 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H400 |
EUH031 |
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 3 % M = 10 |
T |
017-013-00-2 |
calcium chloride |
233-140-8 |
10043-52-4 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
017-014-00-8 |
ammonium chloride |
235-186-4 |
12125-02-9 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
017-015-00-3 |
(2-(aminomethyl)phenyl)acetylchloride hydrochloride |
417-410-4 |
61807-67-8 |
Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
017-016-00-9 |
methyltriphenylphosphonium chloride |
418-400-2 |
1031-15-8 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H411 |
|
|
|
017-017-00-4 |
(Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride |
426-210-6 |
120086-58-0 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
017-018-00-X |
N, N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride |
405-660-7 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
017-019-00-5 |
(R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride |
415-110-8 |
54417-53-7 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|